From 50fc8781a992eda96b833c196d3e471a480a98e6 Mon Sep 17 00:00:00 2001 From: Jens <1742418+1cu@users.noreply.github.com> Date: Fri, 13 Feb 2026 16:45:52 +0100 Subject: [PATCH] feat: collect timeout timing sessions for diagnostics (#814) --- README.md | 8 +- docs/BROWSER_TROUBLESHOOTING.md | 5 + docs/CONFIGURATION.md | 40 +- src/kleinanzeigen_bot/__init__.py | 17 +- src/kleinanzeigen_bot/extract.py | 2 +- src/kleinanzeigen_bot/model/config_model.py | 4 + .../resources/translations.de.yaml | 13 + .../utils/timing_collector.py | 168 ++++ .../utils/web_scraping_mixin.py | 54 +- tests/smoke/test_smoke_health.py | 12 +- tests/unit/test_timing_collector.py | 204 +++++ tests/unit/test_web_scraping_mixin.py | 725 ++++++++++-------- 12 files changed, 902 insertions(+), 350 deletions(-) create mode 100644 src/kleinanzeigen_bot/utils/timing_collector.py create mode 100644 tests/unit/test_timing_collector.py diff --git a/README.md b/README.md index fad419c..98113a6 100644 --- a/README.md +++ b/README.md @@ -272,7 +272,7 @@ Path resolution rules: - Runtime files are mode-dependent write locations (for example, logfile, update state, browser profile/cache, diagnostics, and downloaded ads). - `--config` selects only the config file; it does not silently switch workspace mode. -- `--workspace-mode=portable`: runtime files are rooted next to the active config file (or the current working directory if no `--config` is supplied). +- `--workspace-mode=portable`: runtime files are placed in the same directory as the active config file (or the current working directory if no `--config` is supplied). - `--workspace-mode=xdg`: runtime files use OS-standard user directories. - `--config` without `--workspace-mode`: mode is inferred from existing footprints; on ambiguity/unknown, the command fails with guidance (for example: `Could not infer workspace mode for --config ...`) and asks you to rerun with `--workspace-mode=portable` or `--workspace-mode=xdg`. @@ -280,7 +280,7 @@ Examples: - `kleinanzeigen-bot --config /sync/dropbox/config1.yaml verify` (no `--workspace-mode`): mode is inferred from detected footprints; if both portable and user-directories footprints are found (or none are found), the command fails and lists the found paths. - `kleinanzeigen-bot --workspace-mode=portable --config /sync/dropbox/config1.yaml verify`: runtime files are rooted at `/sync/dropbox/` (for example `/sync/dropbox/.temp/` and `/sync/dropbox/downloaded-ads/`). -- `kleinanzeigen-bot --workspace-mode=xdg --config /sync/dropbox/config1.yaml verify`: config is read from `/sync/dropbox/config1.yaml`, while runtime files stay in user directories (for example Linux `~/.config/kleinanzeigen-bot/`, `~/.local/state/kleinanzeigen-bot/`, `~/.cache/kleinanzeigen-bot/`). +- `kleinanzeigen-bot --workspace-mode=xdg --config /sync/dropbox/config1.yaml verify`: config is read from `/sync/dropbox/config1.yaml`, while runtime files stay in user directories (on Linux: `~/.config/kleinanzeigen-bot/`, `~/.local/state/kleinanzeigen-bot/`, `~/.cache/kleinanzeigen-bot/`). 1. **Portable mode (recommended for most users, especially on Windows):** @@ -296,11 +296,11 @@ Examples: **OS notes (brief):** -- **Windows:** User directories mode uses AppData (Roaming/Local); portable keeps everything beside the `.exe`. +- **Windows:** User directories mode uses AppData (Roaming/Local); portable keeps everything alongside the `.exe`. - **Linux:** User directories mode uses `~/.config/kleinanzeigen-bot/config.yaml`, `~/.local/state/kleinanzeigen-bot/`, and `~/.cache/kleinanzeigen-bot/`; portable uses `./config.yaml`, `./.temp/`, and `./downloaded-ads/`. - **macOS:** User directories mode uses `~/Library/Application Support/kleinanzeigen-bot/config.yaml` (config), `~/Library/Application Support/kleinanzeigen-bot/` (state/runtime), and `~/Library/Caches/kleinanzeigen-bot/` (cache/diagnostics); portable stays in the current working directory. -If you have mixed legacy footprints (portable + XDG), pass an explicit mode (for example `--workspace-mode=portable`) and then clean up unused files. See [Configuration: Installation Modes](docs/CONFIGURATION.md#installation-modes). +If you have footprints from both modes (portable + XDG), pass an explicit mode (for example `--workspace-mode=portable`) and then clean up unused files. See [Configuration: Installation Modes](docs/CONFIGURATION.md#installation-modes). ### 1) Main configuration ⚙️ diff --git a/docs/BROWSER_TROUBLESHOOTING.md b/docs/BROWSER_TROUBLESHOOTING.md index 539761a..37646ff 100644 --- a/docs/BROWSER_TROUBLESHOOTING.md +++ b/docs/BROWSER_TROUBLESHOOTING.md @@ -78,6 +78,11 @@ The bot will also provide specific instructions on how to fix your configuration 1. Override specific keys under `timeouts` (e.g., `pagination_initial: 20.0`) if only a single selector is problematic. 1. For slow email verification prompts, raise `timeouts.email_verification`. 1. Keep `retry_enabled` on so that DOM lookups are retried with exponential backoff. +1. Attach `timing_data.json` when opening issues so maintainers can tune defaults from real-world timing evidence. + - It is written automatically during runs when `diagnostics.timing_collection` is enabled (default: `true`, see `CONFIGURATION.md`). + - Portable mode path: `./.temp/timing/timing_data.json` + - User directories mode path: `~/.cache/kleinanzeigen-bot/timing/timing_data.json` (Linux), `~/Library/Caches/kleinanzeigen-bot/timing/timing_data.json` (macOS), or `%LOCALAPPDATA%\kleinanzeigen-bot\timing\timing_data.json` (Windows) + - Which one applies depends on your installation mode: portable mode writes next to your config/current directory, user directories mode writes in OS-standard user paths. Check which path exists on your system, or see `CONFIGURATION.md#installation-modes` for mode selection details. ### Issue: Bot fails to detect existing login session diff --git a/docs/CONFIGURATION.md b/docs/CONFIGURATION.md index 508ca0b..9413218 100644 --- a/docs/CONFIGURATION.md +++ b/docs/CONFIGURATION.md @@ -262,6 +262,7 @@ diagnostics: publish: false # Capture screenshot + HTML + JSON on each failed publish attempt (timeouts/protocol errors) capture_log_copy: false # Copy entire bot log file when diagnostics are captured (may duplicate log content) pause_on_login_detection_failure: false # Pause for manual inspection (interactive only) + timing_collection: true # Collect timeout timing data locally for troubleshooting and tuning output_dir: "" # Custom output directory (see "Output locations (default)" below) ``` @@ -309,7 +310,44 @@ The bot uses a layered approach to detect login state, prioritizing stealth over - **User directories mode**: `~/.cache/kleinanzeigen-bot/diagnostics/` (Linux), `~/Library/Caches/kleinanzeigen-bot/diagnostics/` (macOS), or `%LOCALAPPDATA%\kleinanzeigen-bot\Cache\diagnostics\` (Windows) - **Custom**: Path resolved relative to your `config.yaml` if `output_dir` is specified -> **⚠️ PII Warning:** HTML dumps, JSON payloads, and log copies may contain PII. Typical examples include account email, ad titles/descriptions, contact info, and prices. Log copies are produced by `capture_log_copy` when diagnostics capture runs, such as `capture_on.publish` or `capture_on.login_detection`. Review or redact these artifacts before sharing them publicly. +**Timing collection output (default):** + +- **Portable mode**: `./.temp/timing/timing_data.json` +- **User directories mode**: `~/.cache/kleinanzeigen-bot/timing/timing_data.json` (Linux) or `~/Library/Caches/kleinanzeigen-bot/timing/timing_data.json` (macOS) +- Data is grouped by run/session and retained for 30 days via automatic cleanup during each data write + +Example structure: + +```json +[ + { + "session_id": "abc12345", + "command": "publish", + "started_at": "2026-02-07T10:00:00+01:00", + "ended_at": "2026-02-07T10:04:30+01:00", + "records": [ + { + "operation_key": "default", + "operation_type": "web_find", + "effective_timeout_sec": 5.0, + "actual_duration_sec": 1.2, + "attempt_index": 0, + "success": true + } + ] + } +] +``` + +How to read it quickly: + +- Group by `command` and `session_id` first to compare slow vs fast runs +- Look for high `actual_duration_sec` values near `effective_timeout_sec` and repeated `success: false` entries +- `attempt_index` is zero-based (`0` first attempt, `1` first retry) +- Use `operation_key` + `operation_type` to identify which timeout bucket (`default`, `page_load`, etc.) needs tuning +- For deeper timeout tuning workflow, see [Browser Troubleshooting](./BROWSER_TROUBLESHOOTING.md) + +> **⚠️ PII Warning:** HTML dumps, JSON payloads, timing data JSON files (for example `timing_data.json`), and log copies may contain PII. Typical examples include account email, ad titles/descriptions, contact info, and prices. Log copies are produced by `capture_log_copy` when diagnostics capture runs, such as `capture_on.publish` or `capture_on.login_detection`. Review or redact these artifacts before sharing them publicly. ## Installation Modes diff --git a/src/kleinanzeigen_bot/__init__.py b/src/kleinanzeigen_bot/__init__.py index f274d44..fa1ba2e 100644 --- a/src/kleinanzeigen_bot/__init__.py +++ b/src/kleinanzeigen_bot/__init__.py @@ -24,6 +24,7 @@ from .utils.exceptions import CaptchaEncountered from .utils.files import abspath from .utils.i18n import Locale, get_current_locale, pluralize, set_current_locale from .utils.misc import ainput, ensure, is_frozen +from .utils.timing_collector import TimingCollector from .utils.web_scraping_mixin import By, Element, Is, WebScrapingMixin # W0406: possibly a bug, see https://github.com/PyCQA/pylint/issues/3933 @@ -179,13 +180,14 @@ class KleinanzeigenBot(WebScrapingMixin): # noqa: PLR0904 self._log_basename = os.path.splitext(os.path.basename(sys.executable))[0] if is_frozen() else self.__module__ self.log_file_path:str | None = abspath(f"{self._log_basename}.log") self._logfile_arg:str | None = None - self._logfile_explicitly_provided = False + self._logfile_explicitly_provided:bool = False self.command = "help" self.ads_selector = "due" self.keep_old_ads = False self._login_detection_diagnostics_captured:bool = False + self._timing_collector:TimingCollector | None = None def __del__(self) -> None: if self.file_log: @@ -393,6 +395,12 @@ class KleinanzeigenBot(WebScrapingMixin): # noqa: PLR0904 sys.exit(2) finally: self.close_browser_session() + if self._timing_collector is not None: + try: + loop = asyncio.get_running_loop() + await loop.run_in_executor(None, self._timing_collector.flush) + except Exception as exc: # noqa: BLE001 + LOG.warning("Timing collector flush failed: %s", exc) def show_help(self) -> None: if is_frozen(): @@ -613,6 +621,13 @@ class KleinanzeigenBot(WebScrapingMixin): # noqa: PLR0904 config_yaml = dicts.load_dict_if_exists(self.config_file_path, _("config")) self.config = Config.model_validate(config_yaml, strict = True, context = self.config_file_path) + timing_enabled = self.config.diagnostics.timing_collection + if timing_enabled and self.workspace: + timing_dir = self.workspace.diagnostics_dir.parent / "timing" + self._timing_collector = TimingCollector(timing_dir, self.command) + else: + self._timing_collector = None + # load built-in category mappings self.categories = dicts.load_dict_from_module(resources, "categories.yaml", "") LOG.debug("Loaded %s categories from categories.yaml", len(self.categories)) diff --git a/src/kleinanzeigen_bot/extract.py b/src/kleinanzeigen_bot/extract.py index da51f0e..6fa82cd 100644 --- a/src/kleinanzeigen_bot/extract.py +++ b/src/kleinanzeigen_bot/extract.py @@ -43,7 +43,7 @@ class AdExtractor(WebScrapingMixin): super().__init__() self.browser = browser self.config:Config = config - self.download_dir = download_dir + self.download_dir:Path = download_dir self.published_ads_by_id:dict[int, dict[str, Any]] = published_ads_by_id or {} async def download_ad(self, ad_id:int) -> None: diff --git a/src/kleinanzeigen_bot/model/config_model.py b/src/kleinanzeigen_bot/model/config_model.py index 379adc2..0e2d44d 100644 --- a/src/kleinanzeigen_bot/model/config_model.py +++ b/src/kleinanzeigen_bot/model/config_model.py @@ -265,6 +265,10 @@ class DiagnosticsConfig(ContextualModel): default = None, description = "Optional output directory for diagnostics artifacts. If omitted, a safe default is used based on installation mode.", ) + timing_collection:bool = Field( + default = True, + description = "If true, collect local timeout timing data and write it to diagnostics JSON for troubleshooting and tuning.", + ) @model_validator(mode = "before") @classmethod diff --git a/src/kleinanzeigen_bot/resources/translations.de.yaml b/src/kleinanzeigen_bot/resources/translations.de.yaml index 17fc093..1ec4ef2 100644 --- a/src/kleinanzeigen_bot/resources/translations.de.yaml +++ b/src/kleinanzeigen_bot/resources/translations.de.yaml @@ -261,6 +261,7 @@ kleinanzeigen_bot/__init__.py: "You provided no ads selector. Defaulting to \"new\".": "Es wurden keine Anzeigen-Selektor angegeben. Es wird \"new\" verwendet." "You provided no ads selector. Defaulting to \"changed\".": "Es wurden keine Anzeigen-Selektor angegeben. Es wird \"changed\" verwendet." "Unknown command: %s": "Unbekannter Befehl: %s" + "Timing collector flush failed: %s": "Zeitmessdaten konnten nicht gespeichert werden: %s" fill_login_data_and_send: "Logging in as [%s]...": "Anmeldung als [%s]..." @@ -527,6 +528,9 @@ kleinanzeigen_bot/utils/web_scraping_mixin.py: "Last page reached (no enabled 'Naechste' button found).": "Letzte Seite erreicht (kein aktivierter 'Naechste'-Button gefunden)." "No pagination controls found. Assuming last page.": "Keine Paginierungssteuerung gefunden. Es wird von der letzten Seite ausgegangen." + _record_timing: + "Timing collector failed for key=%s operation=%s: %s": "Zeitmessung fehlgeschlagen für key=%s operation=%s: %s" + close_browser_session: "Closing Browser session...": "Schließe Browser-Sitzung..." @@ -685,6 +689,15 @@ kleinanzeigen_bot/utils/diagnostics.py: "Diagnostics capture attempted but no artifacts were saved (all captures failed)": "Diagnoseerfassung versucht, aber keine Artefakte gespeichert (alle Erfassungen fehlgeschlagen)" "Diagnostics capture failed: %s": "Diagnoseerfassung fehlgeschlagen: %s" +################################################# +kleinanzeigen_bot/utils/timing_collector.py: +################################################# + _load_existing_sessions: + "Unable to load timing collection data from %s: %s": "Zeitmessdaten aus %s konnten nicht geladen werden: %s" + + flush: + "Failed to flush timing collection data: %s": "Zeitmessdaten konnten nicht gespeichert werden: %s" + ################################################# kleinanzeigen_bot/utils/xdg_paths.py: ################################################# diff --git a/src/kleinanzeigen_bot/utils/timing_collector.py b/src/kleinanzeigen_bot/utils/timing_collector.py new file mode 100644 index 0000000..8f146ca --- /dev/null +++ b/src/kleinanzeigen_bot/utils/timing_collector.py @@ -0,0 +1,168 @@ +# SPDX-FileCopyrightText: © Jens Bergmann and contributors +# SPDX-License-Identifier: AGPL-3.0-or-later +# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/ + +"""Collect per-operation timeout timings and persist per-run JSON sessions. + +`TimingCollector` records operation durations in seconds, grouped by a single bot run +(`session_id`). Call `record(...)` during runtime and `flush()` once at command end to +append the current session to `timing_data.json` with automatic 30-day retention. +The collector is best-effort and designed for troubleshooting, not strict telemetry. +""" + +from __future__ import annotations + +import json, uuid # isort: skip +import os +from dataclasses import asdict, dataclass +from datetime import timedelta +from typing import TYPE_CHECKING, Any, Final + +if TYPE_CHECKING: + from pathlib import Path + +from kleinanzeigen_bot.utils import loggers, misc + +LOG:Final[loggers.Logger] = loggers.get_logger(__name__) + +RETENTION_DAYS:Final[int] = 30 +TIMING_FILE:Final[str] = "timing_data.json" + + +@dataclass +class TimingRecord: + timestamp:str + operation_key:str + operation_type:str + description:str + configured_timeout_sec:float + effective_timeout_sec:float + actual_duration_sec:float + attempt_index:int + success:bool + + def to_dict(self) -> dict[str, Any]: + return asdict(self) + + +class TimingCollector: + def __init__(self, output_dir:Path, command:str) -> None: + self.output_dir = output_dir.resolve() + self.command = command + self.session_id = uuid.uuid4().hex[:8] + self.started_at = misc.now().isoformat() + self.records:list[TimingRecord] = [] + self._flushed = False + + LOG.debug("Timing collection initialized (session=%s, output_dir=%s, command=%s)", self.session_id, self.output_dir, command) + + def record( + self, + *, + key:str, + operation_type:str, + description:str, + configured_timeout:float, + effective_timeout:float, + actual_duration:float, + attempt_index:int, + success:bool, + ) -> None: + self.records.append( + TimingRecord( + timestamp = misc.now().isoformat(), + operation_key = key, + operation_type = operation_type, + description = description, + configured_timeout_sec = configured_timeout, + effective_timeout_sec = effective_timeout, + actual_duration_sec = actual_duration, + attempt_index = attempt_index, + success = success, + ) + ) + LOG.debug( + "Timing captured: %s [%s] duration=%.3fs timeout=%.3fs success=%s", + operation_type, + key, + actual_duration, + effective_timeout, + success, + ) + + def flush(self) -> Path | None: + if self._flushed: + LOG.debug("Timing collection already flushed for this run") + return None + if not self.records: + LOG.debug("Timing collection enabled but no records captured in this run") + return None + + try: + self.output_dir.mkdir(parents = True, exist_ok = True) + data = self._load_existing_sessions() + data.append( + { + "session_id": self.session_id, + "command": self.command, + "started_at": self.started_at, + "ended_at": misc.now().isoformat(), + "records": [record.to_dict() for record in self.records], + } + ) + + cutoff = misc.now() - timedelta(days = RETENTION_DAYS) + retained:list[dict[str, Any]] = [] + dropped = 0 + for session in data: + try: + parsed = misc.parse_datetime(session.get("started_at"), add_timezone_if_missing = True) + except ValueError: + parsed = None + if parsed is None: + dropped += 1 + continue + if parsed >= cutoff: + retained.append(session) + else: + dropped += 1 + + if dropped > 0: + LOG.debug("Timing collection pruned %d old or malformed sessions", dropped) + + output_file = self.output_dir / TIMING_FILE + temp_file = self.output_dir / f".{TIMING_FILE}.{self.session_id}.tmp" + with temp_file.open("w", encoding = "utf-8") as fd: + json.dump(retained, fd, indent = 2) + fd.write("\n") + fd.flush() + os.fsync(fd.fileno()) + temp_file.replace(output_file) + + LOG.debug( + "Timing collection flushed to %s (%d sessions, %d current records, retention=%d days)", + output_file, + len(retained), + len(self.records), + RETENTION_DAYS, + ) + self.records = [] + self._flushed = True + return output_file + except Exception as exc: # noqa: BLE001 + LOG.warning("Failed to flush timing collection data: %s", exc) + return None + + def _load_existing_sessions(self) -> list[dict[str, Any]]: + file_path = self.output_dir / TIMING_FILE + if not file_path.exists(): + return [] + + try: + with file_path.open(encoding = "utf-8") as fd: + payload = json.load(fd) + if isinstance(payload, list): + return [item for item in payload if isinstance(item, dict)] + except Exception as exc: # noqa: BLE001 + LOG.warning("Unable to load timing collection data from %s: %s", file_path, exc) + return [] diff --git a/src/kleinanzeigen_bot/utils/web_scraping_mixin.py b/src/kleinanzeigen_bot/utils/web_scraping_mixin.py index f81e7ff..d354866 100644 --- a/src/kleinanzeigen_bot/utils/web_scraping_mixin.py +++ b/src/kleinanzeigen_bot/utils/web_scraping_mixin.py @@ -183,6 +183,36 @@ class WebScrapingMixin: # Always perform the initial attempt plus the configured number of retries. return 1 + cfg.retry_max_attempts + def _record_timing( + self, + *, + key:str, + description:str, + configured_timeout:float, + effective_timeout:float, + actual_duration:float, + attempt_index:int, + success:bool, + ) -> None: + collector = getattr(self, "_timing_collector", None) + if collector is None: + return + + operation_type = description.split("(", 1)[0] if "(" in description else description + try: + collector.record( + key = key, + operation_type = operation_type, + description = description, + configured_timeout = configured_timeout, + effective_timeout = effective_timeout, + actual_duration = actual_duration, + attempt_index = attempt_index, + success = success, + ) + except Exception as exc: # noqa: BLE001 + LOG.warning("Timing collector failed for key=%s operation=%s: %s", key, operation_type, exc) + async def _run_with_timeout_retries( self, operation:Callable[[float], Awaitable[T]], *, description:str, key:str = "default", override:float | None = None ) -> T: @@ -190,12 +220,34 @@ class WebScrapingMixin: Execute an async callable with retry/backoff handling for TimeoutError. """ attempts = self._timeout_attempts() + configured_timeout = self._timeout(key, override) + loop = asyncio.get_running_loop() for attempt in range(attempts): effective_timeout = self._effective_timeout(key, override, attempt = attempt) + attempt_started = loop.time() try: - return await operation(effective_timeout) + result = await operation(effective_timeout) + self._record_timing( + key = key, + description = description, + configured_timeout = configured_timeout, + effective_timeout = effective_timeout, + actual_duration = loop.time() - attempt_started, + attempt_index = attempt, + success = True, + ) + return result except TimeoutError: + self._record_timing( + key = key, + description = description, + configured_timeout = configured_timeout, + effective_timeout = effective_timeout, + actual_duration = loop.time() - attempt_started, + attempt_index = attempt, + success = False, + ) if attempt >= attempts - 1: raise LOG.debug("Retrying %s after TimeoutError (attempt %d/%d, timeout %.1fs)", description, attempt + 1, attempts, effective_timeout) diff --git a/tests/smoke/test_smoke_health.py b/tests/smoke/test_smoke_health.py index 1fec612..10b13e8 100644 --- a/tests/smoke/test_smoke_health.py +++ b/tests/smoke/test_smoke_health.py @@ -96,12 +96,12 @@ def invoke_cli( set_current_locale(previous_locale) -def _xdg_env_overrides(tmp_path:Path) -> dict[str, str]: - """Create temporary HOME/XDG environment overrides for isolated smoke test runs.""" - home = tmp_path / "home" - xdg_config = tmp_path / "xdg" / "config" - xdg_state = tmp_path / "xdg" / "state" - xdg_cache = tmp_path / "xdg" / "cache" +def _xdg_env_overrides(base_path:Path) -> dict[str, str]: + """Create temporary HOME/XDG environment overrides rooted at the provided base path.""" + home = base_path / "home" + xdg_config = base_path / "xdg" / "config" + xdg_state = base_path / "xdg" / "state" + xdg_cache = base_path / "xdg" / "cache" for path in (home, xdg_config, xdg_state, xdg_cache): path.mkdir(parents = True, exist_ok = True) return { diff --git a/tests/unit/test_timing_collector.py b/tests/unit/test_timing_collector.py new file mode 100644 index 0000000..c0febb2 --- /dev/null +++ b/tests/unit/test_timing_collector.py @@ -0,0 +1,204 @@ +# SPDX-FileCopyrightText: © Jens Bergmann and contributors +# SPDX-License-Identifier: AGPL-3.0-or-later +# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/ + +import json +from datetime import timedelta +from pathlib import Path +from unittest.mock import patch + +import pytest + +from kleinanzeigen_bot.utils import misc +from kleinanzeigen_bot.utils.timing_collector import RETENTION_DAYS, TimingCollector + +pytestmark = pytest.mark.unit + + +class TestTimingCollector: + def test_output_dir_resolves_to_given_path(self, tmp_path:Path) -> None: + collector = TimingCollector(tmp_path / "xdg-cache" / "timing", "publish") + + assert collector.output_dir == (tmp_path / "xdg-cache" / "timing").resolve() + + def test_flush_writes_session_data(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + collector = TimingCollector(tmp_path / ".temp" / "timing", "publish") + collector.record( + key = "default", + operation_type = "web_find", + description = "web_find(ID, submit)", + configured_timeout = 5.0, + effective_timeout = 5.0, + actual_duration = 0.4, + attempt_index = 0, + success = True, + ) + + file_path = collector.flush() + + assert file_path is not None + assert file_path.exists() + + data = json.loads(file_path.read_text(encoding = "utf-8")) + assert isinstance(data, list) + assert len(data) == 1 + assert data[0]["command"] == "publish" + assert len(data[0]["records"]) == 1 + assert data[0]["records"][0]["operation_key"] == "default" + + def test_flush_prunes_old_and_malformed_sessions(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + + output_dir = tmp_path / ".temp" / "timing" + output_dir.mkdir(parents = True, exist_ok = True) + data_path = output_dir / "timing_data.json" + + old_started = (misc.now() - timedelta(days = RETENTION_DAYS + 1)).isoformat() + recent_started = (misc.now() - timedelta(days = 2)).isoformat() + + existing_payload = [ + { + "session_id": "old-session", + "command": "publish", + "started_at": old_started, + "ended_at": old_started, + "records": [], + }, + { + "session_id": "recent-session", + "command": "publish", + "started_at": recent_started, + "ended_at": recent_started, + "records": [], + }, + { + "session_id": "malformed-session", + "command": "publish", + "started_at": "not-a-datetime", + "ended_at": "not-a-datetime", + "records": [], + }, + ] + data_path.write_text(json.dumps(existing_payload), encoding = "utf-8") + + collector = TimingCollector(tmp_path / ".temp" / "timing", "verify") + collector.record( + key = "default", + operation_type = "web_find", + description = "web_find(ID, submit)", + configured_timeout = 5.0, + effective_timeout = 5.0, + actual_duration = 0.2, + attempt_index = 0, + success = True, + ) + + file_path = collector.flush() + + assert file_path is not None + data = json.loads(file_path.read_text(encoding = "utf-8")) + session_ids = [session["session_id"] for session in data] + assert "old-session" not in session_ids + assert "malformed-session" not in session_ids + assert "recent-session" in session_ids + assert collector.session_id in session_ids + + def test_flush_returns_none_when_already_flushed(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + collector = TimingCollector(tmp_path / ".temp" / "timing", "publish") + collector.record( + key = "default", + operation_type = "web_find", + description = "web_find(ID, submit)", + configured_timeout = 5.0, + effective_timeout = 5.0, + actual_duration = 0.1, + attempt_index = 0, + success = True, + ) + + first = collector.flush() + second = collector.flush() + + assert first is not None + assert second is None + + def test_flush_returns_none_when_no_records(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + collector = TimingCollector(tmp_path / ".temp" / "timing", "publish") + + assert collector.flush() is None + + def test_flush_recovers_from_corrupted_json(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + + output_dir = tmp_path / ".temp" / "timing" + output_dir.mkdir(parents = True, exist_ok = True) + data_path = output_dir / "timing_data.json" + data_path.write_text("{ this is invalid json", encoding = "utf-8") + + collector = TimingCollector(tmp_path / ".temp" / "timing", "verify") + collector.record( + key = "default", + operation_type = "web_find", + description = "web_find(ID, submit)", + configured_timeout = 5.0, + effective_timeout = 5.0, + actual_duration = 0.1, + attempt_index = 0, + success = True, + ) + + file_path = collector.flush() + + assert file_path is not None + payload = json.loads(file_path.read_text(encoding = "utf-8")) + assert isinstance(payload, list) + assert len(payload) == 1 + assert payload[0]["session_id"] == collector.session_id + + def test_flush_ignores_non_list_payload(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + + output_dir = tmp_path / ".temp" / "timing" + output_dir.mkdir(parents = True, exist_ok = True) + data_path = output_dir / "timing_data.json" + data_path.write_text(json.dumps({"unexpected": "shape"}), encoding = "utf-8") + + collector = TimingCollector(tmp_path / ".temp" / "timing", "verify") + collector.record( + key = "default", + operation_type = "web_find", + description = "web_find(ID, submit)", + configured_timeout = 5.0, + effective_timeout = 5.0, + actual_duration = 0.1, + attempt_index = 0, + success = True, + ) + + file_path = collector.flush() + + assert file_path is not None + payload = json.loads(file_path.read_text(encoding = "utf-8")) + assert isinstance(payload, list) + assert len(payload) == 1 + assert payload[0]["session_id"] == collector.session_id + + def test_flush_returns_none_when_write_raises(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: + monkeypatch.chdir(tmp_path) + collector = TimingCollector(tmp_path / ".temp" / "timing", "verify") + collector.record( + key = "default", + operation_type = "web_find", + description = "web_find(ID, submit)", + configured_timeout = 5.0, + effective_timeout = 5.0, + actual_duration = 0.1, + attempt_index = 0, + success = True, + ) + + with patch.object(Path, "mkdir", side_effect = OSError("cannot create dir")): + assert collector.flush() is None diff --git a/tests/unit/test_web_scraping_mixin.py b/tests/unit/test_web_scraping_mixin.py index c18c483..f3a835f 100644 --- a/tests/unit/test_web_scraping_mixin.py +++ b/tests/unit/test_web_scraping_mixin.py @@ -31,6 +31,7 @@ from kleinanzeigen_bot.utils.web_scraping_mixin import By, Is, WebScrapingMixin, class ConfigProtocol(Protocol): """Protocol for Config objects used in tests.""" + extensions:list[str] browser_args:list[str] user_data_dir:str | None @@ -44,6 +45,23 @@ def _nodriver_start_mock() -> Mock: return cast(Mock, cast(Any, nodriver).start) +class RecordingCollector: + """Helper collector that stores timing records for assertions.""" + + def __init__(self, sink:list[dict[str, Any]]) -> None: + self._sink = sink + + def record(self, **kwargs:Any) -> None: + self._sink.append(kwargs) + + +class FailingCollector: + """Helper collector that raises to test error handling.""" + + def record(self, **kwargs:Any) -> None: + raise RuntimeError("collector failed") + + class TrulyAwaitableMockPage: """A helper to make a mock Page object truly awaitable for tests.""" @@ -271,7 +289,7 @@ class TestWebScrapingErrorHandling: input_field.send_keys.assert_awaited_once_with(special_value) # Verify that the JavaScript received properly escaped value call_args = dropdown_elem.apply.call_args[0][0] - assert '"quotes"' in call_args or r'\"quotes\"' in call_args # JSON escaping should handle quotes + assert '"quotes"' in call_args or r"\"quotes\"" in call_args # JSON escaping should handle quotes @pytest.mark.asyncio async def test_web_select_by_value(self, web_scraper:WebScrapingMixin) -> None: @@ -336,7 +354,9 @@ class TestWebScrapingErrorHandling: await web_scraper.web_open("https://example.com", timeout = 0.1) @pytest.mark.asyncio - async def test_web_open_skip_when_url_already_loaded(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> None: + async def test_web_open_skip_when_url_already_loaded( + self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage + ) -> None: """web_open should short-circuit when the requested URL is already active.""" mock_browser.get.reset_mock() mock_page.url = "https://example.com" @@ -402,8 +422,7 @@ class TestWebScrapingErrorHandling: recorded:list[tuple[float, bool]] = [] - async def fake_web_await(condition:Callable[[], object], *, timeout:float, timeout_error_message:str = "", - apply_multiplier:bool = True) -> Element: + async def fake_web_await(condition:Callable[[], object], *, timeout:float, timeout_error_message:str = "", apply_multiplier:bool = True) -> Element: recorded.append((timeout, apply_multiplier)) raise TimeoutError(timeout_error_message or "timeout") @@ -420,10 +439,12 @@ class TestTimeoutAndRetryHelpers: def test_get_timeout_config_prefers_config_timeouts(self, web_scraper:WebScrapingMixin) -> None: """_get_timeout_config should return the config-provided timeout model when available.""" - custom_config = Config.model_validate({ - "login": {"username": "user@example.com", "password": "secret"}, # noqa: S105 - "timeouts": {"default": 7.5} - }) + custom_config = Config.model_validate( + { + "login": {"username": "user@example.com", "password": "secret"}, # noqa: S105 + "timeouts": {"default": 7.5}, + } + ) web_scraper.config = custom_config assert web_scraper._get_timeout_config() is custom_config.timeouts @@ -454,14 +475,65 @@ class TestTimeoutAndRetryHelpers: assert result == "done" assert len(attempts) == 2 + @pytest.mark.asyncio + async def test_run_with_timeout_retries_records_success_timing(self, web_scraper:WebScrapingMixin) -> None: + """_run_with_timeout_retries should emit a timing record for successful attempts.""" + recorded:list[dict[str, Any]] = [] + cast(Any, web_scraper)._timing_collector = RecordingCollector(recorded) + + async def operation(_timeout:float) -> str: + return "ok" + + result = await web_scraper._run_with_timeout_retries(operation, description = "web_find(ID, test)") + + assert result == "ok" + assert len(recorded) == 1 + assert recorded[0]["operation_type"] == "web_find" + assert recorded[0]["success"] is True + assert recorded[0]["attempt_index"] == 0 + + @pytest.mark.asyncio + async def test_run_with_timeout_retries_records_timeout_timing(self, web_scraper:WebScrapingMixin) -> None: + """_run_with_timeout_retries should emit timing records for timed out attempts.""" + recorded:list[dict[str, Any]] = [] + cast(Any, web_scraper)._timing_collector = RecordingCollector(recorded) + web_scraper.config.timeouts.retry_max_attempts = 1 + + async def always_timeout(_timeout:float) -> str: + raise TimeoutError("boom") + + with pytest.raises(TimeoutError, match = "boom"): + await web_scraper._run_with_timeout_retries(always_timeout, description = "web_find(ID, test)") + + assert len(recorded) == 2 + assert all(entry["operation_type"] == "web_find" for entry in recorded) + assert all(entry["success"] is False for entry in recorded) + assert recorded[0]["attempt_index"] == 0 + assert recorded[1]["attempt_index"] == 1 + + @pytest.mark.asyncio + async def test_run_with_timeout_retries_ignores_collector_failure(self, web_scraper:WebScrapingMixin) -> None: + """_run_with_timeout_retries should continue when timing collector record fails.""" + cast(Any, web_scraper)._timing_collector = FailingCollector() + + async def operation(_timeout:float) -> str: + return "ok" + + result = await web_scraper._run_with_timeout_retries(operation, description = "web_find(ID, test)") + + assert result == "ok" + @pytest.mark.asyncio async def test_run_with_timeout_retries_guard_clause(self, web_scraper:WebScrapingMixin) -> None: """_run_with_timeout_retries should guard against zero-attempt edge cases.""" + async def never_called(timeout:float) -> None: pytest.fail("operation should not run when attempts are zero") - with patch.object(web_scraper, "_timeout_attempts", return_value = 0), \ - pytest.raises(TimeoutError, match = "guarded-op failed without executing operation"): + with ( + patch.object(web_scraper, "_timeout_attempts", return_value = 0), + pytest.raises(TimeoutError, match = "guarded-op failed without executing operation"), + ): await web_scraper._run_with_timeout_retries(never_called, description = "guarded-op") @@ -476,15 +548,9 @@ class TestSelectorTimeoutMessages: (By.CSS_SELECTOR, ".hero", "No HTML element found using CSS selector '.hero' within 2.0 seconds."), (By.TEXT, "Submit", "No HTML element found containing text 'Submit' within 2.0 seconds."), (By.XPATH, "//div[@class='hero']", "No HTML element found using XPath '//div[@class='hero']' within 2.0 seconds."), - ] + ], ) - async def test_web_find_timeout_suffixes( - self, - web_scraper:WebScrapingMixin, - selector_type:By, - selector_value:str, - expected_message:str - ) -> None: + async def test_web_find_timeout_suffixes(self, web_scraper:WebScrapingMixin, selector_type:By, selector_value:str, expected_message:str) -> None: """web_find should pass descriptive timeout messages for every selector strategy.""" mock_element = AsyncMock(spec = Element) mock_wait = AsyncMock(return_value = mock_element) @@ -506,14 +572,10 @@ class TestSelectorTimeoutMessages: (By.TAG_NAME, "article", "No HTML elements found of tag
within 1 seconds."), (By.TEXT, "Listings", "No HTML elements found containing text 'Listings' within 1 seconds."), (By.XPATH, "//footer", "No HTML elements found using XPath '//footer' within 1 seconds."), - ] + ], ) async def test_web_find_all_once_timeout_suffixes( - self, - web_scraper:WebScrapingMixin, - selector_type:By, - selector_value:str, - expected_message:str + self, web_scraper:WebScrapingMixin, selector_type:By, selector_value:str, expected_message:str ) -> None: """_web_find_all_once should surface informative timeout errors for each selector.""" elements = [AsyncMock(spec = Element)] @@ -674,12 +736,7 @@ class TestWebScrolling: # Expect four scrollTo operations: two down, two up assert scripts.count("document.body.scrollHeight") == 1 scroll_calls = [script for script in scripts if script.startswith("window.scrollTo")] - assert scroll_calls == [ - "window.scrollTo(0, 10)", - "window.scrollTo(0, 20)", - "window.scrollTo(0, 10)", - "window.scrollTo(0, 0)" - ] + assert scroll_calls == ["window.scrollTo(0, 10)", "window.scrollTo(0, 20)", "window.scrollTo(0, 10)", "window.scrollTo(0, 0)"] sleep_durations = [call.args[0] for call in mock_sleep.await_args_list] assert sleep_durations == [1.0, 1.0, 0.5, 0.5] @@ -838,6 +895,7 @@ class TestWebScrapingBrowserConfiguration: @pytest.mark.asyncio async def test_browser_profile_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: """Test browser profile configuration and preferences handling.""" + class DummyConfig: def __init__(self, **kwargs:object) -> None: self.browser_args:list[str] = [] @@ -889,7 +947,7 @@ class TestWebScrapingBrowserConfiguration: "C:\\Users\\runneradmin\\AppData\\Local\\Chromium\\Application\\chrome.exe", "C:\\Program Files\\Chrome\\Application\\chrome.exe", "C:\\Program Files (x86)\\Chrome\\Application\\chrome.exe", - "C:\\Users\\runneradmin\\AppData\\Local\\Chrome\\Application\\chrome.exe" + "C:\\Users\\runneradmin\\AppData\\Local\\Chrome\\Application\\chrome.exe", }: return True if "Preferences" in str(path) and str(tmp_path) in str(path): @@ -934,6 +992,7 @@ class TestWebScrapingBrowserConfiguration: @pytest.mark.asyncio async def test_browser_arguments_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: """Test browser arguments configuration.""" + class DummyConfig: def __init__(self, **kwargs:object) -> None: self.browser_args:list[str] = [] @@ -960,6 +1019,7 @@ class TestWebScrapingBrowserConfiguration: async def mock_exists_async(path:str | Path) -> bool: return str(path) in {"/usr/bin/chrome", "/usr/bin/edge"} + monkeypatch.setattr(files, "exists", mock_exists_async) # Test with custom arguments @@ -1077,6 +1137,7 @@ class TestWebScrapingBrowserConfiguration: @pytest.mark.asyncio async def test_browser_extension_loading(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: """Test browser extension loading.""" + class DummyConfig: def __init__(self, **kwargs:object) -> None: self.browser_args:list[str] = [] @@ -1157,12 +1218,8 @@ class TestWebScrapingBrowserConfiguration: # Test Linux with multiple browser options def which_mock(x:str) -> str | None: - return { - "chromium": "/usr/bin/chromium", - "chromium-browser": None, - "google-chrome": None, - "microsoft-edge": None - }.get(x) + return {"chromium": "/usr/bin/chromium", "chromium-browser": None, "google-chrome": None, "microsoft-edge": None}.get(x) + monkeypatch.setattr(platform, "system", lambda: "Linux") monkeypatch.setattr(shutil, "which", which_mock) monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chromium") @@ -1215,6 +1272,7 @@ class TestWebScrapingBrowserConfiguration: @pytest.mark.asyncio async def test_session_state_persistence(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: """Test that session state persists across browser restarts when user_data_dir is set.""" + # DummyConfig to simulate browser config class DummyConfig: def __init__(self, **kwargs:object) -> None: @@ -1269,6 +1327,7 @@ class TestWebScrapingBrowserConfiguration: @pytest.mark.asyncio async def test_session_creation_error_cleanup(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: """Test that resources are cleaned up when session creation fails.""" + class DummyConfig: def __init__(self, **kwargs:object) -> None: self.browser_args:list[str] = [] @@ -1336,6 +1395,7 @@ class TestWebScrapingBrowserConfiguration: @pytest.mark.asyncio async def test_external_process_termination(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None: """Test handling of external browser process termination.""" + class DummyConfig: def __init__(self, **kwargs:object) -> None: self.browser_args:list[str] = [] @@ -1427,8 +1487,7 @@ class TestWebScrapingDiagnostics: def test_diagnose_browser_issues_binary_exists_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when browser binary exists and is executable.""" - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True): + with patch("os.path.exists", return_value = True), patch("os.access", return_value = True): scraper_with_config.browser_config.binary_location = "/usr/bin/chrome" scraper_with_config.diagnose_browser_issues() @@ -1437,8 +1496,7 @@ class TestWebScrapingDiagnostics: def test_diagnose_browser_issues_binary_exists_not_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when browser binary exists but is not executable.""" - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = False): + with patch("os.path.exists", return_value = True), patch("os.access", return_value = False): scraper_with_config.browser_config.binary_location = "/usr/bin/chrome" scraper_with_config.diagnose_browser_issues() @@ -1470,13 +1528,15 @@ class TestWebScrapingDiagnostics: assert "(fail) No compatible browser found" in caplog.text def test_diagnose_browser_issues_user_data_dir_exists_readable( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path ) -> None: """Test diagnostic when user data directory exists and is readable/writable.""" test_dir = str(tmp_path / "chrome-profile") - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.browser_config.user_data_dir = test_dir scraper_with_config.diagnose_browser_issues() @@ -1484,13 +1544,15 @@ class TestWebScrapingDiagnostics: assert "(ok) User data directory is readable and writable" in caplog.text def test_diagnose_browser_issues_user_data_dir_exists_not_readable( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path ) -> None: """Test diagnostic when user data directory exists but is not readable/writable.""" test_dir = str(tmp_path / "chrome-profile") - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.browser_config.user_data_dir = test_dir scraper_with_config.diagnose_browser_issues() @@ -1498,22 +1560,24 @@ class TestWebScrapingDiagnostics: assert "(fail) User data directory permissions issue" in caplog.text def test_diagnose_browser_issues_user_data_dir_not_exists( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path ) -> None: """Test diagnostic when user data directory does not exist.""" test_dir = str(tmp_path / "chrome-profile") - with patch("os.path.exists", side_effect = lambda path: path != test_dir), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", side_effect = lambda path: path != test_dir), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.browser_config.user_data_dir = test_dir scraper_with_config.diagnose_browser_issues() assert f"(info) User data directory does not exist (will be created): {test_dir}" in caplog.text def test_diagnose_browser_issues_remote_debugging_port_configured_open( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture + ) -> None: """Test diagnostic when remote debugging port is configured and open.""" - with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen") as mock_urlopen: + with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), patch("urllib.request.urlopen") as mock_urlopen: mock_response = Mock() mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}' mock_urlopen.return_value = mock_response @@ -1526,10 +1590,13 @@ class TestWebScrapingDiagnostics: assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text def test_diagnose_browser_issues_remote_debugging_port_configured_open_api_fails( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture + ) -> None: """Test diagnostic when remote debugging port is open but API is not accessible.""" - with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen", side_effect = Exception("Connection refused")): + with ( + patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), + patch("urllib.request.urlopen", side_effect = Exception("Connection refused")), + ): scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"] scraper_with_config.diagnose_browser_issues() @@ -1539,7 +1606,8 @@ class TestWebScrapingDiagnostics: assert "This might indicate a browser update issue or configuration problem" in caplog.text def test_diagnose_browser_issues_remote_debugging_port_configured_closed( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture + ) -> None: """Test diagnostic when remote debugging port is configured but closed.""" with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False): scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"] @@ -1549,7 +1617,8 @@ class TestWebScrapingDiagnostics: assert "(info) Remote debugging port is not open" in caplog.text def test_diagnose_browser_issues_remote_debugging_port_not_configured( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture + ) -> None: """Test diagnostic when remote debugging port is not configured.""" scraper_with_config.browser_config.arguments = ["--other-arg"] scraper_with_config.diagnose_browser_issues() @@ -1565,11 +1634,13 @@ class TestWebScrapingDiagnostics: Mock(info = {"pid": 1234, "name": "chrome", "cmdline": ["/usr/bin/chrome"]}), Mock(info = {"pid": 5678, "name": "chromium", "cmdline": ["/usr/bin/chromium"]}), Mock(info = {"pid": 9012, "name": "edge", "cmdline": ["/usr/bin/edge"]}), - Mock(info = {"pid": 3456, "name": "chrome", "cmdline": ["/usr/bin/chrome", "--remote-debugging-port=9222"]}) + Mock(info = {"pid": 3456, "name": "chrome", "cmdline": ["/usr/bin/chrome", "--remote-debugging-port=9222"]}), ] - with patch("psutil.process_iter", return_value = mock_processes), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("psutil.process_iter", return_value = mock_processes), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() # Should find 2 chrome processes (target browser), one with debugging, one without @@ -1586,7 +1657,7 @@ class TestWebScrapingDiagnostics: @patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info") def test_diagnose_browser_issues_macos_platform_with_user_data_dir( - self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path + self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path ) -> None: """Test diagnostic on macOS platform with user data directory.""" test_dir = str(tmp_path / "chrome-profile") @@ -1594,14 +1665,9 @@ class TestWebScrapingDiagnostics: # Setup mock for Chrome 136+ detection with valid configuration mock_get_diagnostic.return_value = { "binary_detection": None, - "remote_detection": { - "version_string": "136.0.6778.0", - "major_version": 136, - "browser_name": "Chrome", - "is_chrome_136_plus": True - }, + "remote_detection": {"version_string": "136.0.6778.0", "major_version": 136, "browser_name": "Chrome", "is_chrome_136_plus": True}, "chrome_136_plus_detected": True, - "recommendations": [] + "recommendations": [], } # Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run @@ -1610,13 +1676,14 @@ class TestWebScrapingDiagnostics: del os.environ["PYTEST_CURRENT_TEST"] try: - with patch("platform.system", return_value = "Darwin"), \ - patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen") as mock_urlopen, \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): - + with ( + patch("platform.system", return_value = "Darwin"), + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), + patch("urllib.request.urlopen") as mock_urlopen, + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): # Mock Chrome 136+ detection from remote debugging mock_response = Mock() mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}' @@ -1636,9 +1703,11 @@ class TestWebScrapingDiagnostics: def test_diagnose_browser_issues_linux_platform_not_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic on Linux platform when not running as root.""" - with patch("platform.system", return_value = "Linux"), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False): + with ( + patch("platform.system", return_value = "Linux"), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + ): scraper_with_config.diagnose_browser_issues() # Linux platform detection was removed - no specific message expected @@ -1648,9 +1717,11 @@ class TestWebScrapingDiagnostics: def test_diagnose_browser_issues_linux_platform_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic on Linux platform when running as root.""" - with patch("platform.system", return_value = "Linux"), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True): + with ( + patch("platform.system", return_value = "Linux"), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True), + ): scraper_with_config.diagnose_browser_issues() # Linux platform detection was removed - no specific message expected @@ -1659,8 +1730,10 @@ class TestWebScrapingDiagnostics: def test_diagnose_browser_issues_unknown_platform(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic on unknown platform.""" - with patch("platform.system", return_value = "UnknownOS"), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("platform.system", return_value = "UnknownOS"), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() # Should not show any platform-specific messages @@ -1670,28 +1743,25 @@ class TestWebScrapingDiagnostics: def test_diagnose_browser_issues_macos_remote_debugging_instructions(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic shows macOS-specific remote debugging instructions.""" - with patch("platform.system", return_value = "Darwin"), \ - patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("platform.system", return_value = "Darwin"), + patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"] scraper_with_config.diagnose_browser_issues() @patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info") def test_diagnose_browser_issues_chrome_136_plus_misconfigured( - self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture + self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture ) -> None: """Test diagnostic when Chrome 136+ is detected but user data directory is not configured.""" # Setup mock for Chrome 136+ detection with invalid configuration mock_get_diagnostic.return_value = { "binary_detection": None, - "remote_detection": { - "version_string": "136.0.6778.0", - "major_version": 136, - "browser_name": "Chrome", - "is_chrome_136_plus": True - }, + "remote_detection": {"version_string": "136.0.6778.0", "major_version": 136, "browser_name": "Chrome", "is_chrome_136_plus": True}, "chrome_136_plus_detected": True, - "recommendations": [] + "recommendations": [], } # Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run @@ -1700,10 +1770,11 @@ class TestWebScrapingDiagnostics: del os.environ["PYTEST_CURRENT_TEST"] try: - with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen") as mock_urlopen, \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): - + with ( + patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), + patch("urllib.request.urlopen") as mock_urlopen, + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): # Mock Chrome 136+ detection from remote debugging mock_response = Mock() mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}' @@ -1725,18 +1796,19 @@ class TestWebScrapingDiagnostics: os.environ["PYTEST_CURRENT_TEST"] = original_env def test_diagnose_browser_issues_complete_diagnostic_flow( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path ) -> None: """Test complete diagnostic flow with all components.""" test_dir = str(tmp_path / "chrome-profile") - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen") as mock_urlopen, \ - patch("psutil.process_iter", return_value = []), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False): - + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), + patch("urllib.request.urlopen") as mock_urlopen, + patch("psutil.process_iter", return_value = []), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + ): mock_response = Mock() mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}' mock_urlopen.return_value = mock_response @@ -1761,169 +1833,168 @@ class TestWebScrapingDiagnostics: assert "Linux detected" not in caplog.text assert "=== End Diagnostics ===" in caplog.text - def test_diagnose_browser_issues_remote_debugging_host_configured( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_remote_debugging_host_configured(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when remote debugging host is configured.""" - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen") as mock_urlopen, \ - patch("psutil.process_iter", return_value = []), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), + patch("urllib.request.urlopen") as mock_urlopen, + patch("psutil.process_iter", return_value = []), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): mock_response = Mock() mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}' mock_urlopen.return_value = mock_response - scraper_with_config.browser_config.arguments = [ - "--remote-debugging-host=192.168.1.100", - "--remote-debugging-port=9222" - ] + scraper_with_config.browser_config.arguments = ["--remote-debugging-host=192.168.1.100", "--remote-debugging-port=9222"] scraper_with_config.diagnose_browser_issues() assert "(info) Remote debugging port configured: 9222" in caplog.text assert "(ok) Remote debugging port is open" in caplog.text - def test_diagnose_browser_issues_process_info_missing_name( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_process_info_missing_name(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when process info is missing name.""" mock_process = Mock() mock_process.info = {"pid": 1234, "name": None, "cmdline": []} - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("psutil.process_iter", return_value = [mock_process]), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("psutil.process_iter", return_value = [mock_process]), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() assert "(info) No browser processes currently running" in caplog.text - def test_diagnose_browser_issues_psutil_exception_handling( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_psutil_exception_handling(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when psutil raises an exception during process iteration.""" # Mock psutil.process_iter to return a list that will cause an exception when accessing proc.info mock_process = Mock() mock_process.info = {"name": "chrome"} mock_processes = [mock_process] - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("psutil.process_iter", return_value = mock_processes), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \ - patch.object(mock_process, "info", side_effect = psutil.AccessDenied): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("psutil.process_iter", return_value = mock_processes), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + patch.object(mock_process, "info", side_effect = psutil.AccessDenied), + ): scraper_with_config.diagnose_browser_issues() # Should handle the exception gracefully and continue assert "=== Browser Connection Diagnostics ===" in caplog.text assert "=== End Diagnostics ===" in caplog.text - def test_diagnose_browser_issues_browser_not_executable( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_browser_not_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when browser binary exists but is not executable.""" scraper_with_config.browser_config.binary_location = "/usr/bin/chrome" - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = False), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch("psutil.process_iter", return_value = []): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = False), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch("psutil.process_iter", return_value = []), + ): scraper_with_config.diagnose_browser_issues() assert "(fail) Browser binary is not executable" in caplog.text - def test_diagnose_browser_issues_browser_not_found( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_browser_not_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when browser binary does not exist.""" scraper_with_config.browser_config.binary_location = "/usr/bin/chrome" - with patch("os.path.exists", return_value = False), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch("psutil.process_iter", return_value = []): + with ( + patch("os.path.exists", return_value = False), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch("psutil.process_iter", return_value = []), + ): scraper_with_config.diagnose_browser_issues() assert "(fail) Browser binary not found:" in caplog.text - def test_diagnose_browser_issues_no_browser_auto_detection( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_no_browser_auto_detection(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when no browser binary is configured and auto-detection fails.""" scraper_with_config.browser_config.binary_location = None - with patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch("psutil.process_iter", return_value = []), \ - patch.object(scraper_with_config, "get_compatible_browser", side_effect = AssertionError("No browser found")): + with ( + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch("psutil.process_iter", return_value = []), + patch.object(scraper_with_config, "get_compatible_browser", side_effect = AssertionError("No browser found")), + ): scraper_with_config.diagnose_browser_issues() - assert "(fail) No compatible browser found" in caplog.text + assert "(fail) No compatible browser found" in caplog.text def test_diagnose_browser_issues_user_data_dir_permissions_issue( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path + self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path ) -> None: """Test diagnostic when user data directory has permission issues.""" test_dir = str(tmp_path / "chrome-profile") scraper_with_config.browser_config.user_data_dir = test_dir - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = False), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = False), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() assert "(fail) User data directory permissions issue" in caplog.text - def test_diagnose_browser_issues_remote_debugging_api_inaccessible( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_remote_debugging_api_inaccessible(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when remote debugging port is open but API is not accessible.""" scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"] - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \ - patch("urllib.request.urlopen", side_effect = Exception("Connection refused")), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), + patch("urllib.request.urlopen", side_effect = Exception("Connection refused")), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() assert "(fail) Remote debugging port is open but API not accessible" in caplog.text assert "This might indicate a browser update issue or configuration problem" in caplog.text - def test_diagnose_browser_issues_macos_chrome_warning( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_macos_chrome_warning(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when macOS Chrome remote debugging is configured without user_data_dir.""" scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"] scraper_with_config.browser_config.user_data_dir = None - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("psutil.process_iter", return_value = []), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \ - patch("platform.system", return_value = "Darwin"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("psutil.process_iter", return_value = []), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), + patch("platform.system", return_value = "Darwin"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() - def test_diagnose_browser_issues_linux_root_user( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_linux_root_user(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test diagnostic when running as root on Linux.""" - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True), \ - patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True), + patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), + ): scraper_with_config.diagnose_browser_issues() assert "(fail) Running as root - this can cause browser issues" in caplog.text @@ -1947,74 +2018,74 @@ class TestWebScrapingDiagnostics: mock_process2.info = {"name": "edge"} mock_processes = [mock_process1, mock_process2] - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("psutil.process_iter", return_value = mock_processes), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._diagnose_chrome_version_issues"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \ - patch.object(web_scraper, "get_compatible_browser", return_value = "/usr/bin/chrome"), \ - patch.object(mock_process1, "info", side_effect = psutil.NoSuchProcess(pid = 123)), \ - patch.object(mock_process2, "info", side_effect = psutil.AccessDenied(pid = 456)): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("psutil.process_iter", return_value = mock_processes), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._diagnose_chrome_version_issues"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), + patch.object(web_scraper, "get_compatible_browser", return_value = "/usr/bin/chrome"), + patch.object(mock_process1, "info", side_effect = psutil.NoSuchProcess(pid = 123)), + patch.object(mock_process2, "info", side_effect = psutil.AccessDenied(pid = 456)), + ): # Should not raise any exceptions web_scraper.diagnose_browser_issues() - def test_diagnose_browser_issues_handles_per_process_errors( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_handles_per_process_errors(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """diagnose_browser_issues should ignore psutil errors raised per process.""" caplog.set_level(logging.INFO) class FailingProcess: - @property def info(self) -> dict[str, object]: raise psutil.AccessDenied(pid = 999) - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("psutil.process_iter", return_value = [FailingProcess()]), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "_diagnose_chrome_version_issues"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("psutil.process_iter", return_value = [FailingProcess()]), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "_diagnose_chrome_version_issues"), + ): scraper_with_config.browser_config.binary_location = "/usr/bin/chrome" scraper_with_config.diagnose_browser_issues() assert "(info) No browser processes currently running" in caplog.text - def test_diagnose_browser_issues_handles_global_psutil_failure( - self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + def test_diagnose_browser_issues_handles_global_psutil_failure(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """diagnose_browser_issues should log a warning if psutil.process_iter fails entirely.""" caplog.set_level(logging.WARNING) - with patch("os.path.exists", return_value = True), \ - patch("os.access", return_value = True), \ - patch("psutil.process_iter", side_effect = psutil.Error("boom")), \ - patch("platform.system", return_value = "Linux"), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \ - patch.object(scraper_with_config, "_diagnose_chrome_version_issues"): + with ( + patch("os.path.exists", return_value = True), + patch("os.access", return_value = True), + patch("psutil.process_iter", side_effect = psutil.Error("boom")), + patch("platform.system", return_value = "Linux"), + patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), + patch.object(scraper_with_config, "_diagnose_chrome_version_issues"), + ): scraper_with_config.browser_config.binary_location = "/usr/bin/chrome" scraper_with_config.diagnose_browser_issues() assert "(warn) Unable to inspect browser processes:" in caplog.text @pytest.mark.asyncio - async def test_validate_chrome_version_configuration_port_open_but_api_inaccessible( - self, web_scraper:WebScrapingMixin - ) -> None: + async def test_validate_chrome_version_configuration_port_open_but_api_inaccessible(self, web_scraper:WebScrapingMixin) -> None: """Test _validate_chrome_version_configuration when port is open but API is inaccessible.""" # Configure remote debugging web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"] web_scraper.browser_config.binary_location = "/usr/bin/chrome" - with patch.dict("os.environ", {}, clear = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", return_value = None), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log: - + with ( + patch.dict("os.environ", {}, clear = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", return_value = None), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log, + ): # Should not raise any exceptions and should log the appropriate debug message await web_scraper._validate_chrome_version_configuration() @@ -2022,20 +2093,19 @@ class TestWebScrapingDiagnostics: mock_log.debug.assert_any_call(" -> Port is open but remote debugging API not accessible") @pytest.mark.asyncio - async def test_validate_chrome_version_configuration_remote_detection_exception( - self, web_scraper:WebScrapingMixin - ) -> None: + async def test_validate_chrome_version_configuration_remote_detection_exception(self, web_scraper:WebScrapingMixin) -> None: """Test _validate_chrome_version_configuration when remote detection raises exception.""" # Configure remote debugging web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"] web_scraper.browser_config.binary_location = "/usr/bin/chrome" - with patch.dict("os.environ", {}, clear = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", side_effect = Exception("Test exception")), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log: - + with ( + patch.dict("os.environ", {}, clear = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", side_effect = Exception("Test exception")), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log, + ): # Should not raise any exceptions and should log the appropriate debug message await web_scraper._validate_chrome_version_configuration() @@ -2045,19 +2115,18 @@ class TestWebScrapingDiagnostics: assert len(debug_calls) > 0, "Expected debug message not found" @pytest.mark.asyncio - async def test_validate_chrome_version_configuration_no_existing_browser( - self, web_scraper:WebScrapingMixin - ) -> None: + async def test_validate_chrome_version_configuration_no_existing_browser(self, web_scraper:WebScrapingMixin) -> None: """Test _validate_chrome_version_configuration when no existing browser is found.""" # Configure remote debugging web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"] web_scraper.browser_config.binary_location = "/usr/bin/chrome" - with patch.dict("os.environ", {}, clear = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = False), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log: - + with ( + patch.dict("os.environ", {}, clear = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = False), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log, + ): # Should not raise any exceptions and should log the appropriate debug message await web_scraper._validate_chrome_version_configuration() @@ -2077,16 +2146,15 @@ class TestWebScrapingMixinPortRetry: return scraper @pytest.mark.asyncio - async def test_browser_connection_error_handling( - self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + async def test_browser_connection_error_handling(self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test error handling when browser connection fails.""" - with patch("os.path.exists", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to connect as root user")), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class: - + with ( + patch("os.path.exists", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to connect as root user")), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class, + ): mock_config = Mock() mock_config_class.return_value = mock_config @@ -2098,15 +2166,16 @@ class TestWebScrapingMixinPortRetry: @pytest.mark.asyncio async def test_browser_connection_error_handling_non_root_error( - self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture + self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture ) -> None: """Test error handling when browser connection fails with non-root error.""" - with patch("os.path.exists", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Connection timeout")), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class: - + with ( + patch("os.path.exists", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Connection timeout")), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class, + ): mock_config = Mock() mock_config_class.return_value = mock_config @@ -2125,15 +2194,14 @@ class TestWebScrapingMixinPortRetry: return scraper @pytest.mark.asyncio - async def test_browser_startup_error_handling_root_error( - self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + async def test_browser_startup_error_handling_root_error(self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test error handling when browser startup fails with root error.""" - with patch("os.path.exists", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to start as root user")), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class: - + with ( + patch("os.path.exists", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to start as root user")), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class, + ): mock_config = Mock() mock_config_class.return_value = mock_config @@ -2144,15 +2212,14 @@ class TestWebScrapingMixinPortRetry: assert "Failed to start browser. This error often occurs when:" in caplog.text @pytest.mark.asyncio - async def test_browser_startup_error_handling_non_root_error( - self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture - ) -> None: + async def test_browser_startup_error_handling_non_root_error(self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None: """Test error handling when browser startup fails with non-root error.""" - with patch("os.path.exists", return_value = True), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Browser binary not found")), \ - patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class: - + with ( + patch("os.path.exists", return_value = True), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Browser binary not found")), + patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class, + ): mock_config = Mock() mock_config_class.return_value = mock_config @@ -2207,19 +2274,18 @@ class TestWebScrapingMixinProfileHandling: scraper.browser_config.profile_name = "TestProfile" return scraper - def test_profile_directory_creation_with_user_data_dir( - self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path - ) -> None: + def test_profile_directory_creation_with_user_data_dir(self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path) -> None: """Test profile directory creation when user_data_dir is configured.""" test_dir = str(tmp_path / "test-profile") scraper_with_profile_config.browser_config.user_data_dir = test_dir - with patch("os.path.join", return_value = os.path.join(test_dir, "TestProfile")), \ - patch("os.makedirs") as mock_makedirs, \ - patch("os.path.exists", return_value = False), \ - patch("builtins.open", mock_open()), \ - patch("json.dump"): - + with ( + patch("os.path.join", return_value = os.path.join(test_dir, "TestProfile")), + patch("os.makedirs") as mock_makedirs, + patch("os.path.exists", return_value = False), + patch("builtins.open", mock_open()), + patch("json.dump"), + ): # This would be called during browser session creation profile_dir = os.path.join(test_dir, "TestProfile") mock_makedirs.assert_not_called() # Not called yet @@ -2228,18 +2294,17 @@ class TestWebScrapingMixinProfileHandling: os.makedirs(profile_dir, exist_ok = True) mock_makedirs.assert_called_with(profile_dir, exist_ok = True) - def test_profile_directory_creation_with_preferences_file( - self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path - ) -> None: + def test_profile_directory_creation_with_preferences_file(self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path) -> None: """Test profile directory creation with preferences file when it doesn't exist.""" test_dir = str(tmp_path / "test-profile") scraper_with_profile_config.browser_config.user_data_dir = test_dir - with patch("os.makedirs") as mock_makedirs, \ - patch("os.path.exists", return_value = False), \ - patch("builtins.open", mock_open()) as mock_file, \ - patch("json.dump") as mock_json_dump: - + with ( + patch("os.makedirs") as mock_makedirs, + patch("os.path.exists", return_value = False), + patch("builtins.open", mock_open()) as mock_file, + patch("json.dump") as mock_json_dump, + ): # Simulate the profile creation logic profile_dir = os.path.join(test_dir, "TestProfile") prefs_file = os.path.join(profile_dir, "Preferences") @@ -2255,18 +2320,17 @@ class TestWebScrapingMixinProfileHandling: mock_file.assert_called_with(prefs_file, "w", encoding = "UTF-8") mock_json_dump.assert_called() - def test_profile_directory_creation_with_existing_preferences_file( - self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path - ) -> None: + def test_profile_directory_creation_with_existing_preferences_file(self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path) -> None: """Test profile directory creation when preferences file already exists.""" test_dir = str(tmp_path / "test-profile") scraper_with_profile_config.browser_config.user_data_dir = test_dir - with patch("os.makedirs") as mock_makedirs, \ - patch("os.path.exists", return_value = True), \ - patch("builtins.open", mock_open()) as mock_file, \ - patch("json.dump") as mock_json_dump: - + with ( + patch("os.makedirs") as mock_makedirs, + patch("os.path.exists", return_value = True), + patch("builtins.open", mock_open()) as mock_file, + patch("json.dump") as mock_json_dump, + ): # Simulate the profile creation logic profile_dir = os.path.join(test_dir, "TestProfile") @@ -2278,20 +2342,19 @@ class TestWebScrapingMixinProfileHandling: mock_file.assert_not_called() mock_json_dump.assert_not_called() - def test_profile_directory_creation_with_edge_browser( - self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path - ) -> None: + def test_profile_directory_creation_with_edge_browser(self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path) -> None: """Test profile directory creation with Edge browser configuration.""" test_dir = str(tmp_path / "test-profile") scraper_with_profile_config.browser_config.user_data_dir = test_dir scraper_with_profile_config.browser_config.binary_location = "/usr/bin/microsoft-edge" - with patch("os.makedirs") as mock_makedirs, \ - patch("os.path.exists", return_value = False), \ - patch("builtins.open", mock_open()), \ - patch("json.dump"), \ - patch("os.environ", {"MSEDGEDRIVER_TELEMETRY_OPTOUT": "1"}): - + with ( + patch("os.makedirs") as mock_makedirs, + patch("os.path.exists", return_value = False), + patch("builtins.open", mock_open()), + patch("json.dump"), + patch("os.environ", {"MSEDGEDRIVER_TELEMETRY_OPTOUT": "1"}), + ): # Simulate the profile creation logic profile_dir = os.path.join(test_dir, "TestProfile") @@ -2299,19 +2362,13 @@ class TestWebScrapingMixinProfileHandling: os.makedirs(profile_dir, exist_ok = True) mock_makedirs.assert_called_with(profile_dir, exist_ok = True) - def test_profile_directory_creation_with_private_window( - self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path - ) -> None: + def test_profile_directory_creation_with_private_window(self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path) -> None: """Test profile directory creation with private window configuration.""" test_dir = str(tmp_path / "test-profile") scraper_with_profile_config.browser_config.user_data_dir = test_dir scraper_with_profile_config.browser_config.use_private_window = True - with patch("os.makedirs") as mock_makedirs, \ - patch("os.path.exists", return_value = False), \ - patch("builtins.open", mock_open()), \ - patch("json.dump"): - + with patch("os.makedirs") as mock_makedirs, patch("os.path.exists", return_value = False), patch("builtins.open", mock_open()), patch("json.dump"): # Simulate the profile creation logic profile_dir = os.path.join(test_dir, "TestProfile") @@ -2319,16 +2376,12 @@ class TestWebScrapingMixinProfileHandling: os.makedirs(profile_dir, exist_ok = True) mock_makedirs.assert_called_with(profile_dir, exist_ok = True) - def test_profile_directory_creation_without_user_data_dir( - self, scraper_with_profile_config:WebScrapingMixin - ) -> None: + def test_profile_directory_creation_without_user_data_dir(self, scraper_with_profile_config:WebScrapingMixin) -> None: """Test profile directory handling when user_data_dir is not configured.""" scraper_with_profile_config.browser_config.user_data_dir = None # Should not create profile directories when user_data_dir is None - with patch("os.path.join") as mock_join, \ - patch("os.makedirs") as mock_makedirs: - + with patch("os.path.join") as mock_join, patch("os.makedirs") as mock_makedirs: # The profile creation logic should not be called mock_join.assert_not_called() mock_makedirs.assert_not_called()