Files
kleinanzeigen-bot/tests/unit/test_web_scraping_mixin.py

2254 lines
113 KiB
Python

# SPDX-FileCopyrightText: © Jens Bergmann and contributors
# SPDX-License-Identifier: AGPL-3.0-or-later
# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/
"""Unit tests for web_scraping_mixin.py focusing on error handling scenarios.
Copyright (c) 2024, kleinanzeigen-bot contributors.
All rights reserved.
"""
import json
import logging
import os
import platform
import shutil
import zipfile
from collections.abc import Awaitable, Callable
from pathlib import Path
from typing import Any, NoReturn, Protocol, cast
from unittest.mock import AsyncMock, MagicMock, Mock, mock_open, patch
import nodriver
import psutil
import pytest
from nodriver.core.element import Element
from nodriver.core.tab import Tab as Page
from kleinanzeigen_bot.model.config_model import Config
from kleinanzeigen_bot.utils import files, loggers
from kleinanzeigen_bot.utils.web_scraping_mixin import By, Is, WebScrapingMixin, _is_admin # noqa: PLC2701
class ConfigProtocol(Protocol):
"""Protocol for Config objects used in tests."""
extensions:list[str]
browser_args:list[str]
user_data_dir:str | None
def add_extension(self, ext:str) -> None:
pass
def _nodriver_start_mock() -> Mock:
"""Return the nodriver.start mock with proper typing."""
return cast(Mock, cast(Any, nodriver).start)
class TrulyAwaitableMockPage:
"""A helper to make a mock Page object truly awaitable for tests."""
def __init__(self) -> None:
self._mock = AsyncMock(spec = Page)
self.url = "https://example.com"
self.query_selector = AsyncMock()
self.evaluate = AsyncMock()
def __getattr__(self, item:str) -> object:
return getattr(self._mock, item)
def __await__(self) -> object:
async def _noop() -> "TrulyAwaitableMockPage":
return self
return _noop().__await__()
# Allow setting attributes on the mock
def __setattr__(self, key:str, value:object) -> None:
if key in {"_mock", "url", "query_selector", "evaluate"}:
object.__setattr__(self, key, value)
else:
setattr(self._mock, key, value)
@pytest.fixture
def mock_page() -> TrulyAwaitableMockPage:
"""Create a truly awaitable mock Page object."""
page = TrulyAwaitableMockPage()
return page
@pytest.fixture
def mock_browser() -> AsyncMock:
"""Create a mock Browser object."""
browser = AsyncMock()
browser.websocket_url = "ws://localhost:9222"
return browser
@pytest.fixture
def web_scraper(mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> WebScrapingMixin:
"""Create a WebScrapingMixin instance with mocked browser and page."""
scraper = WebScrapingMixin()
scraper.browser = mock_browser
scraper.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue]
scraper.config = Config.model_validate({"login": {"username": "user@example.com", "password": "secret"}}) # noqa: S105
return scraper
def test_write_initial_prefs(tmp_path:Path) -> None:
"""Test _write_initial_prefs helper function."""
from kleinanzeigen_bot.utils.web_scraping_mixin import _write_initial_prefs # noqa: PLC0415, PLC2701
prefs_file = tmp_path / "Preferences"
_write_initial_prefs(str(prefs_file))
# Verify file was created
assert prefs_file.exists()
# Verify content is valid JSON with expected structure
with open(prefs_file, encoding = "UTF-8") as f:
prefs = json.load(f)
assert prefs["credentials_enable_service"] is False
assert prefs["enable_do_not_track"] is True
assert prefs["google"]["services"]["consented_to_sync"] is False
assert prefs["profile"]["password_manager_enabled"] is False
assert prefs["profile"]["default_content_setting_values"]["notifications"] == 2
assert prefs["signin"]["allowed"] is False
assert "www.kleinanzeigen.de" in prefs["translate_site_blacklist"]
assert prefs["devtools"]["preferences"]["currentDockState"] == '"bottom"'
class TestWebScrapingErrorHandling:
"""Test error handling scenarios in WebScrapingMixin."""
@pytest.mark.asyncio
async def test_web_find_timeout(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test timeout handling in web_find."""
# Mock page.query_selector to return None, simulating element not found
mock_page.query_selector.return_value = None
# Test timeout for ID selector
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
await web_scraper.web_find(By.ID, "test-id", timeout = 0.1)
# Test timeout for class selector
with pytest.raises(TimeoutError, match = "No HTML element found with CSS class 'test-class'"):
await web_scraper.web_find(By.CLASS_NAME, "test-class", timeout = 0.1)
@pytest.mark.asyncio
async def test_web_find_network_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test network error handling in web_find."""
# Mock page.query_selector to raise a network error
mock_page.query_selector.side_effect = Exception("Network error")
# Test network error for ID selector
with pytest.raises(Exception, match = "Network error"):
await web_scraper.web_find(By.ID, "test-id", timeout = 0.1)
@pytest.mark.asyncio
async def test_web_click_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test element not found error in web_click."""
# Mock page.query_selector to return None
mock_page.query_selector.return_value = None
# Test element not found error
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
await web_scraper.web_click(By.ID, "test-id", timeout = 0.1)
@pytest.mark.asyncio
async def test_web_click_element_not_clickable(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test element not clickable error in web_click."""
# Create a mock element that raises an error on click
mock_element = AsyncMock(spec = Element)
mock_element.click.side_effect = Exception("Element not clickable")
mock_page.query_selector.return_value = mock_element
# Test element not clickable error
with pytest.raises(Exception, match = "Element not clickable"):
await web_scraper.web_click(By.ID, "test-id")
@pytest.mark.asyncio
async def test_web_input_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test element not found error in web_input."""
# Mock page.query_selector to return None
mock_page.query_selector.return_value = None
# Test element not found error
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
await web_scraper.web_input(By.ID, "test-id", "test text", timeout = 0.1)
@pytest.mark.asyncio
async def test_web_input_clear_failure(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test input clear failure in web_input."""
# Create a mock element that raises an error on clear_input
mock_element = AsyncMock(spec = Element)
mock_element.clear_input.side_effect = Exception("Cannot clear input")
mock_page.query_selector.return_value = mock_element
# Test input clear failure
with pytest.raises(Exception, match = "Cannot clear input"):
await web_scraper.web_input(By.ID, "test-id", "test text")
@pytest.mark.asyncio
async def test_web_select_combobox_missing_dropdown_options(self, web_scraper:WebScrapingMixin) -> None:
"""Test combobox selection when aria-controls attribute is missing."""
input_field = AsyncMock(spec = Element)
input_field.attrs = {}
input_field.clear_input = AsyncMock()
input_field.send_keys = AsyncMock()
web_scraper.web_find = AsyncMock(return_value = input_field) # type: ignore[method-assign]
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
with pytest.raises(TimeoutError, match = "Combobox missing aria-controls attribute"):
await web_scraper.web_select_combobox(By.ID, "combo-id", "Option", timeout = 0.1)
input_field.clear_input.assert_awaited_once()
input_field.send_keys.assert_awaited_once_with("Option")
assert web_scraper.web_sleep.await_count == 1 # Only one sleep before checking aria-controls
@pytest.mark.asyncio
async def test_web_select_combobox_selects_matching_option(self, web_scraper:WebScrapingMixin) -> None:
"""Test combobox selection matches a visible <li> option."""
input_field = AsyncMock(spec = Element)
input_field.attrs = {"aria-controls": "dropdown-id"}
input_field.clear_input = AsyncMock()
input_field.send_keys = AsyncMock()
dropdown_elem = AsyncMock(spec = Element)
dropdown_elem.apply = AsyncMock(return_value = True)
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
result = await web_scraper.web_select_combobox(By.ID, "combo-id", "Visible Label")
assert result is dropdown_elem
input_field.clear_input.assert_awaited_once()
input_field.send_keys.assert_awaited_once_with("Visible Label")
dropdown_elem.apply.assert_awaited_once()
assert web_scraper.web_sleep.await_count == 2
@pytest.mark.asyncio
async def test_web_select_combobox_no_matching_option_raises(self, web_scraper:WebScrapingMixin) -> None:
"""Test combobox selection raises when no <li> matches the entered text."""
input_field = AsyncMock(spec = Element)
input_field.attrs = {"aria-controls": "dropdown-id"}
input_field.clear_input = AsyncMock()
input_field.send_keys = AsyncMock()
dropdown_elem = AsyncMock(spec = Element)
dropdown_elem.apply = AsyncMock(return_value = False)
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
with pytest.raises(TimeoutError, match = "No matching option found in combobox"):
await web_scraper.web_select_combobox(By.ID, "combo-id", "Missing Label")
dropdown_elem.apply.assert_awaited_once()
assert web_scraper.web_sleep.await_count == 1 # One sleep after typing, error before second sleep
@pytest.mark.asyncio
async def test_web_select_combobox_special_characters(self, web_scraper:WebScrapingMixin) -> None:
"""Test combobox selection with special characters (quotes, newlines, etc)."""
input_field = AsyncMock(spec = Element)
input_field.attrs = {"aria-controls": "dropdown-id"}
input_field.clear_input = AsyncMock()
input_field.send_keys = AsyncMock()
dropdown_elem = AsyncMock(spec = Element)
dropdown_elem.apply = AsyncMock(return_value = True)
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
# Test with quotes, backslashes, and newlines
special_value = 'Value with "quotes" and \\ backslash'
result = await web_scraper.web_select_combobox(By.ID, "combo-id", special_value)
assert result is dropdown_elem
input_field.send_keys.assert_awaited_once_with(special_value)
# Verify that the JavaScript received properly escaped value
call_args = dropdown_elem.apply.call_args[0][0]
assert '"quotes"' in call_args or r'\"quotes\"' in call_args # JSON escaping should handle quotes
@pytest.mark.asyncio
async def test_web_select_by_value(self, web_scraper:WebScrapingMixin) -> None:
"""Test web_select successfully matches by option value."""
select_elem = AsyncMock(spec = Element)
select_elem.apply = AsyncMock()
web_scraper.web_check = AsyncMock(return_value = True) # type: ignore[method-assign]
web_scraper.web_await = AsyncMock(return_value = True) # type: ignore[method-assign]
web_scraper.web_find = AsyncMock(return_value = select_elem) # type: ignore[method-assign]
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
result = await web_scraper.web_select(By.ID, "select-id", "option-value")
assert result is select_elem
select_elem.apply.assert_awaited_once()
web_scraper.web_sleep.assert_awaited_once()
@pytest.mark.asyncio
async def test_web_select_raises_on_missing_option(self, web_scraper:WebScrapingMixin) -> None:
"""Test web_select raises TimeoutError when option not found."""
select_elem = AsyncMock(spec = Element)
# Simulate JS throwing an error when option not found
select_elem.apply = AsyncMock(side_effect = Exception("Option not found by value or displayed text: missing"))
web_scraper.web_check = AsyncMock(return_value = True) # type: ignore[method-assign]
web_scraper.web_await = AsyncMock(return_value = True) # type: ignore[method-assign]
web_scraper.web_find = AsyncMock(return_value = select_elem) # type: ignore[method-assign]
with pytest.raises(TimeoutError, match = "Option not found by value or displayed text"):
await web_scraper.web_select(By.ID, "select-id", "missing-option")
async def test_web_input_success_returns_element(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Successful web_input should send keys, wait, and return the element."""
mock_element = AsyncMock(spec = Element)
mock_page.query_selector.return_value = mock_element
mock_sleep = AsyncMock()
cast(Any, web_scraper).web_sleep = mock_sleep
result = await web_scraper.web_input(By.ID, "username", "hello world", timeout = 1)
assert result is mock_element
mock_element.clear_input.assert_awaited_once()
mock_element.send_keys.assert_awaited_once_with("hello world")
mock_sleep.assert_awaited_once()
@pytest.mark.asyncio
async def test_web_open_timeout(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
"""Test page load timeout in web_open."""
# Mock browser.get to return a page that never loads
mock_page = TrulyAwaitableMockPage()
mock_browser.get.return_value = mock_page
# Mock web_execute to never return True for document.readyState
setattr(web_scraper, "web_execute", AsyncMock(return_value = False))
# Ensure page is None so the timeout path is exercised
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
# Test page load timeout
with pytest.raises(TimeoutError, match = "Page did not finish loading within"):
await web_scraper.web_open("https://example.com", timeout = 0.1)
@pytest.mark.asyncio
async def test_web_open_skip_when_url_already_loaded(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> None:
"""web_open should short-circuit when the requested URL is already active."""
mock_browser.get.reset_mock()
mock_page.url = "https://example.com"
mock_execute = AsyncMock()
cast(Any, web_scraper).web_execute = mock_execute
await web_scraper.web_open("https://example.com", reload_if_already_open = False)
mock_browser.get.assert_not_awaited()
mock_execute.assert_not_called()
@pytest.mark.asyncio
async def test_web_request_invalid_response(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test invalid response handling in web_request."""
# Mock page.evaluate to return an invalid response
mock_page.evaluate.return_value = {"statusCode": 404, "statusMessage": "Not Found", "headers": {}, "content": "Page not found"}
# Test invalid response error
with pytest.raises(AssertionError, match = "Invalid response"):
await web_scraper.web_request("https://example.com")
@pytest.mark.asyncio
async def test_web_request_network_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test network error handling in web_request."""
# Mock page.evaluate to raise a network error
mock_page.evaluate.side_effect = Exception("Network error")
# Test network error
with pytest.raises(Exception, match = "Network error"):
await web_scraper.web_request("https://example.com")
@pytest.mark.asyncio
async def test_web_check_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test element not found error in web_check."""
# Mock page.query_selector to return None
mock_page.query_selector.return_value = None
# Test element not found error
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
await web_scraper.web_check(By.ID, "test-id", Is.CLICKABLE, timeout = 0.1)
@pytest.mark.asyncio
async def test_web_check_attribute_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test attribute error in web_check."""
# Create a mock element that raises an error on attribute check
mock_element = AsyncMock(spec = Element)
mock_element.attrs = {}
mock_element.apply.side_effect = Exception("Attribute error")
mock_page.query_selector.return_value = mock_element
# Test attribute error
with pytest.raises(Exception, match = "Attribute error"):
await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED)
@pytest.mark.asyncio
async def test_web_find_applies_timeout_multiplier_and_backoff(self, web_scraper:WebScrapingMixin) -> None:
"""Ensure multiplier/backoff logic is honored when timeouts occur."""
assert web_scraper.config is not None
web_scraper.config.timeouts.multiplier = 2.0
web_scraper.config.timeouts.retry_enabled = True
web_scraper.config.timeouts.retry_max_attempts = 2
web_scraper.config.timeouts.retry_backoff_factor = 2.0
recorded:list[tuple[float, bool]] = []
async def fake_web_await(condition:Callable[[], object], *, timeout:float, timeout_error_message:str = "",
apply_multiplier:bool = True) -> Element:
recorded.append((timeout, apply_multiplier))
raise TimeoutError(timeout_error_message or "timeout")
cast(Any, web_scraper).web_await = fake_web_await
with pytest.raises(TimeoutError):
await web_scraper.web_find(By.ID, "test-id", timeout = 0.5)
assert recorded == [(1.0, False), (2.0, False), (4.0, False)]
class TestTimeoutAndRetryHelpers:
"""Test timeout helper utilities in WebScrapingMixin."""
def test_get_timeout_config_prefers_config_timeouts(self, web_scraper:WebScrapingMixin) -> None:
"""_get_timeout_config should return the config-provided timeout model when available."""
custom_config = Config.model_validate({
"login": {"username": "user@example.com", "password": "secret"}, # noqa: S105
"timeouts": {"default": 7.5}
})
web_scraper.config = custom_config
assert web_scraper._get_timeout_config() is custom_config.timeouts
def test_timeout_attempts_respects_retry_switch(self, web_scraper:WebScrapingMixin) -> None:
"""_timeout_attempts should collapse to a single attempt when retries are disabled."""
web_scraper.config.timeouts.retry_enabled = False
assert web_scraper._timeout_attempts() == 1
web_scraper.config.timeouts.retry_enabled = True
web_scraper.config.timeouts.retry_max_attempts = 3
assert web_scraper._timeout_attempts() == 4
@pytest.mark.asyncio
async def test_run_with_timeout_retries_retries_operation(self, web_scraper:WebScrapingMixin) -> None:
"""_run_with_timeout_retries should retry when TimeoutError is raised before succeeding."""
attempts:list[float] = []
async def flaky_operation(timeout:float) -> str:
attempts.append(timeout)
if len(attempts) == 1:
raise TimeoutError("first attempt")
return "done"
web_scraper.config.timeouts.retry_max_attempts = 1
result = await web_scraper._run_with_timeout_retries(flaky_operation, description = "retry-op")
assert result == "done"
assert len(attempts) == 2
@pytest.mark.asyncio
async def test_run_with_timeout_retries_guard_clause(self, web_scraper:WebScrapingMixin) -> None:
"""_run_with_timeout_retries should guard against zero-attempt edge cases."""
async def never_called(timeout:float) -> None:
pytest.fail("operation should not run when attempts are zero")
with patch.object(web_scraper, "_timeout_attempts", return_value = 0), \
pytest.raises(TimeoutError, match = "guarded-op failed without executing operation"):
await web_scraper._run_with_timeout_retries(never_called, description = "guarded-op")
class TestSelectorTimeoutMessages:
"""Ensure selector helpers provide informative timeout messages."""
@pytest.mark.asyncio
@pytest.mark.parametrize(
("selector_type", "selector_value", "expected_message"),
[
(By.TAG_NAME, "section", "No HTML element found of tag <section> within 2.0 seconds."),
(By.CSS_SELECTOR, ".hero", "No HTML element found using CSS selector '.hero' within 2.0 seconds."),
(By.TEXT, "Submit", "No HTML element found containing text 'Submit' within 2.0 seconds."),
(By.XPATH, "//div[@class='hero']", "No HTML element found using XPath '//div[@class='hero']' within 2.0 seconds."),
]
)
async def test_web_find_timeout_suffixes(
self,
web_scraper:WebScrapingMixin,
selector_type:By,
selector_value:str,
expected_message:str
) -> None:
"""web_find should pass descriptive timeout messages for every selector strategy."""
mock_element = AsyncMock(spec = Element)
mock_wait = AsyncMock(return_value = mock_element)
cast(Any, web_scraper).web_await = mock_wait
result = await web_scraper.web_find(selector_type, selector_value, timeout = 2)
assert result is mock_element
call = mock_wait.await_args_list[0]
assert expected_message == call.kwargs["timeout_error_message"]
assert call.kwargs["apply_multiplier"] is False
@pytest.mark.asyncio
@pytest.mark.parametrize(
("selector_type", "selector_value", "expected_message"),
[
(By.CLASS_NAME, "hero", "No HTML elements found with CSS class 'hero' within 1 seconds."),
(By.CSS_SELECTOR, ".card", "No HTML elements found using CSS selector '.card' within 1 seconds."),
(By.TAG_NAME, "article", "No HTML elements found of tag <article> within 1 seconds."),
(By.TEXT, "Listings", "No HTML elements found containing text 'Listings' within 1 seconds."),
(By.XPATH, "//footer", "No HTML elements found using XPath '//footer' within 1 seconds."),
]
)
async def test_web_find_all_once_timeout_suffixes(
self,
web_scraper:WebScrapingMixin,
selector_type:By,
selector_value:str,
expected_message:str
) -> None:
"""_web_find_all_once should surface informative timeout errors for each selector."""
elements = [AsyncMock(spec = Element)]
mock_wait = AsyncMock(return_value = elements)
cast(Any, web_scraper).web_await = mock_wait
result = await web_scraper._web_find_all_once(selector_type, selector_value, 1)
assert result is elements
call = mock_wait.await_args_list[0]
assert expected_message == call.kwargs["timeout_error_message"]
assert call.kwargs["apply_multiplier"] is False
@pytest.mark.asyncio
async def test_web_find_all_delegates_to_retry_helper(self, web_scraper:WebScrapingMixin) -> None:
"""web_find_all should execute via the timeout retry helper."""
elements = [AsyncMock(spec = Element)]
async def fake_retry(operation:Callable[[float], Awaitable[list[Element]]], **kwargs:Any) -> list[Element]:
assert kwargs["description"] == "web_find_all(CLASS_NAME, hero)"
assert kwargs["override"] == 1.5
result = await operation(0.42)
return result
retry_mock = AsyncMock(side_effect = fake_retry)
once_mock = AsyncMock(return_value = elements)
cast(Any, web_scraper)._run_with_timeout_retries = retry_mock
cast(Any, web_scraper)._web_find_all_once = once_mock
result = await web_scraper.web_find_all(By.CLASS_NAME, "hero", timeout = 1.5)
assert result is elements
retry_call = retry_mock.await_args_list[0]
assert retry_call.kwargs["key"] == "default"
assert retry_call.kwargs["override"] == 1.5
once_call = once_mock.await_args_list[0]
assert once_call.args[:2] == (By.CLASS_NAME, "hero")
assert once_call.args[2] == 0.42
@pytest.mark.asyncio
async def test_web_check_unsupported_attribute(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""web_check should raise for unsupported attribute queries."""
mock_element = AsyncMock(spec = Element)
mock_element.attrs = {}
mock_page.query_selector.return_value = mock_element
with pytest.raises(AssertionError, match = "Unsupported attribute"):
await web_scraper.web_check(By.ID, "test-id", cast(Is, object()), timeout = 0.1)
class TestWebScrapingSessionManagement:
"""Test session management edge cases in WebScrapingMixin."""
def test_close_browser_session_cleans_up_resources(self) -> None:
"""Ensure browser and page references are cleared and child processes are killed."""
scraper = WebScrapingMixin()
scraper.browser = MagicMock()
scraper.browser._process_pid = 42
stop_mock = scraper.browser.stop = MagicMock()
scraper.page = MagicMock(spec = Page)
with patch("psutil.Process") as mock_proc:
mock_child = MagicMock()
mock_child.is_running.return_value = True
mock_proc.return_value.children.return_value = [mock_child]
scraper.close_browser_session()
mock_proc.assert_called_once_with(42)
stop_mock.assert_called_once()
mock_child.kill.assert_called_once()
assert scraper.browser is None
assert scraper.page is None
def test_close_browser_session_idempotent(self) -> None:
"""Repeated calls should leave the state clean without re-running cleanup logic."""
scraper = WebScrapingMixin()
scraper.browser = MagicMock()
scraper.browser._process_pid = 99
stop_mock = scraper.browser.stop = MagicMock()
scraper.page = MagicMock(spec = Page)
with patch("psutil.Process") as mock_proc:
mock_proc.return_value.children.return_value = []
scraper.close_browser_session()
scraper.close_browser_session()
mock_proc.assert_called_once()
stop_mock.assert_called_once()
def test_close_browser_session_without_browser_skips_inspection(self) -> None:
"""When no browser exists, no process inspection should run and the page should stay untouched."""
scraper = WebScrapingMixin()
scraper.browser = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
preserved_page = MagicMock(spec = Page)
scraper.page = preserved_page
with patch("psutil.Process") as mock_proc:
scraper.close_browser_session()
mock_proc.assert_not_called()
assert scraper.page is preserved_page
def test_close_browser_session_handles_missing_children(self) -> None:
"""Child-less browsers should still stop cleanly without raising."""
scraper = WebScrapingMixin()
scraper.browser = MagicMock()
scraper.browser._process_pid = 123
stop_mock = scraper.browser.stop = MagicMock()
scraper.page = MagicMock(spec = Page)
with patch("psutil.Process") as mock_proc:
mock_proc.return_value.children.return_value = []
scraper.close_browser_session()
mock_proc.assert_called_once()
stop_mock.assert_called_once()
def test_get_compatible_browser_raises_on_unknown_os(self) -> None:
"""Test get_compatible_browser raises AssertionError on unknown OS."""
scraper = WebScrapingMixin()
with patch("platform.system", return_value = "UnknownOS"), pytest.raises(AssertionError):
scraper.get_compatible_browser()
def test_get_compatible_browser_raises_if_no_browser_found(self) -> None:
"""Test get_compatible_browser raises AssertionError if no browser is found."""
scraper = WebScrapingMixin()
with (
patch("platform.system", return_value = "Linux"),
patch("os.path.isfile", return_value = False),
patch("shutil.which", return_value = None),
pytest.raises(AssertionError),
):
scraper.get_compatible_browser()
class TestWebScrolling:
"""Test scrolling helpers."""
@pytest.mark.asyncio
async def test_web_scroll_page_down_scrolls_and_returns(self, web_scraper:WebScrapingMixin) -> None:
"""web_scroll_page_down should scroll both directions when requested."""
scripts:list[str] = []
async def exec_side_effect(script:str) -> int | None:
scripts.append(script)
if script == "document.body.scrollHeight":
return 20
return None
cast(Any, web_scraper).web_execute = AsyncMock(side_effect = exec_side_effect)
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.asyncio.sleep", new_callable = AsyncMock) as mock_sleep:
await web_scraper.web_scroll_page_down(scroll_length = 10, scroll_speed = 10, scroll_back_top = True)
assert scripts[0] == "document.body.scrollHeight"
# Expect four scrollTo operations: two down, two up
assert scripts.count("document.body.scrollHeight") == 1
scroll_calls = [script for script in scripts if script.startswith("window.scrollTo")]
assert scroll_calls == [
"window.scrollTo(0, 10)",
"window.scrollTo(0, 20)",
"window.scrollTo(0, 10)",
"window.scrollTo(0, 0)"
]
sleep_durations = [call.args[0] for call in mock_sleep.await_args_list]
assert sleep_durations == [1.0, 1.0, 0.5, 0.5]
@pytest.mark.asyncio
async def test_session_expiration_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
"""Test handling of expired browser sessions."""
mock_browser.get.side_effect = Exception("Session expired")
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
with pytest.raises(Exception, match = "Session expired"):
await web_scraper.web_open("https://example.com")
# Do not assert browser/page are None, as production code does not clear them
@pytest.mark.asyncio
async def test_multiple_session_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
"""Test handling of multiple browser sessions."""
mock_page1 = TrulyAwaitableMockPage()
mock_browser.get.return_value = mock_page1
mock_browser._process_pid = 12345
# Patch stop as MagicMock to avoid RuntimeWarning
mock_browser.stop = MagicMock()
await web_scraper.web_open("https://example1.com")
assert web_scraper.page == mock_page1
# Patch psutil.Process to avoid NoSuchProcess error
with patch("psutil.Process") as mock_proc:
mock_child = MagicMock()
mock_child.is_running.return_value = True
mock_proc.return_value.children.return_value = [mock_child]
web_scraper.close_browser_session()
assert web_scraper.browser is None
assert web_scraper.page is None
# Re-assign browser for new session
web_scraper.browser = mock_browser
mock_page2 = TrulyAwaitableMockPage()
mock_browser.get.return_value = mock_page2
mock_browser._process_pid = 12346
await web_scraper.web_open("https://example2.com")
assert web_scraper.page == mock_page2
@pytest.mark.asyncio
async def test_browser_crash_recovery(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
"""Test recovery from browser crash."""
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
web_scraper.browser = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
# Reassign the mock browser before setting up the side effect
web_scraper.browser = mock_browser
mock_browser.get.side_effect = Exception("Browser crashed")
with pytest.raises(Exception, match = "Browser crashed"):
await web_scraper.web_open("https://example.com")
# Do not assert browser/page are None, as production code does not clear them
mock_page = TrulyAwaitableMockPage()
mock_browser.get.side_effect = None
mock_browser.get.return_value = mock_page
await web_scraper.web_open("https://example.com")
assert web_scraper.page == mock_page
@pytest.mark.asyncio
async def test_web_await_custom_condition_success(self, web_scraper:WebScrapingMixin) -> None:
"""Test web_await returns when custom condition is met."""
call_count = {"count": 0}
async def condition() -> bool:
call_count["count"] += 1
return call_count["count"] >= 3
result:bool = await web_scraper.web_await(condition, timeout = 1)
assert result is True
assert call_count["count"] >= 3
@pytest.mark.asyncio
async def test_web_await_custom_condition_timeout(self, web_scraper:WebScrapingMixin) -> None:
"""Test web_await raises TimeoutError if condition is never met."""
async def condition() -> bool:
return False
with pytest.raises(TimeoutError):
await web_scraper.web_await(condition, timeout = 0.05)
@pytest.mark.asyncio
async def test_web_find_retry_mechanism(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test web_find retries until element is found within timeout."""
call_count = {"count": 0}
async def query_selector(*args:object, **kwargs:object) -> AsyncMock | None:
call_count["count"] += 1
if call_count["count"] == 3:
return AsyncMock(spec = Element)
return None
mock_page.query_selector.side_effect = query_selector
result = await web_scraper.web_find(By.ID, "test-id", timeout = 0.2)
assert result is not None
assert call_count["count"] >= 3
@pytest.mark.asyncio
async def test_web_find_element_state_change(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test web_check detects element state change (e.g., becomes visible)."""
call_count = {"count": 0}
async def query_selector(*args:object, **kwargs:object) -> AsyncMock | None:
call_count["count"] += 1
if call_count["count"] == 2:
element = AsyncMock(spec = Element)
element.attrs = {}
async def apply_fn(*a:object, **kw:object) -> bool:
return True
element.apply = AsyncMock(side_effect = apply_fn)
return element
return None
mock_page.query_selector.side_effect = query_selector
result = await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED, timeout = 1.0)
assert result is True
assert call_count["count"] >= 2
@pytest.mark.asyncio
async def test_web_find_timeout_configuration(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
"""Test web_find respects timeout configuration and raises TimeoutError."""
mock_page.query_selector.return_value = None
with pytest.raises(TimeoutError):
await web_scraper.web_find(By.ID, "test-id", timeout = 0.05)
class TestWebScrapingBrowserConfiguration:
"""Test browser configuration in WebScrapingMixin."""
@pytest.mark.asyncio
async def test_browser_binary_location_detection(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test browser binary location detection on different platforms."""
scraper = WebScrapingMixin()
# Test Linux
monkeypatch.setattr(platform, "system", lambda: "Linux")
monkeypatch.setattr(shutil, "which", lambda x: "/usr/bin/chrome" if x == "google-chrome" else None)
monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chrome")
assert scraper.get_compatible_browser() == "/usr/bin/chrome"
# Test macOS
monkeypatch.setattr(platform, "system", lambda: "Darwin")
mac_path = "/Applications/Google Chrome.app/Contents/MacOS/Google Chrome"
monkeypatch.setattr(os.path, "isfile", lambda p: p == mac_path)
assert scraper.get_compatible_browser() == mac_path
# Test Windows
monkeypatch.setattr(platform, "system", lambda: "Windows")
win_path = "C:\\Program Files\\Chrome\\Application\\chrome.exe"
# Mock os.environ to include PROGRAMFILES and PROGRAMFILES(X86) and LOCALAPPDATA
monkeypatch.setenv("PROGRAMFILES", "C:\\Program Files")
monkeypatch.setenv("PROGRAMFILES(X86)", "C:\\Program Files (x86)")
monkeypatch.setenv("LOCALAPPDATA", "C:\\Users\\TestUser\\AppData\\Local")
monkeypatch.setattr(os.path, "isfile", lambda p: p == win_path)
assert scraper.get_compatible_browser() == win_path
@pytest.mark.asyncio
async def test_browser_profile_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test browser profile configuration and preferences handling."""
class DummyConfig:
def __init__(self, **kwargs:object) -> None:
self.browser_args:list[str] = []
self.user_data_dir:str | None = None
self.extensions:list[str] = []
self.browser_executable_path:str | None = None
self.host:str | None = None
self.port:int | None = None
self.headless:bool = False
self._extensions:list[str] = [] # Add private extensions list
def add_extension(self, ext:str) -> None:
self._extensions.append(ext) # Use private extensions list
# Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
# Mock Config class
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
# Mock os.path.exists to return True for the browser binary and use real exists for Preferences file (and Edge)
edge_path = "/Applications/Microsoft Edge.app/Contents/MacOS/Microsoft Edge"
chrome_path = "/Applications/Google Chrome.app/Contents/MacOS/Google Chrome"
real_exists = os.path.exists
def mock_exists_sync(path:str) -> bool:
# Handle all browser paths
if path in {
# Linux paths
"/usr/bin/chromium",
"/usr/bin/chromium-browser",
"/usr/bin/google-chrome",
"/usr/bin/microsoft-edge",
"/usr/bin/chrome",
# macOS paths
edge_path,
chrome_path,
# Windows paths
"C:\\Program Files\\Microsoft\\Edge\\Application\\msedge.exe",
"C:\\Program Files (x86)\\Microsoft\\Edge\\Application\\msedge.exe",
"C:\\Program Files\\Chromium\\Application\\chrome.exe",
"C:\\Program Files (x86)\\Chromium\\Application\\chrome.exe",
"C:\\Users\\runneradmin\\AppData\\Local\\Chromium\\Application\\chrome.exe",
"C:\\Program Files\\Chrome\\Application\\chrome.exe",
"C:\\Program Files (x86)\\Chrome\\Application\\chrome.exe",
"C:\\Users\\runneradmin\\AppData\\Local\\Chrome\\Application\\chrome.exe"
}:
return True
if "Preferences" in str(path) and str(tmp_path) in str(path):
return real_exists(path)
return False
async def mock_exists_async(path:str | Path) -> bool:
return mock_exists_sync(str(path))
monkeypatch.setattr(os.path, "exists", mock_exists_sync)
monkeypatch.setattr(files, "exists", mock_exists_async)
# Create test profile directory
profile_dir = tmp_path / "Default"
profile_dir.mkdir()
prefs_file = profile_dir / "Preferences"
# Test with existing preferences file
prefs_file.write_text(json.dumps({"existing": "prefs"}), encoding = "UTF-8")
scraper = WebScrapingMixin()
scraper.browser_config.user_data_dir = str(tmp_path)
scraper.browser_config.profile_name = "Default"
await scraper.create_browser_session()
# Verify preferences file was not overwritten
prefs = json.loads(prefs_file.read_text(encoding = "UTF-8"))
assert prefs["existing"] == "prefs"
# Test with missing preferences file
prefs_file.unlink()
await scraper.create_browser_session()
# Verify new preferences file was created with correct settings
prefs = json.loads(prefs_file.read_text(encoding = "UTF-8"))
assert prefs["credentials_enable_service"] is False
assert prefs["enable_do_not_track"] is True
assert prefs["profile"]["password_manager_enabled"] is False
assert prefs["signin"]["allowed"] is False
assert "www.kleinanzeigen.de" in prefs["translate_site_blacklist"]
@pytest.mark.asyncio
async def test_browser_arguments_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test browser arguments configuration."""
class DummyConfig:
def __init__(self, **kwargs:object) -> None:
self.browser_args:list[str] = []
self.user_data_dir:str | None = None
self.extensions:list[str] = []
self.browser_executable_path:str | None = None
self.host:str | None = None
self.port:int | None = None
self.headless:bool = False
def add_extension(self, ext:str) -> None:
self.extensions.append(ext)
# Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
# Mock Config class
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
# Mock os.path.exists to return True for both Chrome and Edge paths
monkeypatch.setattr(os.path, "exists", lambda p: p in {"/usr/bin/chrome", "/usr/bin/edge"})
async def mock_exists_async(path:str | Path) -> bool:
return str(path) in {"/usr/bin/chrome", "/usr/bin/edge"}
monkeypatch.setattr(files, "exists", mock_exists_async)
# Test with custom arguments
scraper = WebScrapingMixin()
scraper.browser_config.arguments = ["--custom-arg=value", "--another-arg"]
scraper.browser_config.use_private_window = True
scraper.browser_config.binary_location = "/usr/bin/chrome"
await scraper.create_browser_session()
# Verify browser arguments
config = _nodriver_start_mock().call_args[0][0]
assert "--custom-arg=value" in config.browser_args
assert "--another-arg" in config.browser_args
assert "--incognito" in config.browser_args
assert "--disable-crash-reporter" in config.browser_args
assert "--disable-domain-reliability" in config.browser_args
# Test with Edge browser
scraper = WebScrapingMixin()
scraper.browser_config.binary_location = "/usr/bin/edge"
await scraper.create_browser_session()
# Verify Edge-specific arguments
config = _nodriver_start_mock().call_args[0][0]
assert "-inprivate" in config.browser_args
assert os.environ.get("MSEDGEDRIVER_TELEMETRY_OPTOUT") == "1"
@pytest.mark.asyncio
async def test_browser_extension_loading(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test browser extension loading."""
class DummyConfig:
def __init__(self, **kwargs:object) -> None:
self.browser_args:list[str] = []
self.user_data_dir:str | None = None
self.extensions:list[str] = []
self.browser_executable_path:str | None = None
self.host:str | None = None
self.port:int | None = None
self.headless:bool = False
self._extensions:list[str] = [] # Add private extensions list
def add_extension(self, ext:str) -> None:
self._extensions.append(ext) # Use private extensions list
# Create test extension files
ext1 = tmp_path / "ext1.crx"
ext2 = tmp_path / "ext2.crx"
# Create proper CRX files (which are ZIP files)
with zipfile.ZipFile(ext1, "w") as z:
z.writestr("manifest.json", '{"name": "Test Extension 1"}')
with zipfile.ZipFile(ext2, "w") as z:
z.writestr("manifest.json", '{"name": "Test Extension 2"}')
# Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
# Mock Config class
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
# Mock files.exists and files.is_dir to return appropriate values
async def mock_exists(path:str | Path) -> bool:
path_str = str(path)
# Resolve real paths to handle symlinks (e.g., /var -> /private/var on macOS)
real_path = str(Path(path_str).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
real_ext1 = str(Path(ext1).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
real_ext2 = str(Path(ext2).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
return path_str in {"/usr/bin/chrome", "/usr/bin/edge"} or real_path in {real_ext1, real_ext2} or os.path.exists(path_str) # noqa: ASYNC240
async def mock_is_dir(path:str | Path) -> bool:
path_str = str(path)
# Resolve real paths to handle symlinks
real_path = str(Path(path_str).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
real_ext1 = str(Path(ext1).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
real_ext2 = str(Path(ext2).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
# Nodriver extracts CRX files to temp directories, so they appear as directories
if real_path in {real_ext1, real_ext2}:
return True
return Path(path_str).is_dir() # noqa: ASYNC240 Test mock, runs synchronously
monkeypatch.setattr(files, "exists", mock_exists)
monkeypatch.setattr(files, "is_dir", mock_is_dir)
# Test extension loading
scraper = WebScrapingMixin()
scraper.browser_config.extensions = [str(ext1), str(ext2)]
scraper.browser_config.binary_location = "/usr/bin/chrome"
await scraper.create_browser_session()
# Verify extensions were loaded
config = _nodriver_start_mock().call_args[0][0]
assert len(config._extensions) == 2
for ext_path in config._extensions:
assert await files.exists(ext_path)
assert await files.is_dir(ext_path)
# Test with non-existent extension
scraper.browser_config.extensions = ["non_existent.crx"]
with pytest.raises(AssertionError):
await scraper.create_browser_session()
@pytest.mark.asyncio
async def test_browser_binary_location_detection_edge_cases(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test browser binary location detection edge cases."""
scraper = WebScrapingMixin()
# Test Linux with multiple browser options
def which_mock(x:str) -> str | None:
return {
"chromium": "/usr/bin/chromium",
"chromium-browser": None,
"google-chrome": None,
"microsoft-edge": None
}.get(x)
monkeypatch.setattr(platform, "system", lambda: "Linux")
monkeypatch.setattr(shutil, "which", which_mock)
monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chromium")
assert scraper.get_compatible_browser() == "/usr/bin/chromium"
# Test Linux with no browsers found
monkeypatch.setattr(shutil, "which", lambda x: None)
monkeypatch.setattr(os.path, "isfile", lambda p: False)
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
scraper.get_compatible_browser()
# Test Windows with environment variables not set
monkeypatch.setattr(platform, "system", lambda: "Windows")
# Set default values for environment variables
monkeypatch.setenv("PROGRAMFILES", "C:\\Program Files")
monkeypatch.setenv("PROGRAMFILES(X86)", "C:\\Program Files (x86)")
monkeypatch.setenv("LOCALAPPDATA", "C:\\Users\\TestUser\\AppData\\Local")
monkeypatch.setattr(os.path, "isfile", lambda p: False)
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
scraper.get_compatible_browser()
# Test macOS with non-existent paths
monkeypatch.setattr(platform, "system", lambda: "Darwin")
monkeypatch.setattr(os.path, "isfile", lambda p: False)
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
scraper.get_compatible_browser()
@pytest.mark.asyncio
async def test_session_state_persistence(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test that session state persists across browser restarts when user_data_dir is set."""
# DummyConfig to simulate browser config
class DummyConfig:
def __init__(self, **kwargs:object) -> None:
self.browser_args:list[str] = []
self.user_data_dir:str | None = None
self.extensions:list[str] = []
self.browser_executable_path:str | None = None
self.host:str | None = None
self.port:int | None = None
self.headless:bool = False
self._extensions:list[str] = []
def add_extension(self, ext:str) -> None:
self._extensions.append(ext)
# Mock nodriver.start to return a mock browser
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
monkeypatch.setattr(os.path, "exists", lambda p: True)
# Simulate state file in user_data_dir
state_file = tmp_path / "Default" / "state.json"
state_file.parent.mkdir(parents = True, exist_ok = True)
# First session: write state
scraper = WebScrapingMixin()
scraper.browser_config.user_data_dir = str(tmp_path)
scraper.browser_config.profile_name = "Default"
await scraper.create_browser_session()
state_file.write_text('{"foo": "bar"}', encoding = "utf-8")
scraper.browser._process_pid = 12345
scraper.browser.stop = MagicMock()
with patch("psutil.Process") as mock_proc:
mock_proc.return_value.children.return_value = []
scraper.close_browser_session()
# Second session: read state
scraper2 = WebScrapingMixin()
scraper2.browser_config.user_data_dir = str(tmp_path)
scraper2.browser_config.profile_name = "Default"
await scraper2.create_browser_session()
data = state_file.read_text(encoding = "utf-8")
assert data == '{"foo": "bar"}'
scraper2.browser._process_pid = 12346
scraper2.browser.stop = MagicMock()
with patch("psutil.Process") as mock_proc:
mock_proc.return_value.children.return_value = []
scraper2.close_browser_session()
@pytest.mark.asyncio
async def test_session_creation_error_cleanup(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test that resources are cleaned up when session creation fails."""
class DummyConfig:
def __init__(self, **kwargs:object) -> None:
self.browser_args:list[str] = []
self.user_data_dir:str | None = None
self.extensions:list[str] = []
self.browser_executable_path:str | None = None
self.host:str | None = None
self.port:int | None = None
self.headless:bool = False
self._extensions:list[str] = []
def add_extension(self, ext:str) -> None:
self._extensions.append(ext)
# Create a temporary file before the test
temp_file = tmp_path / "temp_resource"
temp_file.write_text("test")
# Mock nodriver.start to raise an exception
async def mock_start_fail(*args:object, **kwargs:object) -> NoReturn:
if temp_file.exists():
temp_file.unlink()
raise Exception("Session creation failed")
def make_mock_browser() -> AsyncMock:
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
mock_browser._process_pid = 12345
mock_browser.stop = MagicMock()
return mock_browser
monkeypatch.setattr(nodriver, "start", mock_start_fail)
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
# Don't mock os.path.exists globally - let the file operations work normally
# Attempt to create a session
scraper = WebScrapingMixin()
scraper.browser_config.user_data_dir = str(tmp_path)
scraper.browser_config.profile_name = "Default"
with pytest.raises(Exception, match = "Session creation failed"):
await scraper.create_browser_session() # type: ignore[unused-ignore,reportGeneralTypeIssues] # Awaiting a function that always raises
assert not (tmp_path / "temp_resource").exists()
assert scraper.browser is None
assert scraper.page is None
# Now patch nodriver.start to return a new mock browser each time
mock_browser = make_mock_browser()
mock_page = TrulyAwaitableMockPage()
mock_browser.get = AsyncMock(return_value = mock_page)
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
# Mock create_browser_session to ensure proper setup
async def mock_create_session(self:WebScrapingMixin) -> None:
self.browser = mock_browser
self.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session)
await scraper.create_browser_session() # type: ignore[unused-ignore,reportGeneralTypeIssues] # Awaiting a function that always raises
print("[DEBUG] scraper.page after session creation:", scraper.page)
assert scraper.browser is not None
assert scraper.page is not None
@pytest.mark.asyncio
async def test_external_process_termination(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
"""Test handling of external browser process termination."""
class DummyConfig:
def __init__(self, **kwargs:object) -> None:
self.browser_args:list[str] = []
self.user_data_dir:str | None = None
self.extensions:list[str] = []
self.browser_executable_path:str | None = None
self.host:str | None = None
self.port:int | None = None
self.headless:bool = False
self._extensions:list[str] = []
def add_extension(self, ext:str) -> None:
self._extensions.append(ext)
def make_mock_browser() -> AsyncMock:
mock_browser = AsyncMock()
mock_browser.websocket_url = "ws://localhost:9222"
mock_browser._process_pid = 12345
mock_browser.stop = MagicMock()
return mock_browser
mock_browser = make_mock_browser()
mock_page = TrulyAwaitableMockPage()
mock_browser.get = AsyncMock(return_value = mock_page)
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
monkeypatch.setattr(os.path, "exists", lambda p: True)
# Mock create_browser_session to ensure proper setup
async def mock_create_session(self:WebScrapingMixin) -> None:
self.browser = mock_browser
self.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session)
scraper = WebScrapingMixin()
scraper.browser_config.user_data_dir = str(tmp_path)
scraper.browser_config.profile_name = "Default"
await scraper.create_browser_session()
with patch("psutil.Process") as mock_proc:
mock_proc.side_effect = psutil.NoSuchProcess(12345)
with pytest.raises(psutil.NoSuchProcess):
scraper.close_browser_session()
# Create a new mock browser for the second session
mock_browser2 = make_mock_browser()
mock_browser2._process_pid = 12346
mock_page2 = TrulyAwaitableMockPage()
mock_browser2.get = AsyncMock(return_value = mock_page2)
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser2))
# Update mock_create_session for the second session
async def mock_create_session2(self:WebScrapingMixin) -> None:
self.browser = mock_browser2
self.page = mock_page2 # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session2)
await scraper.create_browser_session()
print("[DEBUG] scraper.page after session creation:", scraper.page)
assert scraper.browser is not None
assert scraper.page is not None
def test_diagnose_browser_issues(self, caplog:pytest.LogCaptureFixture) -> None:
"""Test that diagnose_browser_issues provides expected diagnostic output."""
# Configure logging to capture output
caplog.set_level(loggers.INFO)
# Create a WebScrapingMixin instance
mixin = WebScrapingMixin()
# Call the diagnose method
mixin.diagnose_browser_issues()
# Check that diagnostic output was produced
log_output = caplog.text.lower()
assert "browser connection diagnostics" in log_output or "browser-verbindungsdiagnose" in log_output
assert "end diagnostics" in log_output or "ende der diagnose" in log_output
class TestWebScrapingDiagnostics:
"""Test the diagnose_browser_issues method."""
@pytest.fixture
def scraper_with_config(self) -> WebScrapingMixin:
"""Create a WebScrapingMixin instance with browser config."""
scraper = WebScrapingMixin()
return scraper
def test_diagnose_browser_issues_binary_exists_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when browser binary exists and is executable."""
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True):
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
scraper_with_config.diagnose_browser_issues()
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
assert "(ok) Browser binary is executable" in caplog.text
def test_diagnose_browser_issues_binary_exists_not_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when browser binary exists but is not executable."""
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = False):
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
scraper_with_config.diagnose_browser_issues()
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
assert "(fail) Browser binary is not executable" in caplog.text
def test_diagnose_browser_issues_binary_not_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when browser binary is not found."""
with patch("os.path.exists", return_value = False):
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
scraper_with_config.diagnose_browser_issues()
assert "(fail) Browser binary not found: /usr/bin/chrome" in caplog.text
def test_diagnose_browser_issues_auto_detect_success(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when auto-detecting browser succeeds."""
with patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.browser_config.binary_location = None
scraper_with_config.diagnose_browser_issues()
assert "(ok) Auto-detected browser: /usr/bin/chrome" in caplog.text
def test_diagnose_browser_issues_auto_detect_failure(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when auto-detecting browser fails."""
with patch.object(scraper_with_config, "get_compatible_browser", return_value = None):
scraper_with_config.browser_config.binary_location = None
scraper_with_config.diagnose_browser_issues()
assert "(fail) No compatible browser found" in caplog.text
def test_diagnose_browser_issues_user_data_dir_exists_readable(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
) -> None:
"""Test diagnostic when user data directory exists and is readable/writable."""
test_dir = str(tmp_path / "chrome-profile")
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.browser_config.user_data_dir = test_dir
scraper_with_config.diagnose_browser_issues()
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
assert "(ok) User data directory is readable and writable" in caplog.text
def test_diagnose_browser_issues_user_data_dir_exists_not_readable(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
) -> None:
"""Test diagnostic when user data directory exists but is not readable/writable."""
test_dir = str(tmp_path / "chrome-profile")
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.browser_config.user_data_dir = test_dir
scraper_with_config.diagnose_browser_issues()
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
assert "(fail) User data directory permissions issue" in caplog.text
def test_diagnose_browser_issues_user_data_dir_not_exists(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
) -> None:
"""Test diagnostic when user data directory does not exist."""
test_dir = str(tmp_path / "chrome-profile")
with patch("os.path.exists", side_effect = lambda path: path != test_dir), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.browser_config.user_data_dir = test_dir
scraper_with_config.diagnose_browser_issues()
assert f"(info) User data directory does not exist (will be created): {test_dir}" in caplog.text
def test_diagnose_browser_issues_remote_debugging_port_configured_open(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when remote debugging port is configured and open."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen") as mock_urlopen:
mock_response = Mock()
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
mock_urlopen.return_value = mock_response
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.diagnose_browser_issues()
assert "(info) Remote debugging port configured: 9222" in caplog.text
assert "(ok) Remote debugging port is open" in caplog.text
assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text
def test_diagnose_browser_issues_remote_debugging_port_configured_open_api_fails(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when remote debugging port is open but API is not accessible."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen", side_effect = Exception("Connection refused")):
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.diagnose_browser_issues()
assert "(info) Remote debugging port configured: 9222" in caplog.text
assert "(ok) Remote debugging port is open" in caplog.text
assert "(fail) Remote debugging port is open but API not accessible: Connection refused" in caplog.text
assert "This might indicate a browser update issue or configuration problem" in caplog.text
def test_diagnose_browser_issues_remote_debugging_port_configured_closed(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when remote debugging port is configured but closed."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False):
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.diagnose_browser_issues()
assert "(info) Remote debugging port configured: 9222" in caplog.text
assert "(info) Remote debugging port is not open" in caplog.text
def test_diagnose_browser_issues_remote_debugging_port_not_configured(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when remote debugging port is not configured."""
scraper_with_config.browser_config.arguments = ["--other-arg"]
scraper_with_config.diagnose_browser_issues()
# Should not log anything about remote debugging port
assert "Remote debugging port" not in caplog.text
def test_diagnose_browser_issues_browser_processes_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when browser processes are found.
Updated to test target browser detection with debugging status.
"""
mock_processes = [
Mock(info = {"pid": 1234, "name": "chrome", "cmdline": ["/usr/bin/chrome"]}),
Mock(info = {"pid": 5678, "name": "chromium", "cmdline": ["/usr/bin/chromium"]}),
Mock(info = {"pid": 9012, "name": "edge", "cmdline": ["/usr/bin/edge"]}),
Mock(info = {"pid": 3456, "name": "chrome", "cmdline": ["/usr/bin/chrome", "--remote-debugging-port=9222"]})
]
with patch("psutil.process_iter", return_value = mock_processes), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
# Should find 2 chrome processes (target browser), one with debugging, one without
assert "(info) Found 2 browser processes running" in caplog.text
assert " - PID 1234: chrome (remote debugging NOT enabled)" in caplog.text
assert " - PID 3456: chrome (remote debugging enabled)" in caplog.text
def test_diagnose_browser_issues_no_browser_processes(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic when no browser processes are found."""
with patch("psutil.process_iter", return_value = []):
scraper_with_config.diagnose_browser_issues()
assert "(info) No browser processes currently running" in caplog.text
@patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info")
def test_diagnose_browser_issues_macos_platform_with_user_data_dir(
self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
) -> None:
"""Test diagnostic on macOS platform with user data directory."""
test_dir = str(tmp_path / "chrome-profile")
# Setup mock for Chrome 136+ detection with valid configuration
mock_get_diagnostic.return_value = {
"binary_detection": None,
"remote_detection": {
"version_string": "136.0.6778.0",
"major_version": 136,
"browser_name": "Chrome",
"is_chrome_136_plus": True
},
"chrome_136_plus_detected": True,
"recommendations": []
}
# Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run
original_env = os.environ.get("PYTEST_CURRENT_TEST")
if "PYTEST_CURRENT_TEST" in os.environ:
del os.environ["PYTEST_CURRENT_TEST"]
try:
with patch("platform.system", return_value = "Darwin"), \
patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen") as mock_urlopen, \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
# Mock Chrome 136+ detection from remote debugging
mock_response = Mock()
mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}'
mock_urlopen.return_value = mock_response
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.browser_config.user_data_dir = test_dir
scraper_with_config.diagnose_browser_issues()
# Should validate Chrome 136+ configuration and pass
assert "(info) Remote Chrome 136+ detected - validating configuration" in caplog.text
assert "(ok) Chrome 136+ configuration validation passed" in caplog.text
finally:
# Restore environment variable
if original_env is not None:
os.environ["PYTEST_CURRENT_TEST"] = original_env
def test_diagnose_browser_issues_linux_platform_not_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic on Linux platform when not running as root."""
with patch("platform.system", return_value = "Linux"), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False):
scraper_with_config.diagnose_browser_issues()
# Linux platform detection was removed - no specific message expected
assert "Linux detected" not in caplog.text
# Should not show error about running as root
assert "(fail) Running as root" not in caplog.text
def test_diagnose_browser_issues_linux_platform_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic on Linux platform when running as root."""
with patch("platform.system", return_value = "Linux"), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True):
scraper_with_config.diagnose_browser_issues()
# Linux platform detection was removed - no specific message expected
assert "Linux detected" not in caplog.text
assert "(fail) Running as root - this can cause browser issues" in caplog.text
def test_diagnose_browser_issues_unknown_platform(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic on unknown platform."""
with patch("platform.system", return_value = "UnknownOS"), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
# Should not show any platform-specific messages
assert "Windows detected" not in caplog.text
assert "macOS detected" not in caplog.text
assert "Linux detected" not in caplog.text
def test_diagnose_browser_issues_macos_remote_debugging_instructions(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
"""Test diagnostic shows macOS-specific remote debugging instructions."""
with patch("platform.system", return_value = "Darwin"), \
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.diagnose_browser_issues()
@patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info")
def test_diagnose_browser_issues_chrome_136_plus_misconfigured(
self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when Chrome 136+ is detected but user data directory is not configured."""
# Setup mock for Chrome 136+ detection with invalid configuration
mock_get_diagnostic.return_value = {
"binary_detection": None,
"remote_detection": {
"version_string": "136.0.6778.0",
"major_version": 136,
"browser_name": "Chrome",
"is_chrome_136_plus": True
},
"chrome_136_plus_detected": True,
"recommendations": []
}
# Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run
original_env = os.environ.get("PYTEST_CURRENT_TEST")
if "PYTEST_CURRENT_TEST" in os.environ:
del os.environ["PYTEST_CURRENT_TEST"]
try:
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen") as mock_urlopen, \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
# Mock Chrome 136+ detection from remote debugging
mock_response = Mock()
mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}'
mock_urlopen.return_value = mock_response
# Configure remote debugging but NO user data directory
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.browser_config.user_data_dir = None
scraper_with_config.diagnose_browser_issues()
# Should detect Chrome 136+ and show configuration error
assert "(info) Remote Chrome 136+ detected - validating configuration" in caplog.text
assert "(fail) Chrome 136+ configuration validation failed" in caplog.text
assert "Chrome/Edge 136+ requires --user-data-dir to be specified" in caplog.text
assert "Solution: Add --user-data-dir=/path/to/directory to browser arguments" in caplog.text
finally:
# Restore environment variable
if original_env is not None:
os.environ["PYTEST_CURRENT_TEST"] = original_env
def test_diagnose_browser_issues_complete_diagnostic_flow(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
) -> None:
"""Test complete diagnostic flow with all components."""
test_dir = str(tmp_path / "chrome-profile")
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen") as mock_urlopen, \
patch("psutil.process_iter", return_value = []), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False):
mock_response = Mock()
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
mock_urlopen.return_value = mock_response
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
scraper_with_config.browser_config.user_data_dir = test_dir
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.diagnose_browser_issues()
# Check that all diagnostic sections are present
assert "=== Browser Connection Diagnostics ===" in caplog.text
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
assert "(ok) Browser binary is executable" in caplog.text
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
assert "(ok) User data directory is readable and writable" in caplog.text
assert "(info) Remote debugging port configured: 9222" in caplog.text
assert "(ok) Remote debugging port is open" in caplog.text
assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text
assert "(info) No browser processes currently running" in caplog.text
# Linux platform detection was removed - no specific message expected
assert "Linux detected" not in caplog.text
assert "=== End Diagnostics ===" in caplog.text
def test_diagnose_browser_issues_remote_debugging_host_configured(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when remote debugging host is configured."""
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen") as mock_urlopen, \
patch("psutil.process_iter", return_value = []), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
mock_response = Mock()
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
mock_urlopen.return_value = mock_response
scraper_with_config.browser_config.arguments = [
"--remote-debugging-host=192.168.1.100",
"--remote-debugging-port=9222"
]
scraper_with_config.diagnose_browser_issues()
assert "(info) Remote debugging port configured: 9222" in caplog.text
assert "(ok) Remote debugging port is open" in caplog.text
def test_diagnose_browser_issues_process_info_missing_name(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when process info is missing name."""
mock_process = Mock()
mock_process.info = {"pid": 1234, "name": None, "cmdline": []}
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("psutil.process_iter", return_value = [mock_process]), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
assert "(info) No browser processes currently running" in caplog.text
def test_diagnose_browser_issues_psutil_exception_handling(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when psutil raises an exception during process iteration."""
# Mock psutil.process_iter to return a list that will cause an exception when accessing proc.info
mock_process = Mock()
mock_process.info = {"name": "chrome"}
mock_processes = [mock_process]
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("psutil.process_iter", return_value = mock_processes), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
patch.object(mock_process, "info", side_effect = psutil.AccessDenied):
scraper_with_config.diagnose_browser_issues()
# Should handle the exception gracefully and continue
assert "=== Browser Connection Diagnostics ===" in caplog.text
assert "=== End Diagnostics ===" in caplog.text
def test_diagnose_browser_issues_browser_not_executable(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when browser binary exists but is not executable."""
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = False), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch("psutil.process_iter", return_value = []):
scraper_with_config.diagnose_browser_issues()
assert "(fail) Browser binary is not executable" in caplog.text
def test_diagnose_browser_issues_browser_not_found(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when browser binary does not exist."""
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
with patch("os.path.exists", return_value = False), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch("psutil.process_iter", return_value = []):
scraper_with_config.diagnose_browser_issues()
assert "(fail) Browser binary not found:" in caplog.text
def test_diagnose_browser_issues_no_browser_auto_detection(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when no browser binary is configured and auto-detection fails."""
scraper_with_config.browser_config.binary_location = None
with patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch("psutil.process_iter", return_value = []), \
patch.object(scraper_with_config, "get_compatible_browser", side_effect = AssertionError("No browser found")), \
pytest.raises(AssertionError, match = "No browser found"):
scraper_with_config.diagnose_browser_issues()
def test_diagnose_browser_issues_user_data_dir_permissions_issue(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
) -> None:
"""Test diagnostic when user data directory has permission issues."""
test_dir = str(tmp_path / "chrome-profile")
scraper_with_config.browser_config.user_data_dir = test_dir
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = False), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
assert "(fail) User data directory permissions issue" in caplog.text
def test_diagnose_browser_issues_remote_debugging_api_inaccessible(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when remote debugging port is open but API is not accessible."""
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
patch("urllib.request.urlopen", side_effect = Exception("Connection refused")), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
assert "(fail) Remote debugging port is open but API not accessible" in caplog.text
assert "This might indicate a browser update issue or configuration problem" in caplog.text
def test_diagnose_browser_issues_macos_chrome_warning(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when macOS Chrome remote debugging is configured without user_data_dir."""
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
scraper_with_config.browser_config.user_data_dir = None
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("psutil.process_iter", return_value = []), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \
patch("platform.system", return_value = "Darwin"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
def test_diagnose_browser_issues_linux_root_user(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test diagnostic when running as root on Linux."""
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True), \
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
scraper_with_config.diagnose_browser_issues()
assert "(fail) Running as root - this can cause browser issues" in caplog.text
def test_is_admin_on_windows_system(self) -> None:
"""Test _is_admin function on Windows system."""
# Create a mock os module without geteuid
mock_os = Mock()
# Remove geteuid attribute to simulate Windows
del mock_os.geteuid
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
assert _is_admin() is False
def test_diagnose_browser_issues_psutil_exceptions(self, web_scraper:WebScrapingMixin) -> None:
"""Test diagnose_browser_issues handles psutil exceptions gracefully."""
# Mock psutil.process_iter to return a list that will cause exceptions when accessing proc.info
mock_process1 = Mock()
mock_process1.info = {"name": "chrome"}
mock_process2 = Mock()
mock_process2.info = {"name": "edge"}
mock_processes = [mock_process1, mock_process2]
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("psutil.process_iter", return_value = mock_processes), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._diagnose_chrome_version_issues"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \
patch.object(web_scraper, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
patch.object(mock_process1, "info", side_effect = psutil.NoSuchProcess(pid = 123)), \
patch.object(mock_process2, "info", side_effect = psutil.AccessDenied(pid = 456)):
# Should not raise any exceptions
web_scraper.diagnose_browser_issues()
def test_diagnose_browser_issues_handles_per_process_errors(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""diagnose_browser_issues should ignore psutil errors raised per process."""
caplog.set_level(logging.INFO)
class FailingProcess:
@property
def info(self) -> dict[str, object]:
raise psutil.AccessDenied(pid = 999)
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("psutil.process_iter", return_value = [FailingProcess()]), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
scraper_with_config.diagnose_browser_issues()
assert "(info) No browser processes currently running" in caplog.text
def test_diagnose_browser_issues_handles_global_psutil_failure(
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""diagnose_browser_issues should log a warning if psutil.process_iter fails entirely."""
caplog.set_level(logging.WARNING)
with patch("os.path.exists", return_value = True), \
patch("os.access", return_value = True), \
patch("psutil.process_iter", side_effect = psutil.Error("boom")), \
patch("platform.system", return_value = "Linux"), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
scraper_with_config.diagnose_browser_issues()
assert "(warn) Unable to inspect browser processes:" in caplog.text
@pytest.mark.asyncio
async def test_validate_chrome_version_configuration_port_open_but_api_inaccessible(
self, web_scraper:WebScrapingMixin
) -> None:
"""Test _validate_chrome_version_configuration when port is open but API is inaccessible."""
# Configure remote debugging
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
with patch.dict("os.environ", {}, clear = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", return_value = None), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
# Should not raise any exceptions and should log the appropriate debug message
await web_scraper._validate_chrome_version_configuration()
# Verify the debug message was logged
mock_log.debug.assert_any_call(" -> Port is open but remote debugging API not accessible")
@pytest.mark.asyncio
async def test_validate_chrome_version_configuration_remote_detection_exception(
self, web_scraper:WebScrapingMixin
) -> None:
"""Test _validate_chrome_version_configuration when remote detection raises exception."""
# Configure remote debugging
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
with patch.dict("os.environ", {}, clear = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", side_effect = Exception("Test exception")), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
# Should not raise any exceptions and should log the appropriate debug message
await web_scraper._validate_chrome_version_configuration()
# Verify the debug message was logged
# Check that the debug method was called with the expected message
debug_calls = [call for call in mock_log.debug.call_args_list if "Failed to detect version from existing browser" in str(call)]
assert len(debug_calls) > 0, "Expected debug message not found"
@pytest.mark.asyncio
async def test_validate_chrome_version_configuration_no_existing_browser(
self, web_scraper:WebScrapingMixin
) -> None:
"""Test _validate_chrome_version_configuration when no existing browser is found."""
# Configure remote debugging
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
with patch.dict("os.environ", {}, clear = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = False), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
# Should not raise any exceptions and should log the appropriate debug message
await web_scraper._validate_chrome_version_configuration()
# Verify the debug message was logged
mock_log.debug.assert_any_call(" -> No existing browser found at %s:%s", "127.0.0.1", 9222)
class TestWebScrapingMixinPortRetry:
"""Test the _check_port_with_retry method."""
@pytest.fixture
def scraper_with_remote_config(self) -> WebScrapingMixin:
"""Create a WebScrapingMixin instance with remote debugging configuration."""
scraper = WebScrapingMixin()
scraper.browser_config.binary_location = "/usr/bin/chrome"
scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
return scraper
@pytest.mark.asyncio
async def test_browser_connection_error_handling(
self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test error handling when browser connection fails."""
with patch("os.path.exists", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to connect as root user")), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
mock_config = Mock()
mock_config_class.return_value = mock_config
with pytest.raises(Exception, match = "Failed to connect as root user"):
await scraper_with_remote_config.create_browser_session()
# Check that the error handling was triggered
assert "Failed to connect to browser. This error often occurs when:" in caplog.text
@pytest.mark.asyncio
async def test_browser_connection_error_handling_non_root_error(
self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test error handling when browser connection fails with non-root error."""
with patch("os.path.exists", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Connection timeout")), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
mock_config = Mock()
mock_config_class.return_value = mock_config
with pytest.raises(Exception, match = "Connection timeout"):
await scraper_with_remote_config.create_browser_session()
# Should not trigger the root-specific error handling
assert "Failed to connect to browser. This error often occurs when:" not in caplog.text
@pytest.fixture
def scraper_with_startup_config(self) -> WebScrapingMixin:
"""Create a WebScrapingMixin instance for testing browser startup (no remote debugging)."""
scraper = WebScrapingMixin()
scraper.browser_config.binary_location = "/usr/bin/chrome"
# No remote debugging port configured - will start new browser
return scraper
@pytest.mark.asyncio
async def test_browser_startup_error_handling_root_error(
self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test error handling when browser startup fails with root error."""
with patch("os.path.exists", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to start as root user")), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
mock_config = Mock()
mock_config_class.return_value = mock_config
with pytest.raises(Exception, match = "Failed to start as root user"):
await scraper_with_startup_config.create_browser_session()
# Check that the root-specific error handling was triggered
assert "Failed to start browser. This error often occurs when:" in caplog.text
@pytest.mark.asyncio
async def test_browser_startup_error_handling_non_root_error(
self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
) -> None:
"""Test error handling when browser startup fails with non-root error."""
with patch("os.path.exists", return_value = True), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Browser binary not found")), \
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
mock_config = Mock()
mock_config_class.return_value = mock_config
with pytest.raises(Exception, match = "Browser binary not found"):
await scraper_with_startup_config.create_browser_session()
# Should not trigger the root-specific error handling
assert "Failed to start browser. This error often occurs when:" not in caplog.text
@pytest.fixture
def scraper(self) -> WebScrapingMixin:
"""Create a WebScrapingMixin instance."""
return WebScrapingMixin()
@pytest.mark.asyncio
async def test_check_port_with_retry_success_first_try(self, scraper:WebScrapingMixin) -> None:
"""Test port check succeeds on first try."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True):
result = await scraper._check_port_with_retry("127.0.0.1", 9222)
assert result is True
@pytest.mark.asyncio
async def test_check_port_with_retry_success_after_retries(self, scraper:WebScrapingMixin) -> None:
"""Test port check succeeds after some retries."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", side_effect = [False, False, True]):
result = await scraper._check_port_with_retry("127.0.0.1", 9222, max_retries = 3, retry_delay = 0.1)
assert result is True
@pytest.mark.asyncio
async def test_check_port_with_retry_failure_after_max_retries(self, scraper:WebScrapingMixin) -> None:
"""Test port check fails after max retries."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False):
result = await scraper._check_port_with_retry("127.0.0.1", 9222, max_retries = 2, retry_delay = 0.1)
assert result is False
@pytest.mark.asyncio
async def test_check_port_with_retry_custom_parameters(self, scraper:WebScrapingMixin) -> None:
"""Test port check with custom retry parameters."""
with patch("kleinanzeigen_bot.utils.net.is_port_open", side_effect = [False, True]):
result = await scraper._check_port_with_retry("192.168.1.100", 8080, max_retries = 5, retry_delay = 0.05)
assert result is True
class TestWebScrapingMixinProfileHandling:
"""Test the enhanced profile directory handling."""
@pytest.fixture
def scraper_with_profile_config(self, tmp_path:Path) -> WebScrapingMixin:
"""Create a WebScrapingMixin instance with profile configuration."""
scraper = WebScrapingMixin()
scraper.browser_config.user_data_dir = str(tmp_path / "test-profile")
scraper.browser_config.profile_name = "TestProfile"
return scraper
def test_profile_directory_creation_with_user_data_dir(
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
) -> None:
"""Test profile directory creation when user_data_dir is configured."""
test_dir = str(tmp_path / "test-profile")
scraper_with_profile_config.browser_config.user_data_dir = test_dir
with patch("os.path.join", return_value = os.path.join(test_dir, "TestProfile")), \
patch("os.makedirs") as mock_makedirs, \
patch("os.path.exists", return_value = False), \
patch("builtins.open", mock_open()), \
patch("json.dump"):
# This would be called during browser session creation
profile_dir = os.path.join(test_dir, "TestProfile")
mock_makedirs.assert_not_called() # Not called yet
# Simulate the profile creation logic
os.makedirs(profile_dir, exist_ok = True)
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
def test_profile_directory_creation_with_preferences_file(
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
) -> None:
"""Test profile directory creation with preferences file when it doesn't exist."""
test_dir = str(tmp_path / "test-profile")
scraper_with_profile_config.browser_config.user_data_dir = test_dir
with patch("os.makedirs") as mock_makedirs, \
patch("os.path.exists", return_value = False), \
patch("builtins.open", mock_open()) as mock_file, \
patch("json.dump") as mock_json_dump:
# Simulate the profile creation logic
profile_dir = os.path.join(test_dir, "TestProfile")
prefs_file = os.path.join(profile_dir, "Preferences")
# This would be called during browser session creation
os.makedirs(profile_dir, exist_ok = True)
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
# Simulate preferences file creation
with open(prefs_file, "w", encoding = "UTF-8") as fd:
json.dump({"test": "preferences"}, fd)
mock_file.assert_called_with(prefs_file, "w", encoding = "UTF-8")
mock_json_dump.assert_called()
def test_profile_directory_creation_with_existing_preferences_file(
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
) -> None:
"""Test profile directory creation when preferences file already exists."""
test_dir = str(tmp_path / "test-profile")
scraper_with_profile_config.browser_config.user_data_dir = test_dir
with patch("os.makedirs") as mock_makedirs, \
patch("os.path.exists", return_value = True), \
patch("builtins.open", mock_open()) as mock_file, \
patch("json.dump") as mock_json_dump:
# Simulate the profile creation logic
profile_dir = os.path.join(test_dir, "TestProfile")
# This would be called during browser session creation
os.makedirs(profile_dir, exist_ok = True)
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
# Preferences file exists, so it should not be created
mock_file.assert_not_called()
mock_json_dump.assert_not_called()
def test_profile_directory_creation_with_edge_browser(
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
) -> None:
"""Test profile directory creation with Edge browser configuration."""
test_dir = str(tmp_path / "test-profile")
scraper_with_profile_config.browser_config.user_data_dir = test_dir
scraper_with_profile_config.browser_config.binary_location = "/usr/bin/microsoft-edge"
with patch("os.makedirs") as mock_makedirs, \
patch("os.path.exists", return_value = False), \
patch("builtins.open", mock_open()), \
patch("json.dump"), \
patch("os.environ", {"MSEDGEDRIVER_TELEMETRY_OPTOUT": "1"}):
# Simulate the profile creation logic
profile_dir = os.path.join(test_dir, "TestProfile")
# This would be called during browser session creation
os.makedirs(profile_dir, exist_ok = True)
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
def test_profile_directory_creation_with_private_window(
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
) -> None:
"""Test profile directory creation with private window configuration."""
test_dir = str(tmp_path / "test-profile")
scraper_with_profile_config.browser_config.user_data_dir = test_dir
scraper_with_profile_config.browser_config.use_private_window = True
with patch("os.makedirs") as mock_makedirs, \
patch("os.path.exists", return_value = False), \
patch("builtins.open", mock_open()), \
patch("json.dump"):
# Simulate the profile creation logic
profile_dir = os.path.join(test_dir, "TestProfile")
# This would be called during browser session creation
os.makedirs(profile_dir, exist_ok = True)
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
def test_profile_directory_creation_without_user_data_dir(
self, scraper_with_profile_config:WebScrapingMixin
) -> None:
"""Test profile directory handling when user_data_dir is not configured."""
scraper_with_profile_config.browser_config.user_data_dir = None
# Should not create profile directories when user_data_dir is None
with patch("os.path.join") as mock_join, \
patch("os.makedirs") as mock_makedirs:
# The profile creation logic should not be called
mock_join.assert_not_called()
mock_makedirs.assert_not_called()
class TestWebScrapingMixinAdminCheck:
"""Test the _is_admin helper function."""
def test_is_admin_on_unix_system(self) -> None:
"""Test _is_admin function on Unix-like system."""
# Create a mock os module with geteuid
mock_os = Mock()
mock_os.geteuid = Mock(return_value = 0)
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
assert _is_admin() is True
def test_is_admin_on_unix_system_not_root(self) -> None:
"""Test _is_admin function on Unix-like system when not root."""
# Create a mock os module with geteuid
mock_os = Mock()
mock_os.geteuid = Mock(return_value = 1000)
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
assert _is_admin() is False
def test_is_admin_on_windows_system(self) -> None:
"""Test _is_admin function on Windows system."""
# Create a mock os module without geteuid
mock_os = Mock()
# Remove geteuid attribute to simulate Windows
del mock_os.geteuid
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
assert _is_admin() is False