From a3ac27c4412b67c998c0a970bb184ce7128d5db0 Mon Sep 17 00:00:00 2001
From: Jens <1742418+1cu@users.noreply.github.com>
Date: Thu, 13 Nov 2025 15:08:52 +0100
Subject: [PATCH] feat: add configurable timeouts (#673)
MIME-Version: 1.0
Content-Type: text/plain; charset=UTF-8
Content-Transfer-Encoding: 8bit
## ℹ️ Description
- Related issues: #671, #658
- Introduces configurable timeout controls plus retry/backoff handling
for flaky DOM operations.
We often see timeouts which are note reproducible in certain
configurations. I suspect timeout issues based on a combination of
internet speed, browser, os, age of the computer and the weather.
This PR introduces a comprehensive config model to tweak timeouts.
## 📋 Changes Summary
- add TimeoutConfig to the main config/schema and expose timeouts in
README/docs
- wire WebScrapingMixin, extractor, update checker, and browser
diagnostics to honor the configurable timeouts and retries
- update translations/tests to cover the new behaviour and ensure
lint/mypy/pyright pipelines remain green
### ⚙️ Type of Change
- [ ] 🐞 Bug fix (non-breaking change which fixes an issue)
- [x] ✨ New feature (adds new functionality without breaking existing
usage)
- [ ] 💥 Breaking change (changes that might break existing user setups,
scripts, or configurations)
## ✅ Checklist
- [x] I have reviewed my changes to ensure they meet the project's
standards.
- [x] I have tested my changes and ensured that all tests pass (`pdm run
test`).
- [x] I have formatted the code (`pdm run format`).
- [x] I have verified that linting passes (`pdm run lint`).
- [x] I have updated documentation where necessary.
## Summary by CodeRabbit
* **New Features**
* Centralized, configurable timeout system for web interactions,
detection flows, publishing, and pagination.
* Optional retry with exponential backoff for operations that time out.
* **Improvements**
* Replaced fixed wait times with dynamic timeouts throughout workflows.
* More informative timeout-related messages and diagnostics.
* **Tests**
* New and expanded test coverage for timeout behavior, pagination,
diagnostics, and retry logic.
---
CONTRIBUTING.md | 9 +-
README.md | 23 ++
docs/BROWSER_TROUBLESHOOTING.md | 12 +
schemas/config.schema.json | 135 ++++++++
src/kleinanzeigen_bot/__init__.py | 30 +-
src/kleinanzeigen_bot/extract.py | 23 +-
src/kleinanzeigen_bot/model/config_model.py | 50 +++
.../resources/translations.de.yaml | 15 +-
src/kleinanzeigen_bot/update_checker.py | 12 +-
.../utils/chrome_version_detector.py | 25 +-
.../utils/web_scraping_mixin.py | 248 ++++++++++----
tests/unit/test_config_model.py | 51 ++-
tests/unit/test_extract.py | 72 ++++
tests/unit/test_update_checker.py | 12 +
tests/unit/test_web_scraping_mixin.py | 312 +++++++++++++++++-
.../test_web_scraping_mixin_chrome_version.py | 64 +++-
16 files changed, 972 insertions(+), 121 deletions(-)
diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md
index b58d906..eb73735 100644
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -187,6 +187,14 @@ All Python files must start with SPDX license headers:
- Use appropriate log levels (DEBUG, INFO, WARNING, ERROR)
- Log important state changes and decision points
+#### Timeout configuration
+- The default timeout (`timeouts.default`) already wraps all standard DOM helpers (`web_find`, `web_click`, etc.) via `WebScrapingMixin._timeout/_effective_timeout`. Use it unless a workflow clearly needs a different SLA.
+- Reserve `timeouts.quick_dom` for transient overlays (shipping dialogs, payment prompts, toast banners) that should render almost instantly; call `self._timeout("quick_dom")` in those spots to keep the UI responsive.
+- For single selectors that occasionally need more headroom, pass an inline override instead of creating a new config key, e.g. `custom = self._timeout(override = 12.5); await self.web_find(..., timeout = custom)`.
+- Use `_timeout()` when you just need the raw configured value (with optional override); use `_effective_timeout()` when you rely on the global multiplier and retry backoff for a given attempt (e.g. inside `_run_with_timeout_retries`).
+- Add a new timeout key only when a recurring workflow has its own timing profile (pagination, captcha detection, publishing confirmations, Chrome probes, etc.). Whenever you add one, extend `TimeoutConfig`, document it in the sample `timeouts:` block in `README.md`, and explain it in `docs/BROWSER_TROUBLESHOOTING.md`.
+- Encourage users to raise `timeouts.multiplier` when everything is slow, and override existing keys in `config.yaml` before introducing new ones. This keeps the configuration surface minimal.
+
#### Examples
```python
def parse_duration(text: str) -> timedelta:
@@ -297,4 +305,3 @@ See the [LICENSE.txt](LICENSE.txt) file for our project's licensing. All source
- Use the translation system for all output—**never hardcode German or other languages** in the code.
- If you add or change a user-facing message, update the translation file and ensure that translation completeness tests pass (`tests/unit/test_translations.py`).
- Review the translation guidelines and patterns in the codebase for correct usage.
-
diff --git a/README.md b/README.md
index 3899c87..f5333cb 100644
--- a/README.md
+++ b/README.md
@@ -277,6 +277,27 @@ categories:
Verschenken & Tauschen > Verleihen: 272/274
Verschenken & Tauschen > Verschenken: 272/192
+# timeout tuning (optional)
+timeouts:
+ multiplier: 1.0 # Scale all timeouts (e.g. 2.0 for slower networks)
+ default: 5.0 # Base timeout for web_find/web_click/etc.
+ page_load: 15.0 # Timeout for web_open page loads
+ captcha_detection: 2.0 # Timeout for captcha iframe detection
+ sms_verification: 4.0 # Timeout for SMS verification banners
+ gdpr_prompt: 10.0 # Timeout when handling GDPR dialogs
+ publishing_result: 300.0 # Timeout for publishing status checks
+ publishing_confirmation: 20.0 # Timeout for publish confirmation redirect
+ pagination_initial: 10.0 # Timeout for first pagination lookup
+ pagination_follow_up: 5.0 # Timeout for subsequent pagination clicks
+ quick_dom: 2.0 # Generic short DOM timeout (shipping dialogs, etc.)
+ update_check: 10.0 # Timeout for GitHub update requests
+ chrome_remote_probe: 2.0 # Timeout for local remote-debugging probes
+ chrome_remote_debugging: 5.0 # Timeout for remote debugging API calls
+ chrome_binary_detection: 10.0 # Timeout for chrome --version subprocess
+ retry_enabled: true # Enables DOM retry/backoff when timeouts occur
+ retry_max_attempts: 2
+ retry_backoff_factor: 1.5
+
# download configuration
download:
include_all_matching_shipping_options: false # if true, all shipping options matching the package size will be included
@@ -329,6 +350,8 @@ login:
password: ""
```
+Slow networks or sluggish remote browsers often just need a higher `timeouts.multiplier`, while truly problematic selectors can get explicit values directly under `timeouts`. Remember to regenerate the schemas after changing the configuration model so editors stay in sync.
+
### 2) Ad configuration
Each ad is described in a separate JSON or YAML file with prefix `ad_`. The prefix is configurable in config file.
diff --git a/docs/BROWSER_TROUBLESHOOTING.md b/docs/BROWSER_TROUBLESHOOTING.md
index 9ddc328..ba977d3 100644
--- a/docs/BROWSER_TROUBLESHOOTING.md
+++ b/docs/BROWSER_TROUBLESHOOTING.md
@@ -59,6 +59,18 @@ Please update your configuration to include --user-data-dir for remote debugging
The bot will also provide specific instructions on how to fix your configuration.
+### Issue: Slow page loads or recurring TimeoutError
+
+**Symptoms:**
+- `_extract_category_from_ad_page` fails intermittently due to breadcrumb lookups timing out
+- Captcha/SMS/GDPR prompts appear right after a timeout
+- Requests to GitHub's API fail sporadically with timeout errors
+
+**Solutions:**
+1. Increase `timeouts.multiplier` in `config.yaml` (e.g. `2.0` doubles every timeout consistently).
+2. Override specific keys under `timeouts` (e.g. `pagination_initial: 20.0`) if only a single selector is problematic.
+3. Keep `retry_enabled` on so that DOM lookups are retried with exponential backoff.
+
## Common Issues and Solutions
### Issue 1: "Failed to connect to browser" with "root" error
diff --git a/schemas/config.schema.json b/schemas/config.schema.json
index 5ff1943..7f288b7 100644
--- a/schemas/config.schema.json
+++ b/schemas/config.schema.json
@@ -359,6 +359,137 @@
"title": "PublishingConfig",
"type": "object"
},
+ "TimeoutConfig": {
+ "properties": {
+ "multiplier": {
+ "default": 1.0,
+ "description": "Global multiplier applied to all timeout values.",
+ "minimum": 0.1,
+ "title": "Multiplier",
+ "type": "number"
+ },
+ "default": {
+ "type": "number",
+ "minimum": 0.0,
+ "default": 5.0,
+ "description": "Baseline timeout for DOM interactions.",
+ "title": "Default"
+ },
+ "page_load": {
+ "default": 15.0,
+ "description": "Page load timeout for web_open.",
+ "minimum": 1.0,
+ "title": "Page Load",
+ "type": "number"
+ },
+ "captcha_detection": {
+ "default": 2.0,
+ "description": "Timeout for captcha iframe detection.",
+ "minimum": 0.1,
+ "title": "Captcha Detection",
+ "type": "number"
+ },
+ "sms_verification": {
+ "default": 4.0,
+ "description": "Timeout for SMS verification prompts.",
+ "minimum": 0.1,
+ "title": "Sms Verification",
+ "type": "number"
+ },
+ "gdpr_prompt": {
+ "default": 10.0,
+ "description": "Timeout for GDPR/consent dialogs.",
+ "minimum": 1.0,
+ "title": "Gdpr Prompt",
+ "type": "number"
+ },
+ "publishing_result": {
+ "default": 300.0,
+ "description": "Timeout for publishing result checks.",
+ "minimum": 10.0,
+ "title": "Publishing Result",
+ "type": "number"
+ },
+ "publishing_confirmation": {
+ "default": 20.0,
+ "description": "Timeout for publish confirmation redirect.",
+ "minimum": 1.0,
+ "title": "Publishing Confirmation",
+ "type": "number"
+ },
+ "pagination_initial": {
+ "default": 10.0,
+ "description": "Timeout for initial pagination lookup.",
+ "minimum": 1.0,
+ "title": "Pagination Initial",
+ "type": "number"
+ },
+ "pagination_follow_up": {
+ "default": 5.0,
+ "description": "Timeout for subsequent pagination navigation.",
+ "minimum": 1.0,
+ "title": "Pagination Follow Up",
+ "type": "number"
+ },
+ "quick_dom": {
+ "default": 2.0,
+ "description": "Generic short timeout for transient UI.",
+ "minimum": 0.1,
+ "title": "Quick Dom",
+ "type": "number"
+ },
+ "update_check": {
+ "default": 10.0,
+ "description": "Timeout for GitHub update checks.",
+ "minimum": 1.0,
+ "title": "Update Check",
+ "type": "number"
+ },
+ "chrome_remote_probe": {
+ "default": 2.0,
+ "description": "Timeout for local remote-debugging probes.",
+ "minimum": 0.1,
+ "title": "Chrome Remote Probe",
+ "type": "number"
+ },
+ "chrome_remote_debugging": {
+ "default": 5.0,
+ "description": "Timeout for remote debugging API calls.",
+ "minimum": 1.0,
+ "title": "Chrome Remote Debugging",
+ "type": "number"
+ },
+ "chrome_binary_detection": {
+ "default": 10.0,
+ "description": "Timeout for chrome --version subprocesses.",
+ "minimum": 1.0,
+ "title": "Chrome Binary Detection",
+ "type": "number"
+ },
+ "retry_enabled": {
+ "default": true,
+ "description": "Enable built-in retry/backoff for DOM operations.",
+ "title": "Retry Enabled",
+ "type": "boolean"
+ },
+ "retry_max_attempts": {
+ "default": 2,
+ "description": "Max retry attempts when retry is enabled.",
+ "minimum": 1,
+ "title": "Retry Max Attempts",
+ "type": "integer"
+ },
+ "retry_backoff_factor": {
+ "default": 1.5,
+ "description": "Exponential factor applied per retry attempt.",
+ "minimum": 1.0,
+ "title": "Retry Backoff Factor",
+ "type": "number"
+ }
+ },
+ "title": "TimeoutConfig",
+ "type": "object"
+ },
"UpdateCheckConfig": {
"description": "Configuration for update checking functionality.\n\nAttributes:\n enabled: Whether update checking is enabled.\n channel: Which release channel to check ('latest' for stable, 'preview' for prereleases).\n interval: How often to check for updates (e.g. '7d', '1d').\n If the interval is invalid, too short (<1d), or too long (>30d),\n the bot will log a warning and use a default interval for this run:\n - 1d for 'preview' channel\n - 7d for 'latest' channel\n The config file is not changed automatically; please fix your config to avoid repeated warnings.",
"properties": {
@@ -428,6 +559,10 @@
"update_check": {
"$ref": "#/$defs/UpdateCheckConfig",
"description": "Update check configuration"
+ },
+ "timeouts": {
+ "$ref": "#/$defs/TimeoutConfig",
+ "description": "Centralized timeout configuration."
}
},
"title": "Config",
diff --git a/src/kleinanzeigen_bot/__init__.py b/src/kleinanzeigen_bot/__init__.py
index 8fa8209..8d632fd 100644
--- a/src/kleinanzeigen_bot/__init__.py
+++ b/src/kleinanzeigen_bot/__init__.py
@@ -573,8 +573,9 @@ class KleinanzeigenBot(WebScrapingMixin):
async def check_and_wait_for_captcha(self, *, is_login_page:bool = True) -> None:
try:
+ captcha_timeout = self._timeout("captcha_detection")
await self.web_find(By.CSS_SELECTOR,
- "iframe[name^='a-'][src^='https://www.google.com/recaptcha/api2/anchor?']", timeout = 2)
+ "iframe[name^='a-'][src^='https://www.google.com/recaptcha/api2/anchor?']", timeout = captcha_timeout)
if not is_login_page and self.config.captcha.auto_restart:
LOG.warning("Captcha recognized - auto-restart enabled, abort run...")
@@ -624,7 +625,8 @@ class KleinanzeigenBot(WebScrapingMixin):
async def handle_after_login_logic(self) -> None:
try:
- await self.web_find(By.TEXT, "Wir haben dir gerade einen 6-stelligen Code für die Telefonnummer", timeout = 4)
+ sms_timeout = self._timeout("sms_verification")
+ await self.web_find(By.TEXT, "Wir haben dir gerade einen 6-stelligen Code für die Telefonnummer", timeout = sms_timeout)
LOG.warning("############################################")
LOG.warning("# Device verification message detected. Please follow the instruction displayed in the Browser.")
LOG.warning("############################################")
@@ -634,9 +636,12 @@ class KleinanzeigenBot(WebScrapingMixin):
try:
LOG.info("Handling GDPR disclaimer...")
- await self.web_find(By.ID, "gdpr-banner-accept", timeout = 10)
+ gdpr_timeout = self._timeout("gdpr_prompt")
+ await self.web_find(By.ID, "gdpr-banner-accept", timeout = gdpr_timeout)
await self.web_click(By.ID, "gdpr-banner-cmp-button")
- await self.web_click(By.XPATH, "//div[@id='ConsentManagementPage']//*//button//*[contains(., 'Alle ablehnen und fortfahren')]", timeout = 10)
+ await self.web_click(By.XPATH,
+ "//div[@id='ConsentManagementPage']//*//button//*[contains(., 'Alle ablehnen und fortfahren')]",
+ timeout = gdpr_timeout)
except TimeoutError:
pass
@@ -724,7 +729,8 @@ class KleinanzeigenBot(WebScrapingMixin):
count += 1
await self.publish_ad(ad_file, ad_cfg, ad_cfg_orig, published_ads, AdUpdateStrategy.REPLACE)
- await self.web_await(self.__check_publishing_result, timeout = 5 * 60)
+ publish_timeout = self._timeout("publishing_result")
+ await self.web_await(self.__check_publishing_result, timeout = publish_timeout)
if self.config.publishing.delete_old_ads == "AFTER_PUBLISH" and not self.keep_old_ads:
await self.delete_ad(ad_cfg, published_ads, delete_old_ads_by_title = False)
@@ -924,7 +930,8 @@ class KleinanzeigenBot(WebScrapingMixin):
# wait for payment form if commercial account is used
#############################
try:
- await self.web_find(By.ID, "myftr-shppngcrt-frm", timeout = 2)
+ short_timeout = self._timeout("quick_dom")
+ await self.web_find(By.ID, "myftr-shppngcrt-frm", timeout = short_timeout)
LOG.warning("############################################")
LOG.warning("# Payment form detected! Please proceed with payment.")
@@ -934,7 +941,8 @@ class KleinanzeigenBot(WebScrapingMixin):
except TimeoutError:
pass
- await self.web_await(lambda: "p-anzeige-aufgeben-bestaetigung.html?adId=" in self.page.url, timeout = 20)
+ confirmation_timeout = self._timeout("publishing_confirmation")
+ await self.web_await(lambda: "p-anzeige-aufgeben-bestaetigung.html?adId=" in self.page.url, timeout = confirmation_timeout)
# extract the ad id from the URL's query parameter
current_url_query_params = urllib_parse.parse_qs(urllib_parse.urlparse(self.page.url).query)
@@ -986,7 +994,8 @@ class KleinanzeigenBot(WebScrapingMixin):
count += 1
await self.publish_ad(ad_file, ad_cfg, ad_cfg_orig, published_ads, AdUpdateStrategy.MODIFY)
- await self.web_await(self.__check_publishing_result, timeout = 5 * 60)
+ publish_timeout = self._timeout("publishing_result")
+ await self.web_await(self.__check_publishing_result, timeout = publish_timeout)
LOG.info("############################################")
LOG.info("DONE: updated %s", pluralize("ad", count))
@@ -1080,6 +1089,7 @@ class KleinanzeigenBot(WebScrapingMixin):
LOG.debug("Successfully set attribute field [%s] to [%s]...", special_attribute_key, special_attribute_value_str)
async def __set_shipping(self, ad_cfg:Ad, mode:AdUpdateStrategy = AdUpdateStrategy.REPLACE) -> None:
+ short_timeout = self._timeout("quick_dom")
if ad_cfg.shipping_type == "PICKUP":
try:
await self.web_click(By.ID, "radio-pickup")
@@ -1091,7 +1101,7 @@ class KleinanzeigenBot(WebScrapingMixin):
if mode == AdUpdateStrategy.MODIFY:
try:
# when "Andere Versandmethoden" is not available, go back and start over new
- await self.web_find(By.XPATH, '//dialog//button[contains(., "Andere Versandmethoden")]', timeout = 2)
+ await self.web_find(By.XPATH, '//dialog//button[contains(., "Andere Versandmethoden")]', timeout = short_timeout)
except TimeoutError:
await self.web_click(By.XPATH, '//dialog//button[contains(., "Zurück")]')
@@ -1120,7 +1130,7 @@ class KleinanzeigenBot(WebScrapingMixin):
# (important for mode = UPDATE)
await self.web_find(By.XPATH,
'//input[contains(@placeholder, "Versandkosten (optional)")]',
- timeout = 2)
+ timeout = short_timeout)
except TimeoutError:
await self.web_click(By.XPATH, '//*[contains(@id, "INDIVIDUAL") and contains(@data-testid, "Individueller Versand")]')
diff --git a/src/kleinanzeigen_bot/extract.py b/src/kleinanzeigen_bot/extract.py
index f59c105..da61770 100644
--- a/src/kleinanzeigen_bot/extract.py
+++ b/src/kleinanzeigen_bot/extract.py
@@ -33,7 +33,7 @@ class AdExtractor(WebScrapingMixin):
def __init__(self, browser:Browser, config:Config) -> None:
super().__init__()
self.browser = browser
- self.config = config
+ self.config:Config = config
async def download_ad(self, ad_id:int) -> None:
"""
@@ -146,9 +146,10 @@ class AdExtractor(WebScrapingMixin):
# --- Pagination handling ---
multi_page = False
+ pagination_timeout = self._timeout("pagination_initial")
try:
# Correct selector: Use uppercase '.Pagination'
- pagination_section = await self.web_find(By.CSS_SELECTOR, ".Pagination", timeout = 10) # Increased timeout slightly
+ pagination_section = await self.web_find(By.CSS_SELECTOR, ".Pagination", timeout = pagination_timeout) # Increased timeout slightly
# Correct selector: Use 'aria-label'
# Also check if the button is actually present AND potentially enabled (though enabled check isn't strictly necessary here, only for clicking later)
next_buttons = await self.web_find_all(By.CSS_SELECTOR, 'button[aria-label="Nächste"]', parent = pagination_section)
@@ -204,9 +205,10 @@ class AdExtractor(WebScrapingMixin):
break
# --- Navigate to next page ---
+ follow_up_timeout = self._timeout("pagination_follow_up")
try:
# Find the pagination section again (scope might have changed after scroll/wait)
- pagination_section = await self.web_find(By.CSS_SELECTOR, ".Pagination", timeout = 5)
+ pagination_section = await self.web_find(By.CSS_SELECTOR, ".Pagination", timeout = follow_up_timeout)
# Find the "Next" button using the correct aria-label selector and ensure it's not disabled
next_button_element = None
possible_next_buttons = await self.web_find_all(By.CSS_SELECTOR, 'button[aria-label="Nächste"]', parent = pagination_section)
@@ -432,8 +434,19 @@ class AdExtractor(WebScrapingMixin):
# Fallback to legacy selectors in case the breadcrumb structure is unexpected.
LOG.debug(_("Falling back to legacy breadcrumb selectors; collected ids: %s"), category_ids)
- category_first_part = await self.web_find(By.CSS_SELECTOR, "a:nth-of-type(2)", parent = category_line)
- category_second_part = await self.web_find(By.CSS_SELECTOR, "a:nth-of-type(3)", parent = category_line)
+ fallback_timeout = self._effective_timeout()
+ try:
+ category_first_part = await self.web_find(By.CSS_SELECTOR, "a:nth-of-type(2)", parent = category_line)
+ category_second_part = await self.web_find(By.CSS_SELECTOR, "a:nth-of-type(3)", parent = category_line)
+ except TimeoutError as exc:
+ LOG.error(
+ "Legacy breadcrumb selectors not found within %.1f seconds (collected ids: %s)",
+ fallback_timeout,
+ category_ids
+ )
+ raise TimeoutError(
+ _("Unable to locate breadcrumb fallback selectors within %(seconds).1f seconds.") % {"seconds": fallback_timeout}
+ ) from exc
href_first:str = str(category_first_part.attrs["href"])
href_second:str = str(category_second_part.attrs["href"])
cat_num_first_raw = href_first.rsplit("/", maxsplit = 1)[-1]
diff --git a/src/kleinanzeigen_bot/model/config_model.py b/src/kleinanzeigen_bot/model/config_model.py
index 5cdcb5b..a4fab8f 100644
--- a/src/kleinanzeigen_bot/model/config_model.py
+++ b/src/kleinanzeigen_bot/model/config_model.py
@@ -114,6 +114,55 @@ class CaptchaConfig(ContextualModel):
restart_delay:str = "6h"
+class TimeoutConfig(ContextualModel):
+ multiplier:float = Field(
+ default = 1.0,
+ ge = 0.1,
+ description = "Global multiplier applied to all timeout values."
+ )
+ default:float = Field(default = 5.0, ge = 0.0, description = "Baseline timeout for DOM interactions.")
+ page_load:float = Field(default = 15.0, ge = 1.0, description = "Page load timeout for web_open.")
+ captcha_detection:float = Field(default = 2.0, ge = 0.1, description = "Timeout for captcha iframe detection.")
+ sms_verification:float = Field(default = 4.0, ge = 0.1, description = "Timeout for SMS verification prompts.")
+ gdpr_prompt:float = Field(default = 10.0, ge = 1.0, description = "Timeout for GDPR/consent dialogs.")
+ publishing_result:float = Field(default = 300.0, ge = 10.0, description = "Timeout for publishing result checks.")
+ publishing_confirmation:float = Field(default = 20.0, ge = 1.0, description = "Timeout for publish confirmation redirect.")
+ pagination_initial:float = Field(default = 10.0, ge = 1.0, description = "Timeout for initial pagination lookup.")
+ pagination_follow_up:float = Field(default = 5.0, ge = 1.0, description = "Timeout for subsequent pagination navigation.")
+ quick_dom:float = Field(default = 2.0, ge = 0.1, description = "Generic short timeout for transient UI.")
+ update_check:float = Field(default = 10.0, ge = 1.0, description = "Timeout for GitHub update checks.")
+ chrome_remote_probe:float = Field(default = 2.0, ge = 0.1, description = "Timeout for local remote-debugging probes.")
+ chrome_remote_debugging:float = Field(default = 5.0, ge = 1.0, description = "Timeout for remote debugging API calls.")
+ chrome_binary_detection:float = Field(default = 10.0, ge = 1.0, description = "Timeout for chrome --version subprocesses.")
+ retry_enabled:bool = Field(default = True, description = "Enable built-in retry/backoff for DOM operations.")
+ retry_max_attempts:int = Field(default = 2, ge = 1, description = "Max retry attempts when retry is enabled.")
+ retry_backoff_factor:float = Field(default = 1.5, ge = 1.0, description = "Exponential factor applied per retry attempt.")
+
+ def resolve(self, key:str = "default", override:float | None = None) -> float:
+ """
+ Return the base timeout (seconds) for the given key without applying modifiers.
+ """
+ if override is not None:
+ return float(override)
+
+ if key == "default":
+ return float(self.default)
+
+ attr = getattr(self, key, None)
+ if isinstance(attr, (int, float)):
+ return float(attr)
+
+ return float(self.default)
+
+ def effective(self, key:str = "default", override:float | None = None, *, attempt:int = 0) -> float:
+ """
+ Return the effective timeout (seconds) with multiplier/backoff applied.
+ """
+ base = self.resolve(key, override)
+ backoff = self.retry_backoff_factor ** attempt if attempt > 0 else 1.0
+ return base * self.multiplier * backoff
+
+
def _validate_glob_pattern(v:str) -> str:
if not v.strip():
raise ValueError("must be a non-empty, non-blank glob pattern")
@@ -154,6 +203,7 @@ Example:
login:LoginConfig = Field(default_factory = LoginConfig.model_construct, description = "Login credentials")
captcha:CaptchaConfig = Field(default_factory = CaptchaConfig)
update_check:UpdateCheckConfig = Field(default_factory = UpdateCheckConfig, description = "Update check configuration")
+ timeouts:TimeoutConfig = Field(default_factory = TimeoutConfig, description = "Centralized timeout configuration.")
def with_values(self, values:dict[str, Any]) -> Config:
return Config.model_validate(
diff --git a/src/kleinanzeigen_bot/resources/translations.de.yaml b/src/kleinanzeigen_bot/resources/translations.de.yaml
index f4fefb2..c7cf78f 100644
--- a/src/kleinanzeigen_bot/resources/translations.de.yaml
+++ b/src/kleinanzeigen_bot/resources/translations.de.yaml
@@ -219,6 +219,8 @@ kleinanzeigen_bot/extract.py:
_extract_category_from_ad_page:
"Breadcrumb container 'vap-brdcrmb' not found; cannot extract ad category: %s": "Breadcrumb-Container 'vap-brdcrmb' nicht gefunden; kann Anzeigenkategorie nicht extrahieren: %s"
"Falling back to legacy breadcrumb selectors; collected ids: %s": "Weiche auf ältere Breadcrumb-Selektoren aus; gesammelte IDs: %s"
+ "Legacy breadcrumb selectors not found within %.1f seconds (collected ids: %s)": "Ältere Breadcrumb-Selektoren nicht innerhalb von %.1f Sekunden gefunden (gesammelte IDs: %s)"
+ "Unable to locate breadcrumb fallback selectors within %(seconds).1f seconds.": "Ältere Breadcrumb-Selektoren konnten nicht innerhalb von %(seconds).1f Sekunden gefunden werden."
#################################################
kleinanzeigen_bot/utils/i18n.py:
@@ -398,11 +400,6 @@ kleinanzeigen_bot/utils/web_scraping_mixin.py:
web_check:
"Unsupported attribute: %s": "Nicht unterstütztes Attribut: %s"
- web_find:
- "Unsupported selector type: %s": "Nicht unterstützter Selektor-Typ: %s"
-
- web_find_all:
- "Unsupported selector type: %s": "Nicht unterstützter Selektor-Typ: %s"
close_browser_session:
"Closing Browser session...": "Schließe Browser-Sitzung..."
@@ -417,6 +414,12 @@ kleinanzeigen_bot/utils/web_scraping_mixin.py:
web_request:
" -> HTTP %s [%s]...": " -> HTTP %s [%s]..."
+ _web_find_once:
+ "Unsupported selector type: %s": "Nicht unterstützter Selektor-Typ: %s"
+
+ _web_find_all_once:
+ "Unsupported selector type: %s": "Nicht unterstützter Selektor-Typ: %s"
+
diagnose_browser_issues:
"=== Browser Connection Diagnostics ===": "=== Browser-Verbindungsdiagnose ==="
"=== End Diagnostics ===": "=== Ende der Diagnose ==="
@@ -434,6 +437,8 @@ kleinanzeigen_bot/utils/web_scraping_mixin.py:
"(info) Remote debugging port configured: %d": "(Info) Remote-Debugging-Port konfiguriert: %d"
"(info) Remote debugging port is not open": "(Info) Remote-Debugging-Port ist nicht offen"
+ "(warn) Unable to inspect browser processes: %s": "(Warnung) Browser-Prozesse konnten nicht überprüft werden: %s"
+
"(info) No browser processes currently running": "(Info) Derzeit keine Browser-Prozesse aktiv"
"(fail) Running as root - this can cause browser issues": "(Fehler) Läuft als Root - dies kann Browser-Probleme verursachen"
diff --git a/src/kleinanzeigen_bot/update_checker.py b/src/kleinanzeigen_bot/update_checker.py
index 7c7f429..35ccbb3 100644
--- a/src/kleinanzeigen_bot/update_checker.py
+++ b/src/kleinanzeigen_bot/update_checker.py
@@ -49,6 +49,10 @@ class UpdateChecker:
"""
return __version__
+ def _request_timeout(self) -> float:
+ """Return the effective timeout for HTTP calls."""
+ return self.config.timeouts.effective("update_check")
+
def _get_commit_hash(self, version:str) -> str | None:
"""Extract the commit hash from a version string.
@@ -74,7 +78,7 @@ class UpdateChecker:
try:
response = requests.get(
f"https://api.github.com/repos/Second-Hand-Friends/kleinanzeigen-bot/releases/tags/{tag_name}",
- timeout = 10
+ timeout = self._request_timeout()
)
response.raise_for_status()
data = response.json()
@@ -97,7 +101,7 @@ class UpdateChecker:
try:
response = requests.get(
f"https://api.github.com/repos/Second-Hand-Friends/kleinanzeigen-bot/commits/{commit}",
- timeout = 10
+ timeout = self._request_timeout()
)
response.raise_for_status()
data = response.json()
@@ -148,7 +152,7 @@ class UpdateChecker:
# Use /releases/latest endpoint for stable releases
response = requests.get(
"https://api.github.com/repos/Second-Hand-Friends/kleinanzeigen-bot/releases/latest",
- timeout = 10
+ timeout = self._request_timeout()
)
response.raise_for_status()
release = response.json()
@@ -160,7 +164,7 @@ class UpdateChecker:
# Use /releases endpoint and select the most recent prerelease
response = requests.get(
"https://api.github.com/repos/Second-Hand-Friends/kleinanzeigen-bot/releases",
- timeout = 10
+ timeout = self._request_timeout()
)
response.raise_for_status()
releases = response.json()
diff --git a/src/kleinanzeigen_bot/utils/chrome_version_detector.py b/src/kleinanzeigen_bot/utils/chrome_version_detector.py
index 7dd024e..ffcc2ce 100644
--- a/src/kleinanzeigen_bot/utils/chrome_version_detector.py
+++ b/src/kleinanzeigen_bot/utils/chrome_version_detector.py
@@ -78,23 +78,25 @@ def _normalize_browser_name(browser_name:str) -> str:
return "Chrome"
-def detect_chrome_version_from_binary(binary_path:str) -> ChromeVersionInfo | None:
+def detect_chrome_version_from_binary(binary_path:str, *, timeout:float | None = None) -> ChromeVersionInfo | None:
"""
Detect Chrome version by running the browser binary.
Args:
binary_path: Path to the Chrome binary
+ timeout: Optional timeout (seconds) for the subprocess call
Returns:
ChromeVersionInfo if successful, None if detection fails
"""
+ effective_timeout = timeout if timeout is not None else 10.0
try:
# Run browser with --version flag
result = subprocess.run( # noqa: S603
[binary_path, "--version"],
check = False, capture_output = True,
text = True,
- timeout = 10
+ timeout = effective_timeout
)
if result.returncode != 0:
@@ -114,28 +116,30 @@ def detect_chrome_version_from_binary(binary_path:str) -> ChromeVersionInfo | No
return ChromeVersionInfo(version_string, major_version, browser_name)
except subprocess.TimeoutExpired:
- LOG.debug("Browser version command timed out")
+ LOG.debug("Browser version command timed out after %.1fs", effective_timeout)
return None
except (subprocess.SubprocessError, ValueError) as e:
LOG.debug("Failed to detect browser version: %s", str(e))
return None
-def detect_chrome_version_from_remote_debugging(host:str = "127.0.0.1", port:int = 9222) -> ChromeVersionInfo | None:
+def detect_chrome_version_from_remote_debugging(host:str = "127.0.0.1", port:int = 9222, *, timeout:float | None = None) -> ChromeVersionInfo | None:
"""
Detect Chrome version from remote debugging API.
Args:
host: Remote debugging host
port: Remote debugging port
+ timeout: Optional timeout (seconds) for the HTTP request
Returns:
ChromeVersionInfo if successful, None if detection fails
"""
+ effective_timeout = timeout if timeout is not None else 5.0
try:
# Query the remote debugging API
url = f"http://{host}:{port}/json/version"
- response = urllib.request.urlopen(url, timeout = 5) # noqa: S310
+ response = urllib.request.urlopen(url, timeout = effective_timeout) # noqa: S310
version_data = json.loads(response.read().decode())
# Extract version information
@@ -200,7 +204,10 @@ def validate_chrome_136_configuration(browser_arguments:list[str], user_data_dir
def get_chrome_version_diagnostic_info(
binary_path:str | None = None,
remote_host:str = "127.0.0.1",
- remote_port:int | None = None
+ remote_port:int | None = None,
+ *,
+ remote_timeout:float | None = None,
+ binary_timeout:float | None = None
) -> dict[str, Any]:
"""
Get comprehensive Chrome version diagnostic information.
@@ -209,6 +216,8 @@ def get_chrome_version_diagnostic_info(
binary_path: Path to Chrome binary (optional)
remote_host: Remote debugging host
remote_port: Remote debugging port (optional)
+ remote_timeout: Timeout for remote debugging detection
+ binary_timeout: Timeout for binary detection
Returns:
Dictionary with diagnostic information
@@ -223,7 +232,7 @@ def get_chrome_version_diagnostic_info(
# Try binary detection
if binary_path:
- version_info = detect_chrome_version_from_binary(binary_path)
+ version_info = detect_chrome_version_from_binary(binary_path, timeout = binary_timeout)
if version_info:
diagnostic_info["binary_detection"] = {
"version_string": version_info.version_string,
@@ -235,7 +244,7 @@ def get_chrome_version_diagnostic_info(
# Try remote debugging detection
if remote_port:
- version_info = detect_chrome_version_from_remote_debugging(remote_host, remote_port)
+ version_info = detect_chrome_version_from_remote_debugging(remote_host, remote_port, timeout = remote_timeout)
if version_info:
diagnostic_info["remote_detection"] = {
"version_string": version_info.version_string,
diff --git a/src/kleinanzeigen_bot/utils/web_scraping_mixin.py b/src/kleinanzeigen_bot/utils/web_scraping_mixin.py
index a4e4669..b4aaa91 100644
--- a/src/kleinanzeigen_bot/utils/web_scraping_mixin.py
+++ b/src/kleinanzeigen_bot/utils/web_scraping_mixin.py
@@ -2,9 +2,9 @@
# SPDX-License-Identifier: AGPL-3.0-or-later
# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/
import asyncio, enum, inspect, json, os, platform, secrets, shutil, subprocess, urllib.request # isort: skip # noqa: S404
-from collections.abc import Callable, Coroutine, Iterable
+from collections.abc import Awaitable, Callable, Coroutine, Iterable
from gettext import gettext as _
-from typing import Any, Final, cast
+from typing import Any, Final, Optional, cast
try:
from typing import Never # type: ignore[attr-defined,unused-ignore] # mypy
@@ -15,10 +15,13 @@ import nodriver, psutil # isort: skip
from typing import TYPE_CHECKING, TypeGuard
from nodriver.core.browser import Browser
-from nodriver.core.config import Config
+from nodriver.core.config import Config as NodriverConfig
from nodriver.core.element import Element
from nodriver.core.tab import Tab as Page
+from kleinanzeigen_bot.model.config_model import Config as BotConfig
+from kleinanzeigen_bot.model.config_model import TimeoutConfig
+
from . import loggers, net
from .chrome_version_detector import (
ChromeVersionInfo,
@@ -32,6 +35,7 @@ from .misc import T, ensure
if TYPE_CHECKING:
from nodriver.cdp.runtime import RemoteObject
+
# Constants for RemoteObject conversion
_KEY_VALUE_PAIR_SIZE = 2
@@ -102,6 +106,69 @@ class WebScrapingMixin:
self.browser_config:Final[BrowserConfig] = BrowserConfig()
self.browser:Browser = None # pyright: ignore[reportAttributeAccessIssue]
self.page:Page = None # pyright: ignore[reportAttributeAccessIssue]
+ self._default_timeout_config:TimeoutConfig | None = None
+ self.config:BotConfig = cast(BotConfig, None)
+
+ def _get_timeout_config(self) -> TimeoutConfig:
+ config = getattr(self, "config", None)
+ timeouts:TimeoutConfig | None = None
+ if config is not None:
+ timeouts = cast(Optional[TimeoutConfig], getattr(config, "timeouts", None))
+ if timeouts is not None:
+ return timeouts
+
+ if self._default_timeout_config is None:
+ self._default_timeout_config = TimeoutConfig()
+ return self._default_timeout_config
+
+ def _timeout(self, key:str = "default", override:float | None = None) -> float:
+ """
+ Return the base timeout (seconds) for a given key without applying multipliers.
+ """
+ return self._get_timeout_config().resolve(key, override)
+
+ def _effective_timeout(self, key:str = "default", override:float | None = None, *, attempt:int = 0) -> float:
+ """
+ Return the effective timeout (seconds) with multiplier/backoff applied.
+ """
+ return self._get_timeout_config().effective(key, override, attempt = attempt)
+
+ def _timeout_attempts(self) -> int:
+ cfg = self._get_timeout_config()
+ if not cfg.retry_enabled:
+ return 1
+ # Always perform the initial attempt plus the configured number of retries.
+ return 1 + cfg.retry_max_attempts
+
+ async def _run_with_timeout_retries(
+ self,
+ operation:Callable[[float], Awaitable[T]],
+ *,
+ description:str,
+ key:str = "default",
+ override:float | None = None
+ ) -> T:
+ """
+ Execute an async callable with retry/backoff handling for TimeoutError.
+ """
+ attempts = self._timeout_attempts()
+
+ for attempt in range(attempts):
+ effective_timeout = self._effective_timeout(key, override, attempt = attempt)
+ try:
+ return await operation(effective_timeout)
+ except TimeoutError:
+ if attempt >= attempts - 1:
+ raise
+ LOG.debug(
+ "Retrying %s after TimeoutError (attempt %d/%d, timeout %.1fs)",
+ description,
+ attempt + 1,
+ attempts,
+ effective_timeout
+ )
+
+ raise TimeoutError(f"{description} failed without executing operation")
async def create_browser_session(self) -> None:
LOG.info("Creating Browser session...")
@@ -137,7 +204,7 @@ class WebScrapingMixin:
f"Make sure the browser is running and the port is not blocked by firewall.")
try:
- cfg = Config(
+ cfg = NodriverConfig(
browser_executable_path = self.browser_config.binary_location # actually not necessary but nodriver fails without
)
cfg.host = remote_host
@@ -207,7 +274,7 @@ class WebScrapingMixin:
if self.browser_config.user_data_dir:
LOG.info(" -> Browser user data dir: %s", self.browser_config.user_data_dir)
- cfg = Config(
+ cfg = NodriverConfig(
headless = False,
browser_executable_path = self.browser_config.binary_location,
browser_args = browser_args,
@@ -355,7 +422,8 @@ class WebScrapingMixin:
LOG.info("(ok) Remote debugging port is open")
# Try to get more information about the debugging endpoint
try:
- response = urllib.request.urlopen(f"http://127.0.0.1:{remote_port}/json/version", timeout = 2)
+ probe_timeout = self._effective_timeout("chrome_remote_probe")
+ response = urllib.request.urlopen(f"http://127.0.0.1:{remote_port}/json/version", timeout = probe_timeout)
version_info = json.loads(response.read().decode())
LOG.info("(ok) Remote debugging API accessible - Browser: %s", version_info.get("Browser", "Unknown"))
except Exception as e:
@@ -378,30 +446,34 @@ class WebScrapingMixin:
except (AssertionError, TypeError):
target_browser_name = ""
- for proc in psutil.process_iter(["pid", "name", "cmdline"]):
- try:
- proc_name = proc.info["name"] or ""
- cmdline = proc.info["cmdline"] or []
+ try:
+ for proc in psutil.process_iter(["pid", "name", "cmdline"]):
+ try:
+ proc_name = proc.info["name"] or ""
+ cmdline = proc.info["cmdline"] or []
- # Check if this is a browser process relevant to our diagnostics
- is_relevant_browser = False
+ # Check if this is a browser process relevant to our diagnostics
+ is_relevant_browser = False
- # Is this the target browser?
- is_target_browser = target_browser_name and target_browser_name in proc_name.lower()
+ # Is this the target browser?
+ is_target_browser = target_browser_name and target_browser_name in proc_name.lower()
- # Does it have remote debugging?
- has_remote_debugging = cmdline and any(arg.startswith("--remote-debugging-port=") for arg in cmdline)
+ # Does it have remote debugging?
+ has_remote_debugging = cmdline and any(arg.startswith("--remote-debugging-port=") for arg in cmdline)
- # Detect target browser processes for diagnostics
- if is_target_browser:
- is_relevant_browser = True
- # Add debugging status to the process info for better diagnostics
- proc.info["has_remote_debugging"] = has_remote_debugging
+ # Detect target browser processes for diagnostics
+ if is_target_browser:
+ is_relevant_browser = True
+ # Add debugging status to the process info for better diagnostics
+ proc.info["has_remote_debugging"] = has_remote_debugging
- if is_relevant_browser:
- browser_processes.append(proc.info)
- except (psutil.NoSuchProcess, psutil.AccessDenied):
- pass
+ if is_relevant_browser:
+ browser_processes.append(proc.info)
+ except (psutil.NoSuchProcess, psutil.AccessDenied):
+ pass
+ except (psutil.Error, PermissionError) as exc:
+ LOG.warning("(warn) Unable to inspect browser processes: %s", exc)
+ browser_processes = []
if browser_processes:
LOG.info("(info) Found %d browser processes running", len(browser_processes))
@@ -486,15 +558,17 @@ class WebScrapingMixin:
raise AssertionError(_("Installed browser could not be detected"))
async def web_await(self, condition:Callable[[], T | Never | Coroutine[Any, Any, T | Never]], *,
- timeout:int | float = 5, timeout_error_message:str = "") -> T:
+ timeout:int | float | None = None, timeout_error_message:str = "", apply_multiplier:bool = True) -> T:
"""
Blocks/waits until the given condition is met.
- :param timeout: timeout in seconds
+ :param timeout: timeout in seconds (base value, multiplier applied unless disabled)
:raises TimeoutError: if element could not be found within time
"""
loop = asyncio.get_running_loop()
start_at = loop.time()
+ base_timeout = timeout if timeout is not None else self._timeout()
+ effective_timeout = self._effective_timeout(override = base_timeout) if apply_multiplier else base_timeout
while True:
await self.page
@@ -506,13 +580,13 @@ class WebScrapingMixin:
return result
except Exception as ex1:
ex = ex1
- if loop.time() - start_at > timeout:
+ if loop.time() - start_at > effective_timeout:
if ex:
raise ex
- raise TimeoutError(timeout_error_message or f"Condition not met within {timeout} seconds")
+ raise TimeoutError(timeout_error_message or f"Condition not met within {effective_timeout} seconds")
await self.page.sleep(0.5)
- async def web_check(self, selector_type:By, selector_value:str, attr:Is, *, timeout:int | float = 5) -> bool:
+ async def web_check(self, selector_type:By, selector_value:str, attr:Is, *, timeout:int | float | None = None) -> bool:
"""
Locates an HTML element and returns a state.
@@ -559,7 +633,7 @@ class WebScrapingMixin:
"""))
raise AssertionError(_("Unsupported attribute: %s") % attr)
- async def web_click(self, selector_type:By, selector_value:str, *, timeout:int | float = 5) -> Element:
+ async def web_click(self, selector_type:By, selector_value:str, *, timeout:int | float | None = None) -> Element:
"""
Locates an HTML element by ID.
@@ -652,91 +726,130 @@ class WebScrapingMixin:
# Return primitive values as-is
return data
- async def web_find(self, selector_type:By, selector_value:str, *, parent:Element | None = None, timeout:int | float = 5) -> Element:
+ async def web_find(self, selector_type:By, selector_value:str, *, parent:Element | None = None, timeout:int | float | None = None) -> Element:
"""
Locates an HTML element by the given selector type and value.
- :param timeout: timeout in seconds
+ :param timeout: timeout in seconds (base value before multiplier/backoff)
:raises TimeoutError: if element could not be found within time
"""
+
+ async def attempt(effective_timeout:float) -> Element:
+ return await self._web_find_once(selector_type, selector_value, effective_timeout, parent = parent)
+
+ return await self._run_with_timeout_retries(
+ attempt,
+ description = f"web_find({selector_type.name}, {selector_value})",
+ key = "default",
+ override = timeout
+ )
+
+ async def web_find_all(self, selector_type:By, selector_value:str, *, parent:Element | None = None, timeout:int | float | None = None) -> list[Element]:
+ """
+ Locates multiple HTML elements by the given selector type and value.
+
+ :param timeout: timeout in seconds (base value before multiplier/backoff)
+ :raises TimeoutError: if element could not be found within time
+ """
+
+ async def attempt(effective_timeout:float) -> list[Element]:
+ return await self._web_find_all_once(selector_type, selector_value, effective_timeout, parent = parent)
+
+ return await self._run_with_timeout_retries(
+ attempt,
+ description = f"web_find_all({selector_type.name}, {selector_value})",
+ key = "default",
+ override = timeout
+ )
+
+ async def _web_find_once(self, selector_type:By, selector_value:str, timeout:float, *, parent:Element | None = None) -> Element:
+ timeout_suffix = f" within {timeout} seconds."
+
match selector_type:
case By.ID:
escaped_id = selector_value.translate(METACHAR_ESCAPER)
return await self.web_await(
lambda: self.page.query_selector(f"#{escaped_id}", parent),
timeout = timeout,
- timeout_error_message = f"No HTML element found with ID '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML element found with ID '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.CLASS_NAME:
escaped_classname = selector_value.translate(METACHAR_ESCAPER)
return await self.web_await(
lambda: self.page.query_selector(f".{escaped_classname}", parent),
timeout = timeout,
- timeout_error_message = f"No HTML element found with CSS class '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML element found with CSS class '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.TAG_NAME:
return await self.web_await(
lambda: self.page.query_selector(selector_value, parent),
timeout = timeout,
- timeout_error_message = f"No HTML element found of tag <{selector_value}> within {timeout} seconds.")
+ timeout_error_message = f"No HTML element found of tag <{selector_value}>{timeout_suffix}",
+ apply_multiplier = False)
case By.CSS_SELECTOR:
return await self.web_await(
lambda: self.page.query_selector(selector_value, parent),
timeout = timeout,
- timeout_error_message = f"No HTML element found using CSS selector '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML element found using CSS selector '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.TEXT:
ensure(not parent, f"Specifying a parent element currently not supported with selector type: {selector_type}")
return await self.web_await(
lambda: self.page.find_element_by_text(selector_value, best_match = True),
timeout = timeout,
- timeout_error_message = f"No HTML element found containing text '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML element found containing text '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.XPATH:
ensure(not parent, f"Specifying a parent element currently not supported with selector type: {selector_type}")
return await self.web_await(
lambda: self.page.find_element_by_text(selector_value, best_match = True),
timeout = timeout,
- timeout_error_message = f"No HTML element found using XPath '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML element found using XPath '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
raise AssertionError(_("Unsupported selector type: %s") % selector_type)
- async def web_find_all(self, selector_type:By, selector_value:str, *, parent:Element | None = None, timeout:int | float = 5) -> list[Element]:
- """
- Locates an HTML element by ID.
+ async def _web_find_all_once(self, selector_type:By, selector_value:str, timeout:float, *, parent:Element | None = None) -> list[Element]:
+ timeout_suffix = f" within {timeout} seconds."
- :param timeout: timeout in seconds
- :raises TimeoutError: if element could not be found within time
- """
match selector_type:
case By.CLASS_NAME:
escaped_classname = selector_value.translate(METACHAR_ESCAPER)
return await self.web_await(
lambda: self.page.query_selector_all(f".{escaped_classname}", parent),
timeout = timeout,
- timeout_error_message = f"No HTML elements found with CSS class '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML elements found with CSS class '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.CSS_SELECTOR:
return await self.web_await(
lambda: self.page.query_selector_all(selector_value, parent),
timeout = timeout,
- timeout_error_message = f"No HTML elements found using CSS selector '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML elements found using CSS selector '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.TAG_NAME:
return await self.web_await(
lambda: self.page.query_selector_all(selector_value, parent),
timeout = timeout,
- timeout_error_message = f"No HTML elements found of tag <{selector_value}> within {timeout} seconds.")
+ timeout_error_message = f"No HTML elements found of tag <{selector_value}>{timeout_suffix}",
+ apply_multiplier = False)
case By.TEXT:
ensure(not parent, f"Specifying a parent element currently not supported with selector type: {selector_type}")
return await self.web_await(
lambda: self.page.find_elements_by_text(selector_value),
timeout = timeout,
- timeout_error_message = f"No HTML elements found containing text '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML elements found containing text '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
case By.XPATH:
ensure(not parent, f"Specifying a parent element currently not supported with selector type: {selector_type}")
return await self.web_await(
lambda: self.page.find_elements_by_text(selector_value),
timeout = timeout,
- timeout_error_message = f"No HTML elements found using XPath '{selector_value}' within {timeout} seconds.")
+ timeout_error_message = f"No HTML elements found using XPath '{selector_value}'{timeout_suffix}",
+ apply_multiplier = False)
raise AssertionError(_("Unsupported selector type: %s") % selector_type)
- async def web_input(self, selector_type:By, selector_value:str, text:str | int, *, timeout:int | float = 5) -> Element:
+ async def web_input(self, selector_type:By, selector_value:str, text:str | int, *, timeout:int | float | None = None) -> Element:
"""
Enters text into an HTML input field.
@@ -749,10 +862,10 @@ class WebScrapingMixin:
await self.web_sleep()
return input_field
- async def web_open(self, url:str, *, timeout:int | float = 15_000, reload_if_already_open:bool = False) -> None:
+ async def web_open(self, url:str, *, timeout:int | float | None = None, reload_if_already_open:bool = False) -> None:
"""
:param url: url to open in browser
- :param timeout: timespan in seconds within the page needs to be loaded
+ :param timeout: timespan in seconds within the page needs to be loaded (base value)
:param reload_if_already_open: if False does nothing if the URL is already open in the browser
:raises TimeoutException: if page did not open within given timespan
"""
@@ -761,10 +874,15 @@ class WebScrapingMixin:
LOG.debug(" => skipping, [%s] is already open", url)
return
self.page = await self.browser.get(url = url, new_tab = False, new_window = False)
- await self.web_await(lambda: self.web_execute("document.readyState == 'complete'"), timeout = timeout,
- timeout_error_message = f"Page did not finish loading within {timeout} seconds.")
+ page_timeout = self._effective_timeout("page_load", timeout)
+ await self.web_await(
+ lambda: self.web_execute("document.readyState == 'complete'"),
+ timeout = page_timeout,
+ timeout_error_message = f"Page did not finish loading within {page_timeout} seconds.",
+ apply_multiplier = False
+ )
- async def web_text(self, selector_type:By, selector_value:str, *, parent:Element | None = None, timeout:int | float = 5) -> str:
+ async def web_text(self, selector_type:By, selector_value:str, *, parent:Element | None = None, timeout:int | float | None = None) -> str:
return str(await (await self.web_find(selector_type, selector_value, parent = parent, timeout = timeout)).apply("""
function (elem) {
let sel = window.getSelection()
@@ -835,7 +953,7 @@ class WebScrapingMixin:
await self.web_execute(f"window.scrollTo(0, {current_y_pos})")
await asyncio.sleep(scroll_length / scroll_speed / 2) # double speed
- async def web_select(self, selector_type:By, selector_value:str, selected_value:Any, timeout:int | float = 5) -> Element:
+ async def web_select(self, selector_type:By, selector_value:str, selected_value:Any, timeout:int | float | None = None) -> Element:
"""
Selects an of a HTML element.
@@ -895,7 +1013,11 @@ class WebScrapingMixin:
port_available = await self._check_port_with_retry(remote_host, remote_port)
if port_available:
try:
- version_info = detect_chrome_version_from_remote_debugging(remote_host, remote_port)
+ version_info = detect_chrome_version_from_remote_debugging(
+ remote_host,
+ remote_port,
+ timeout = self._effective_timeout("chrome_remote_debugging")
+ )
if version_info:
LOG.debug(" -> Detected version from existing browser: %s", version_info)
else:
@@ -910,7 +1032,10 @@ class WebScrapingMixin:
binary_path = self.browser_config.binary_location
if binary_path:
LOG.debug(" -> No remote browser detected, trying binary detection")
- version_info = detect_chrome_version_from_binary(binary_path)
+ version_info = detect_chrome_version_from_binary(
+ binary_path,
+ timeout = self._effective_timeout("chrome_binary_detection")
+ )
# Validate if Chrome 136+ detected
if version_info and version_info.is_chrome_136_plus:
@@ -977,7 +1102,10 @@ class WebScrapingMixin:
binary_path = self.browser_config.binary_location
diagnostic_info = get_chrome_version_diagnostic_info(
binary_path = binary_path,
- remote_port = remote_port if remote_port > 0 else None
+ remote_host = "127.0.0.1",
+ remote_port = remote_port if remote_port > 0 else None,
+ remote_timeout = self._effective_timeout("chrome_remote_debugging"),
+ binary_timeout = self._effective_timeout("chrome_binary_detection")
)
# Report binary detection results
diff --git a/tests/unit/test_config_model.py b/tests/unit/test_config_model.py
index aa4789f..0e48ecb 100644
--- a/tests/unit/test_config_model.py
+++ b/tests/unit/test_config_model.py
@@ -1,7 +1,9 @@
# SPDX-FileCopyrightText: © Sebastian Thomschke and contributors
# SPDX-License-Identifier: AGPL-3.0-or-later
# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/
-from kleinanzeigen_bot.model.config_model import AdDefaults, Config
+import pytest
+
+from kleinanzeigen_bot.model.config_model import AdDefaults, Config, TimeoutConfig
def test_migrate_legacy_description_prefix() -> None:
@@ -74,3 +76,50 @@ def test_minimal_config_validation() -> None:
config = Config.model_validate(minimal_cfg)
assert config.login.username == "dummy"
assert config.login.password == "dummy" # noqa: S105
+
+
+def test_timeout_config_defaults_and_effective_values() -> None:
+ cfg = Config.model_validate({
+ "login": {"username": "dummy", "password": "dummy"}, # noqa: S105
+ "timeouts": {
+ "multiplier": 2.0,
+ "pagination_initial": 12.0,
+ "retry_max_attempts": 3,
+ "retry_backoff_factor": 2.0
+ }
+ })
+
+ timeouts = cfg.timeouts
+ base = timeouts.resolve("pagination_initial")
+ multiplier = timeouts.multiplier
+ backoff = timeouts.retry_backoff_factor
+ assert base == 12.0
+ assert timeouts.effective("pagination_initial") == base * multiplier * (backoff ** 0)
+ # attempt 1 should apply backoff factor once in addition to multiplier
+ assert timeouts.effective("pagination_initial", attempt = 1) == base * multiplier * (backoff ** 1)
+
+
+def test_validate_glob_pattern_rejects_blank_strings() -> None:
+ with pytest.raises(ValueError, match = "must be a non-empty, non-blank glob pattern"):
+ Config.model_validate({
+ "ad_files": [" "],
+ "ad_defaults": {"contact": {"name": "dummy", "zipcode": "12345"}},
+ "login": {"username": "dummy", "password": "dummy"}
+ })
+
+ cfg = Config.model_validate({
+ "ad_files": ["*.yaml"],
+ "ad_defaults": {"contact": {"name": "dummy", "zipcode": "12345"}},
+ "login": {"username": "dummy", "password": "dummy"}
+ })
+ assert cfg.ad_files == ["*.yaml"]
+
+
+def test_timeout_config_resolve_returns_specific_value() -> None:
+ timeouts = TimeoutConfig(default = 4.0, page_load = 12.5)
+ assert timeouts.resolve("page_load") == 12.5
+
+
+def test_timeout_config_resolve_falls_back_to_default() -> None:
+ timeouts = TimeoutConfig(default = 3.0)
+ assert timeouts.resolve("nonexistent_key") == 3.0
diff --git a/tests/unit/test_extract.py b/tests/unit/test_extract.py
index 8244348..d91da9f 100644
--- a/tests/unit/test_extract.py
+++ b/tests/unit/test_extract.py
@@ -412,6 +412,60 @@ class TestAdExtractorNavigation:
call(By.CLASS_NAME, "cardbox", parent = ad_list_container_mock),
], any_order = False)
+ @pytest.mark.asyncio
+ async def test_extract_own_ads_urls_paginates_with_enabled_next_button(self, test_extractor:AdExtractor) -> None:
+ """Ensure the paginator clicks the first enabled next button and advances."""
+ ad_list_container_mock = MagicMock()
+ pagination_section_mock = MagicMock()
+ cardbox_page_one = MagicMock()
+ cardbox_page_two = MagicMock()
+ link_page_one = MagicMock(attrs = {"href": "/s-anzeige/page-one/111"})
+ link_page_two = MagicMock(attrs = {"href": "/s-anzeige/page-two/222"})
+
+ next_button_enabled = AsyncMock()
+ next_button_enabled.attrs = {}
+ disabled_button = MagicMock()
+ disabled_button.attrs = {"disabled": True}
+
+ link_queue = [link_page_one, link_page_two]
+ next_button_call = {"count": 0}
+ cardbox_call = {"count": 0}
+
+ async def fake_web_find(selector_type:By, selector_value:str, *, parent:Element | None = None,
+ timeout:int | float | None = None) -> Element:
+ if selector_type == By.ID and selector_value == "my-manageitems-adlist":
+ return ad_list_container_mock
+ if selector_type == By.CSS_SELECTOR and selector_value == ".Pagination":
+ return pagination_section_mock
+ if selector_type == By.CSS_SELECTOR and selector_value == "div h3 a.text-onSurface":
+ return link_queue.pop(0)
+ raise AssertionError(f"Unexpected selector {selector_type} {selector_value}")
+
+ async def fake_web_find_all(selector_type:By, selector_value:str, *, parent:Element | None = None,
+ timeout:int | float | None = None) -> list[Element]:
+ if selector_type == By.CSS_SELECTOR and selector_value == 'button[aria-label="Nächste"]':
+ next_button_call["count"] += 1
+ if next_button_call["count"] == 1:
+ return [next_button_enabled] # initial detection -> multi page
+ if next_button_call["count"] == 2:
+ return [disabled_button, next_button_enabled] # navigation on page 1
+ return [] # after navigating, stop
+ if selector_type == By.CLASS_NAME and selector_value == "cardbox":
+ cardbox_call["count"] += 1
+ return [cardbox_page_one] if cardbox_call["count"] == 1 else [cardbox_page_two]
+ raise AssertionError(f"Unexpected find_all selector {selector_type} {selector_value}")
+
+ with patch.object(test_extractor, "web_open", new_callable = AsyncMock), \
+ patch.object(test_extractor, "web_scroll_page_down", new_callable = AsyncMock), \
+ patch.object(test_extractor, "web_sleep", new_callable = AsyncMock), \
+ patch.object(test_extractor, "web_find", new_callable = AsyncMock, side_effect = fake_web_find), \
+ patch.object(test_extractor, "web_find_all", new_callable = AsyncMock, side_effect = fake_web_find_all):
+
+ refs = await test_extractor.extract_own_ads_urls()
+
+ assert refs == ["/s-anzeige/page-one/111", "/s-anzeige/page-two/222"]
+ next_button_enabled.click.assert_awaited() # triggered once during navigation
+
class TestAdExtractorContent:
"""Tests for content extraction functionality."""
@@ -641,6 +695,24 @@ class TestAdExtractorCategory:
mock_web_find.assert_any_call(By.CSS_SELECTOR, "a:nth-of-type(3)", parent = category_line)
mock_web_find_all.assert_awaited_once_with(By.CSS_SELECTOR, "a", parent = category_line)
+ @pytest.mark.asyncio
+ async def test_extract_category_legacy_selectors_timeout(self, extractor:AdExtractor, caplog:pytest.LogCaptureFixture) -> None:
+ """Ensure fallback timeout logs the error and re-raises with translated message."""
+ category_line = MagicMock()
+
+ async def fake_web_find(selector_type:By, selector_value:str, *, parent:Element | None = None,
+ timeout:int | float | None = None) -> Element:
+ if selector_type == By.ID and selector_value == "vap-brdcrmb":
+ return category_line
+ raise TimeoutError("legacy selectors missing")
+
+ with patch.object(extractor, "web_find", new_callable = AsyncMock, side_effect = fake_web_find), \
+ patch.object(extractor, "web_find_all", new_callable = AsyncMock, side_effect = TimeoutError), \
+ caplog.at_level("ERROR"), pytest.raises(TimeoutError, match = "Unable to locate breadcrumb fallback selectors"):
+ await extractor._extract_category_from_ad_page()
+
+ assert any("Legacy breadcrumb selectors not found" in record.message for record in caplog.records)
+
@pytest.mark.asyncio
# pylint: disable=protected-access
async def test_extract_special_attributes_empty(self, extractor:AdExtractor) -> None:
diff --git a/tests/unit/test_update_checker.py b/tests/unit/test_update_checker.py
index 32e4747..2c08be9 100644
--- a/tests/unit/test_update_checker.py
+++ b/tests/unit/test_update_checker.py
@@ -95,6 +95,18 @@ class TestUpdateChecker:
with patch("requests.get", return_value = MagicMock(json = lambda: {"target_commitish": "e7a3d46"})):
assert checker._get_release_commit("latest") == "e7a3d46"
+ def test_request_timeout_uses_config(self, config:Config, mocker:"MockerFixture") -> None:
+ """Ensure HTTP calls honor the timeout configuration."""
+ config.timeouts.multiplier = 1.5
+ checker = UpdateChecker(config)
+ mock_response = MagicMock(json = lambda: {"target_commitish": "abc"})
+ mock_get = mocker.patch("requests.get", return_value = mock_response)
+
+ checker._get_release_commit("latest")
+
+ expected_timeout = config.timeouts.effective("update_check")
+ assert mock_get.call_args.kwargs["timeout"] == expected_timeout
+
def test_get_commit_date(self, config:Config) -> None:
"""Test that the commit date is correctly retrieved from the GitHub API."""
checker = UpdateChecker(config)
diff --git a/tests/unit/test_web_scraping_mixin.py b/tests/unit/test_web_scraping_mixin.py
index fad2456..7ac4ade 100644
--- a/tests/unit/test_web_scraping_mixin.py
+++ b/tests/unit/test_web_scraping_mixin.py
@@ -8,12 +8,14 @@ All rights reserved.
"""
import json
+import logging
import os
import platform
import shutil
import zipfile
+from collections.abc import Awaitable, Callable
from pathlib import Path
-from typing import NoReturn, Protocol, cast
+from typing import Any, NoReturn, Protocol, cast
from unittest.mock import AsyncMock, MagicMock, Mock, mock_open, patch
import nodriver
@@ -22,6 +24,7 @@ import pytest
from nodriver.core.element import Element
from nodriver.core.tab import Tab as Page
+from kleinanzeigen_bot.model.config_model import Config
from kleinanzeigen_bot.utils import loggers
from kleinanzeigen_bot.utils.web_scraping_mixin import By, Is, WebScrapingMixin, _is_admin # noqa: PLC2701
@@ -32,7 +35,13 @@ class ConfigProtocol(Protocol):
browser_args:list[str]
user_data_dir:str | None
- def add_extension(self, ext:str) -> None: ...
+ def add_extension(self, ext:str) -> None:
+ ...
+
+
+def _nodriver_start_mock() -> Mock:
+ """Return the nodriver.start mock with proper typing."""
+ return cast(Mock, cast(Any, nodriver).start)
class TrulyAwaitableMockPage:
@@ -82,6 +91,7 @@ def web_scraper(mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> Web
scraper = WebScrapingMixin()
scraper.browser = mock_browser
scraper.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue]
+ scraper.config = Config.model_validate({"login": {"username": "user@example.com", "password": "secret"}}) # noqa: S105
return scraper
@@ -156,6 +166,21 @@ class TestWebScrapingErrorHandling:
with pytest.raises(Exception, match = "Cannot clear input"):
await web_scraper.web_input(By.ID, "test-id", "test text")
+ @pytest.mark.asyncio
+ async def test_web_input_success_returns_element(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
+ """Successful web_input should send keys, wait, and return the element."""
+ mock_element = AsyncMock(spec = Element)
+ mock_page.query_selector.return_value = mock_element
+ mock_sleep = AsyncMock()
+ cast(Any, web_scraper).web_sleep = mock_sleep
+
+ result = await web_scraper.web_input(By.ID, "username", "hello world", timeout = 1)
+
+ assert result is mock_element
+ mock_element.clear_input.assert_awaited_once()
+ mock_element.send_keys.assert_awaited_once_with("hello world")
+ mock_sleep.assert_awaited_once()
+
@pytest.mark.asyncio
async def test_web_open_timeout(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
"""Test page load timeout in web_open."""
@@ -173,6 +198,19 @@ class TestWebScrapingErrorHandling:
with pytest.raises(TimeoutError, match = "Page did not finish loading within"):
await web_scraper.web_open("https://example.com", timeout = 0.1)
+ @pytest.mark.asyncio
+ async def test_web_open_skip_when_url_already_loaded(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> None:
+ """web_open should short-circuit when the requested URL is already active."""
+ mock_browser.get.reset_mock()
+ mock_page.url = "https://example.com"
+ mock_execute = AsyncMock()
+ cast(Any, web_scraper).web_execute = mock_execute
+
+ await web_scraper.web_open("https://example.com", reload_if_already_open = False)
+
+ mock_browser.get.assert_not_awaited()
+ mock_execute.assert_not_called()
+
@pytest.mark.asyncio
async def test_web_request_invalid_response(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test invalid response handling in web_request."""
@@ -216,6 +254,179 @@ class TestWebScrapingErrorHandling:
with pytest.raises(Exception, match = "Attribute error"):
await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED)
+ @pytest.mark.asyncio
+ async def test_web_find_applies_timeout_multiplier_and_backoff(self, web_scraper:WebScrapingMixin) -> None:
+ """Ensure multiplier/backoff logic is honored when timeouts occur."""
+ assert web_scraper.config is not None
+ web_scraper.config.timeouts.multiplier = 2.0
+ web_scraper.config.timeouts.retry_enabled = True
+ web_scraper.config.timeouts.retry_max_attempts = 2
+ web_scraper.config.timeouts.retry_backoff_factor = 2.0
+
+ recorded:list[tuple[float, bool]] = []
+
+ async def fake_web_await(condition:Callable[[], object], *, timeout:float, timeout_error_message:str = "",
+ apply_multiplier:bool = True) -> Element:
+ recorded.append((timeout, apply_multiplier))
+ raise TimeoutError(timeout_error_message or "timeout")
+
+ cast(Any, web_scraper).web_await = fake_web_await
+
+ with pytest.raises(TimeoutError):
+ await web_scraper.web_find(By.ID, "test-id", timeout = 0.5)
+
+ assert recorded == [(1.0, False), (2.0, False), (4.0, False)]
+
+
+class TestTimeoutAndRetryHelpers:
+ """Test timeout helper utilities in WebScrapingMixin."""
+
+ def test_get_timeout_config_prefers_config_timeouts(self, web_scraper:WebScrapingMixin) -> None:
+ """_get_timeout_config should return the config-provided timeout model when available."""
+ custom_config = Config.model_validate({
+ "login": {"username": "user@example.com", "password": "secret"}, # noqa: S105
+ "timeouts": {"default": 7.5}
+ })
+ web_scraper.config = custom_config
+
+ assert web_scraper._get_timeout_config() is custom_config.timeouts
+
+ def test_timeout_attempts_respects_retry_switch(self, web_scraper:WebScrapingMixin) -> None:
+ """_timeout_attempts should collapse to a single attempt when retries are disabled."""
+ web_scraper.config.timeouts.retry_enabled = False
+ assert web_scraper._timeout_attempts() == 1
+
+ web_scraper.config.timeouts.retry_enabled = True
+ web_scraper.config.timeouts.retry_max_attempts = 3
+ assert web_scraper._timeout_attempts() == 4
+
+ @pytest.mark.asyncio
+ async def test_run_with_timeout_retries_retries_operation(self, web_scraper:WebScrapingMixin) -> None:
+ """_run_with_timeout_retries should retry when TimeoutError is raised before succeeding."""
+ attempts:list[float] = []
+
+ async def flaky_operation(timeout:float) -> str:
+ attempts.append(timeout)
+ if len(attempts) == 1:
+ raise TimeoutError("first attempt")
+ return "done"
+
+ web_scraper.config.timeouts.retry_max_attempts = 1
+ result = await web_scraper._run_with_timeout_retries(flaky_operation, description = "retry-op")
+
+ assert result == "done"
+ assert len(attempts) == 2
+
+ @pytest.mark.asyncio
+ async def test_run_with_timeout_retries_guard_clause(self, web_scraper:WebScrapingMixin) -> None:
+ """_run_with_timeout_retries should guard against zero-attempt edge cases."""
+ async def never_called(timeout:float) -> None:
+ pytest.fail("operation should not run when attempts are zero")
+
+ with patch.object(web_scraper, "_timeout_attempts", return_value = 0), \
+ pytest.raises(TimeoutError, match = "guarded-op failed without executing operation"):
+ await web_scraper._run_with_timeout_retries(never_called, description = "guarded-op")
+
+
+class TestSelectorTimeoutMessages:
+ """Ensure selector helpers provide informative timeout messages."""
+
+ @pytest.mark.asyncio
+ @pytest.mark.parametrize(
+ ("selector_type", "selector_value", "expected_message"),
+ [
+ (By.TAG_NAME, "section", "No HTML element found of tag within 2.0 seconds."),
+ (By.CSS_SELECTOR, ".hero", "No HTML element found using CSS selector '.hero' within 2.0 seconds."),
+ (By.TEXT, "Submit", "No HTML element found containing text 'Submit' within 2.0 seconds."),
+ (By.XPATH, "//div[@class='hero']", "No HTML element found using XPath '//div[@class='hero']' within 2.0 seconds."),
+ ]
+ )
+ async def test_web_find_timeout_suffixes(
+ self,
+ web_scraper:WebScrapingMixin,
+ selector_type:By,
+ selector_value:str,
+ expected_message:str
+ ) -> None:
+ """web_find should pass descriptive timeout messages for every selector strategy."""
+ mock_element = AsyncMock(spec = Element)
+ mock_wait = AsyncMock(return_value = mock_element)
+ cast(Any, web_scraper).web_await = mock_wait
+
+ result = await web_scraper.web_find(selector_type, selector_value, timeout = 2)
+
+ assert result is mock_element
+ call = mock_wait.await_args_list[0]
+ assert expected_message == call.kwargs["timeout_error_message"]
+ assert call.kwargs["apply_multiplier"] is False
+
+ @pytest.mark.asyncio
+ @pytest.mark.parametrize(
+ ("selector_type", "selector_value", "expected_message"),
+ [
+ (By.CLASS_NAME, "hero", "No HTML elements found with CSS class 'hero' within 1 seconds."),
+ (By.CSS_SELECTOR, ".card", "No HTML elements found using CSS selector '.card' within 1 seconds."),
+ (By.TAG_NAME, "article", "No HTML elements found of tag within 1 seconds."),
+ (By.TEXT, "Listings", "No HTML elements found containing text 'Listings' within 1 seconds."),
+ (By.XPATH, "//footer", "No HTML elements found using XPath '//footer' within 1 seconds."),
+ ]
+ )
+ async def test_web_find_all_once_timeout_suffixes(
+ self,
+ web_scraper:WebScrapingMixin,
+ selector_type:By,
+ selector_value:str,
+ expected_message:str
+ ) -> None:
+ """_web_find_all_once should surface informative timeout errors for each selector."""
+ elements = [AsyncMock(spec = Element)]
+ mock_wait = AsyncMock(return_value = elements)
+ cast(Any, web_scraper).web_await = mock_wait
+
+ result = await web_scraper._web_find_all_once(selector_type, selector_value, 1)
+
+ assert result is elements
+ call = mock_wait.await_args_list[0]
+ assert expected_message == call.kwargs["timeout_error_message"]
+ assert call.kwargs["apply_multiplier"] is False
+
+ @pytest.mark.asyncio
+ async def test_web_find_all_delegates_to_retry_helper(self, web_scraper:WebScrapingMixin) -> None:
+ """web_find_all should execute via the timeout retry helper."""
+ elements = [AsyncMock(spec = Element)]
+
+ async def fake_retry(operation:Callable[[float], Awaitable[list[Element]]], **kwargs:Any) -> list[Element]:
+ assert kwargs["description"] == "web_find_all(CLASS_NAME, hero)"
+ assert kwargs["override"] == 1.5
+ result = await operation(0.42)
+ return result
+
+ retry_mock = AsyncMock(side_effect = fake_retry)
+ once_mock = AsyncMock(return_value = elements)
+ cast(Any, web_scraper)._run_with_timeout_retries = retry_mock
+ cast(Any, web_scraper)._web_find_all_once = once_mock
+
+ result = await web_scraper.web_find_all(By.CLASS_NAME, "hero", timeout = 1.5)
+
+ assert result is elements
+ retry_call = retry_mock.await_args_list[0]
+ assert retry_call.kwargs["key"] == "default"
+ assert retry_call.kwargs["override"] == 1.5
+
+ once_call = once_mock.await_args_list[0]
+ assert once_call.args[:2] == (By.CLASS_NAME, "hero")
+ assert once_call.args[2] == 0.42
+
+ @pytest.mark.asyncio
+ async def test_web_check_unsupported_attribute(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
+ """web_check should raise for unsupported attribute queries."""
+ mock_element = AsyncMock(spec = Element)
+ mock_element.attrs = {}
+ mock_page.query_selector.return_value = mock_element
+
+ with pytest.raises(AssertionError, match = "Unsupported attribute"):
+ await web_scraper.web_check(By.ID, "test-id", cast(Is, object()), timeout = 0.1)
+
class TestWebScrapingSessionManagement:
"""Test session management edge cases in WebScrapingMixin."""
@@ -295,9 +506,42 @@ class TestWebScrapingSessionManagement:
with patch("psutil.Process") as mock_proc:
mock_proc.return_value.children.return_value = []
scraper.close_browser_session()
- stop_mock.assert_called_once()
- assert scraper.browser is None
- assert scraper.page is None
+ stop_mock.assert_called_once()
+ assert scraper.browser is None
+ assert scraper.page is None
+
+
+class TestWebScrolling:
+ """Test scrolling helpers."""
+
+ @pytest.mark.asyncio
+ async def test_web_scroll_page_down_scrolls_and_returns(self, web_scraper:WebScrapingMixin) -> None:
+ """web_scroll_page_down should scroll both directions when requested."""
+ scripts:list[str] = []
+
+ async def exec_side_effect(script:str) -> int | None:
+ scripts.append(script)
+ if script == "document.body.scrollHeight":
+ return 20
+ return None
+
+ cast(Any, web_scraper).web_execute = AsyncMock(side_effect = exec_side_effect)
+
+ with patch("kleinanzeigen_bot.utils.web_scraping_mixin.asyncio.sleep", new_callable = AsyncMock) as mock_sleep:
+ await web_scraper.web_scroll_page_down(scroll_length = 10, scroll_speed = 10, scroll_back_top = True)
+
+ assert scripts[0] == "document.body.scrollHeight"
+ # Expect four scrollTo operations: two down, two up
+ assert scripts.count("document.body.scrollHeight") == 1
+ scroll_calls = [script for script in scripts if script.startswith("window.scrollTo")]
+ assert scroll_calls == [
+ "window.scrollTo(0, 10)",
+ "window.scrollTo(0, 20)",
+ "window.scrollTo(0, 10)",
+ "window.scrollTo(0, 0)"
+ ]
+ sleep_durations = [call.args[0] for call in mock_sleep.await_args_list]
+ assert sleep_durations == [1.0, 1.0, 0.5, 0.5]
@pytest.mark.asyncio
async def test_session_expiration_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
@@ -468,7 +712,7 @@ class TestWebScrapingBrowserConfiguration:
def add_extension(self, ext:str) -> None:
self._extensions.append(ext) # Use private extensions list
- # Mock nodriver.start to return a mock browser # type: ignore[attr-defined]
+ # Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
@@ -557,7 +801,7 @@ class TestWebScrapingBrowserConfiguration:
def add_extension(self, ext:str) -> None:
self.extensions.append(ext)
- # Mock nodriver.start to return a mock browser # type: ignore[attr-defined]
+ # Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
@@ -576,7 +820,7 @@ class TestWebScrapingBrowserConfiguration:
await scraper.create_browser_session()
# Verify browser arguments
- config = cast(Mock, nodriver.start).call_args[0][0] # type: ignore[attr-defined]
+ config = _nodriver_start_mock().call_args[0][0]
assert "--custom-arg=value" in config.browser_args
assert "--another-arg" in config.browser_args
assert "--incognito" in config.browser_args
@@ -589,7 +833,7 @@ class TestWebScrapingBrowserConfiguration:
await scraper.create_browser_session()
# Verify Edge-specific arguments
- config = cast(Mock, nodriver.start).call_args[0][0] # type: ignore[attr-defined]
+ config = _nodriver_start_mock().call_args[0][0]
assert "-inprivate" in config.browser_args
assert os.environ.get("MSEDGEDRIVER_TELEMETRY_OPTOUT") == "1"
@@ -620,7 +864,7 @@ class TestWebScrapingBrowserConfiguration:
with zipfile.ZipFile(ext2, "w") as z:
z.writestr("manifest.json", '{"name": "Test Extension 2"}')
- # Mock nodriver.start to return a mock browser # type: ignore[attr-defined]
+ # Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
@@ -644,7 +888,7 @@ class TestWebScrapingBrowserConfiguration:
await scraper.create_browser_session()
# Verify extensions were loaded
- config = cast(Mock, nodriver.start).call_args[0][0] # type: ignore[attr-defined]
+ config = _nodriver_start_mock().call_args[0][0]
assert len(config._extensions) == 2
for ext_path in config._extensions:
assert os.path.exists(ext_path)
@@ -713,7 +957,7 @@ class TestWebScrapingBrowserConfiguration:
def add_extension(self, ext:str) -> None:
self._extensions.append(ext)
- # Mock nodriver.start to return a mock browser # type: ignore[attr-defined]
+ # Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
@@ -772,7 +1016,7 @@ class TestWebScrapingBrowserConfiguration:
temp_file = tmp_path / "temp_resource"
temp_file.write_text("test")
- # Mock nodriver.start to raise an exception # type: ignore[attr-defined]
+ # Mock nodriver.start to raise an exception
async def mock_start_fail(*args:object, **kwargs:object) -> NoReturn:
if temp_file.exists():
temp_file.unlink()
@@ -801,7 +1045,7 @@ class TestWebScrapingBrowserConfiguration:
assert scraper.browser is None
assert scraper.page is None
- # Now patch nodriver.start to return a new mock browser each time # type: ignore[attr-defined]
+ # Now patch nodriver.start to return a new mock browser each time
mock_browser = make_mock_browser()
mock_page = TrulyAwaitableMockPage()
mock_browser.get = AsyncMock(return_value = mock_page)
@@ -1445,6 +1689,46 @@ class TestWebScrapingDiagnostics:
# Should not raise any exceptions
web_scraper.diagnose_browser_issues()
+ def test_diagnose_browser_issues_handles_per_process_errors(
+ self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
+ ) -> None:
+ """diagnose_browser_issues should ignore psutil errors raised per process."""
+ caplog.set_level(logging.INFO)
+
+ class FailingProcess:
+
+ @property
+ def info(self) -> dict[str, object]:
+ raise psutil.AccessDenied(pid = 999)
+
+ with patch("os.path.exists", return_value = True), \
+ patch("os.access", return_value = True), \
+ patch("psutil.process_iter", return_value = [FailingProcess()]), \
+ patch("platform.system", return_value = "Linux"), \
+ patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
+ patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
+ scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
+ scraper_with_config.diagnose_browser_issues()
+
+ assert "(info) No browser processes currently running" in caplog.text
+
+ def test_diagnose_browser_issues_handles_global_psutil_failure(
+ self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
+ ) -> None:
+ """diagnose_browser_issues should log a warning if psutil.process_iter fails entirely."""
+ caplog.set_level(logging.WARNING)
+
+ with patch("os.path.exists", return_value = True), \
+ patch("os.access", return_value = True), \
+ patch("psutil.process_iter", side_effect = psutil.Error("boom")), \
+ patch("platform.system", return_value = "Linux"), \
+ patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
+ patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
+ scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
+ scraper_with_config.diagnose_browser_issues()
+
+ assert "(warn) Unable to inspect browser processes:" in caplog.text
+
@pytest.mark.asyncio
async def test_validate_chrome_version_configuration_port_open_but_api_inaccessible(
self, web_scraper:WebScrapingMixin
diff --git a/tests/unit/test_web_scraping_mixin_chrome_version.py b/tests/unit/test_web_scraping_mixin_chrome_version.py
index d74c6c6..62ac2d5 100644
--- a/tests/unit/test_web_scraping_mixin_chrome_version.py
+++ b/tests/unit/test_web_scraping_mixin_chrome_version.py
@@ -41,8 +41,11 @@ class TestWebScrapingMixinChromeVersionValidation:
# Test validation
await scraper._validate_chrome_version_configuration()
- # Verify detection was called correctly
- mock_detect.assert_called_once_with("/path/to/chrome")
+ # Verify detection was called correctly with timeout
+ assert mock_detect.call_count == 1
+ args, kwargs = mock_detect.call_args
+ assert args[0] == "/path/to/chrome"
+ assert kwargs["timeout"] == pytest.approx(10.0)
# Verify validation passed (no exception raised)
# The validation is now done internally in _validate_chrome_136_configuration
@@ -73,7 +76,10 @@ class TestWebScrapingMixinChromeVersionValidation:
# Test validation should log error but not raise exception due to error handling
await scraper._validate_chrome_version_configuration()
- # Verify error was logged
+ # Verify detection call and logged error
+ assert mock_detect.call_count == 1
+ _, kwargs = mock_detect.call_args
+ assert kwargs["timeout"] == pytest.approx(10.0)
assert "Chrome 136+ configuration validation failed" in caplog.text
assert "Chrome 136+ requires --user-data-dir" in caplog.text
finally:
@@ -104,12 +110,37 @@ class TestWebScrapingMixinChromeVersionValidation:
await scraper._validate_chrome_version_configuration()
# Verify detection was called but no validation
- mock_detect.assert_called_once_with("/path/to/chrome")
+ assert mock_detect.call_count == 1
+ _, kwargs = mock_detect.call_args
+ assert kwargs["timeout"] == pytest.approx(10.0)
finally:
# Restore environment
if original_env:
os.environ["PYTEST_CURRENT_TEST"] = original_env
+ @patch("kleinanzeigen_bot.utils.chrome_version_detector.detect_chrome_version_from_binary")
+ @patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging")
+ async def test_validate_chrome_version_logs_remote_detection(
+ self,
+ mock_remote:Mock,
+ mock_binary:Mock,
+ scraper:WebScrapingMixin,
+ caplog:pytest.LogCaptureFixture
+ ) -> None:
+ """When a remote browser responds, the detected version should be logged."""
+ mock_remote.return_value = ChromeVersionInfo("136.0.6778.0", 136, "Chrome")
+ mock_binary.return_value = None
+ scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
+ scraper.browser_config.binary_location = "/path/to/chrome"
+ caplog.set_level("DEBUG")
+
+ with patch.dict(os.environ, {}, clear = True), \
+ patch.object(scraper, "_check_port_with_retry", return_value = True):
+ await scraper._validate_chrome_version_configuration()
+
+ assert "Detected version from existing browser" in caplog.text
+ mock_remote.assert_called_once()
+
@patch("kleinanzeigen_bot.utils.chrome_version_detector.detect_chrome_version_from_binary")
async def test_validate_chrome_version_configuration_no_binary_location(
self, mock_detect:Mock, scraper:WebScrapingMixin
@@ -145,7 +176,9 @@ class TestWebScrapingMixinChromeVersionValidation:
await scraper._validate_chrome_version_configuration()
# Verify detection was called
- mock_detect.assert_called_once_with("/path/to/chrome")
+ assert mock_detect.call_count == 1
+ _, kwargs = mock_detect.call_args
+ assert kwargs["timeout"] == pytest.approx(10.0)
# Verify debug log message (line 824)
assert "Could not detect browser version, skipping validation" in caplog.text
@@ -201,10 +234,13 @@ class TestWebScrapingMixinChromeVersionDiagnostics:
assert "Chrome 136+ detected - security validation required" in caplog.text
# Verify mocks were called
- mock_get_diagnostic.assert_called_once_with(
- binary_path = "/path/to/chrome",
- remote_port = 9222
- )
+ assert mock_get_diagnostic.call_count == 1
+ kwargs = mock_get_diagnostic.call_args.kwargs
+ assert kwargs["binary_path"] == "/path/to/chrome"
+ assert kwargs["remote_port"] == 9222
+ assert kwargs["remote_host"] == "127.0.0.1"
+ assert kwargs["remote_timeout"] > 0
+ assert kwargs["binary_timeout"] > 0
finally:
# Restore environment
if original_env:
@@ -364,10 +400,12 @@ class TestWebScrapingMixinChromeVersionDiagnostics:
assert "Chrome pre-136 detected - no special security requirements" in caplog.text
# Verify that the diagnostic function was called with correct parameters
- mock_get_diagnostic.assert_called_once_with(
- binary_path = "/path/to/chrome",
- remote_port = None
- )
+ assert mock_get_diagnostic.call_count == 1
+ kwargs = mock_get_diagnostic.call_args.kwargs
+ assert kwargs["binary_path"] == "/path/to/chrome"
+ assert kwargs["remote_port"] is None
+ assert kwargs["remote_timeout"] > 0
+ assert kwargs["binary_timeout"] > 0
finally:
# Restore environment
if original_env: