mirror of
https://github.com/Second-Hand-Friends/kleinanzeigen-bot.git
synced 2026-03-12 02:31:45 +01:00
## ℹ️ Description This pull request fixes Windows browser auto-detection failures reported by users where `diagnose`/startup could not find an installed browser even when Chrome or Edge were present in standard locations. It also makes diagnostics resilient when auto-detection fails by avoiding an assertion-driven abort and continuing with a clear failure log. - Link to the related issue(s): Issue #815 - Describe the motivation and context for this change. - Users reported `Installed browser could not be detected` on Windows despite having a browser installed. - The previous Windows candidate list used a mix of incomplete paths and direct `os.environ[...]` lookups that could raise when variables were missing. - The updated path candidates and ordering were aligned with common Windows install locations used by Playwright’s channel/executable resolution logic (Chrome/Edge under `LOCALAPPDATA`, `PROGRAMFILES`, and `PROGRAMFILES(X86)`). ## 📋 Changes Summary - Expanded Windows browser path candidates in `get_compatible_browser()` to include common Google Chrome and Microsoft Edge install paths, while keeping Chromium and PATH fallbacks. - Replaced unsafe direct env-var indexing with safe retrieval (`os.environ.get(...)`) and added a fallback derivation for `LOCALAPPDATA` via `USERPROFILE\\AppData\\Local` when needed. - Kept legacy Chrome path candidates (`...\\Chrome\\Application\\chrome.exe`) as compatibility fallback. - Updated diagnostics flow to catch browser auto-detection assertion failures and continue with `(fail) No compatible browser found` instead of crashing. - Added/updated unit tests to verify: - Windows detection for LocalAppData Chrome/Edge/Chromium paths. - Missing Windows env vars no longer cause key lookup failures and still surface the intended final detection assertion. - `diagnose_browser_issues()` handles auto-detection assertion failures without raising and logs the expected failure message. ### ⚙️ Type of Change Select the type(s) of change(s) included in this pull request: - [x] 🐞 Bug fix (non-breaking change which fixes an issue) ## ✅ Checklist Before requesting a review, confirm the following: - [x] I have reviewed my changes to ensure they meet the project's standards. - [x] I have tested my changes and ensured that all tests pass (`pdm run test`). - [x] I have formatted the code (`pdm run format`). - [x] I have verified that linting passes (`pdm run lint`). - [x] I have updated documentation where necessary. By submitting this pull request, I confirm that you can use, modify, copy, and redistribute this contribution, under the terms of your choice. <!-- This is an auto-generated comment: release notes by coderabbit.ai --> ## Summary by CodeRabbit * **Bug Fixes** * Hardened Windows browser auto-detection: checks additional common installation locations for Chrome/Chromium/Edge and treats detection failures as non-fatal, allowing diagnostics to continue with fallback behavior and debug logging when no browser is found. * **Tests** * Expanded Windows detection tests to cover more path scenarios and added cases verifying failure-mode diagnostics and logging. * **Style** * Minor formatting tweak in default configuration. <!-- end of auto-generated comment: release notes by coderabbit.ai -->
2280 lines
115 KiB
Python
2280 lines
115 KiB
Python
# SPDX-FileCopyrightText: © Jens Bergmann and contributors
|
|
# SPDX-License-Identifier: AGPL-3.0-or-later
|
|
# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/
|
|
"""Unit tests for web_scraping_mixin.py focusing on error handling scenarios.
|
|
|
|
Copyright (c) 2024, kleinanzeigen-bot contributors.
|
|
All rights reserved.
|
|
"""
|
|
|
|
import json
|
|
import logging
|
|
import os
|
|
import platform
|
|
import shutil
|
|
import zipfile
|
|
from collections.abc import Awaitable, Callable
|
|
from pathlib import Path
|
|
from typing import Any, NoReturn, Protocol, cast
|
|
from unittest.mock import AsyncMock, MagicMock, Mock, mock_open, patch
|
|
|
|
import nodriver
|
|
import psutil
|
|
import pytest
|
|
from nodriver.core.element import Element
|
|
from nodriver.core.tab import Tab as Page
|
|
|
|
from kleinanzeigen_bot.model.config_model import Config
|
|
from kleinanzeigen_bot.utils import files, loggers
|
|
from kleinanzeigen_bot.utils.web_scraping_mixin import By, Is, WebScrapingMixin, _is_admin # noqa: PLC2701
|
|
|
|
|
|
class ConfigProtocol(Protocol):
|
|
"""Protocol for Config objects used in tests."""
|
|
extensions:list[str]
|
|
browser_args:list[str]
|
|
user_data_dir:str | None
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
pass
|
|
|
|
|
|
def _nodriver_start_mock() -> Mock:
|
|
"""Return the nodriver.start mock with proper typing."""
|
|
return cast(Mock, cast(Any, nodriver).start)
|
|
|
|
|
|
class TrulyAwaitableMockPage:
|
|
"""A helper to make a mock Page object truly awaitable for tests."""
|
|
|
|
def __init__(self) -> None:
|
|
self._mock = AsyncMock(spec = Page)
|
|
self.url = "https://example.com"
|
|
self.query_selector = AsyncMock()
|
|
self.evaluate = AsyncMock()
|
|
|
|
def __getattr__(self, item:str) -> object:
|
|
return getattr(self._mock, item)
|
|
|
|
def __await__(self) -> object:
|
|
async def _noop() -> "TrulyAwaitableMockPage":
|
|
return self
|
|
|
|
return _noop().__await__()
|
|
|
|
# Allow setting attributes on the mock
|
|
def __setattr__(self, key:str, value:object) -> None:
|
|
if key in {"_mock", "url", "query_selector", "evaluate"}:
|
|
object.__setattr__(self, key, value)
|
|
else:
|
|
setattr(self._mock, key, value)
|
|
|
|
|
|
@pytest.fixture
|
|
def mock_page() -> TrulyAwaitableMockPage:
|
|
"""Create a truly awaitable mock Page object."""
|
|
page = TrulyAwaitableMockPage()
|
|
return page
|
|
|
|
|
|
@pytest.fixture
|
|
def mock_browser() -> AsyncMock:
|
|
"""Create a mock Browser object."""
|
|
browser = AsyncMock()
|
|
browser.websocket_url = "ws://localhost:9222"
|
|
return browser
|
|
|
|
|
|
@pytest.fixture
|
|
def web_scraper(mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with mocked browser and page."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = mock_browser
|
|
scraper.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
scraper.config = Config.model_validate({"login": {"username": "user@example.com", "password": "secret"}}) # noqa: S105
|
|
return scraper
|
|
|
|
|
|
def test_write_initial_prefs(tmp_path:Path) -> None:
|
|
"""Test _write_initial_prefs helper function."""
|
|
from kleinanzeigen_bot.utils.web_scraping_mixin import _write_initial_prefs # noqa: PLC0415, PLC2701
|
|
|
|
prefs_file = tmp_path / "Preferences"
|
|
_write_initial_prefs(str(prefs_file))
|
|
|
|
# Verify file was created
|
|
assert prefs_file.exists()
|
|
|
|
# Verify content is valid JSON with expected structure
|
|
with open(prefs_file, encoding = "UTF-8") as f:
|
|
prefs = json.load(f)
|
|
|
|
assert prefs["credentials_enable_service"] is False
|
|
assert prefs["enable_do_not_track"] is True
|
|
assert prefs["google"]["services"]["consented_to_sync"] is False
|
|
assert prefs["profile"]["password_manager_enabled"] is False
|
|
assert prefs["profile"]["default_content_setting_values"]["notifications"] == 2
|
|
assert prefs["signin"]["allowed"] is False
|
|
assert "www.kleinanzeigen.de" in prefs["translate_site_blacklist"]
|
|
assert prefs["devtools"]["preferences"]["currentDockState"] == '"bottom"'
|
|
|
|
|
|
class TestWebScrapingErrorHandling:
|
|
"""Test error handling scenarios in WebScrapingMixin."""
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_timeout(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test timeout handling in web_find."""
|
|
# Mock page.query_selector to return None, simulating element not found
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test timeout for ID selector
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.1)
|
|
|
|
# Test timeout for class selector
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with CSS class 'test-class'"):
|
|
await web_scraper.web_find(By.CLASS_NAME, "test-class", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_network_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test network error handling in web_find."""
|
|
# Mock page.query_selector to raise a network error
|
|
mock_page.query_selector.side_effect = Exception("Network error")
|
|
|
|
# Test network error for ID selector
|
|
with pytest.raises(Exception, match = "Network error"):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_click_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not found error in web_click."""
|
|
# Mock page.query_selector to return None
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test element not found error
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_click(By.ID, "test-id", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_click_element_not_clickable(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not clickable error in web_click."""
|
|
# Create a mock element that raises an error on click
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.click.side_effect = Exception("Element not clickable")
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
# Test element not clickable error
|
|
with pytest.raises(Exception, match = "Element not clickable"):
|
|
await web_scraper.web_click(By.ID, "test-id")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_input_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not found error in web_input."""
|
|
# Mock page.query_selector to return None
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test element not found error
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_input(By.ID, "test-id", "test text", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_input_clear_failure(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test input clear failure in web_input."""
|
|
# Create a mock element that raises an error on clear_input
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.clear_input.side_effect = Exception("Cannot clear input")
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
# Test input clear failure
|
|
with pytest.raises(Exception, match = "Cannot clear input"):
|
|
await web_scraper.web_input(By.ID, "test-id", "test text")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_missing_dropdown_options(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection when aria-controls attribute is missing."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
web_scraper.web_find = AsyncMock(return_value = input_field) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
with pytest.raises(TimeoutError, match = "Combobox missing aria-controls attribute"):
|
|
await web_scraper.web_select_combobox(By.ID, "combo-id", "Option", timeout = 0.1)
|
|
|
|
input_field.clear_input.assert_awaited_once()
|
|
input_field.send_keys.assert_awaited_once_with("Option")
|
|
assert web_scraper.web_sleep.await_count == 1 # Only one sleep before checking aria-controls
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_selects_matching_option(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection matches a visible <li> option."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {"aria-controls": "dropdown-id"}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
|
|
dropdown_elem = AsyncMock(spec = Element)
|
|
dropdown_elem.apply = AsyncMock(return_value = True)
|
|
|
|
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
result = await web_scraper.web_select_combobox(By.ID, "combo-id", "Visible Label")
|
|
|
|
assert result is dropdown_elem
|
|
input_field.clear_input.assert_awaited_once()
|
|
input_field.send_keys.assert_awaited_once_with("Visible Label")
|
|
dropdown_elem.apply.assert_awaited_once()
|
|
assert web_scraper.web_sleep.await_count == 2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_no_matching_option_raises(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection raises when no <li> matches the entered text."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {"aria-controls": "dropdown-id"}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
|
|
dropdown_elem = AsyncMock(spec = Element)
|
|
dropdown_elem.apply = AsyncMock(return_value = False)
|
|
|
|
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
with pytest.raises(TimeoutError, match = "No matching option found in combobox"):
|
|
await web_scraper.web_select_combobox(By.ID, "combo-id", "Missing Label")
|
|
|
|
dropdown_elem.apply.assert_awaited_once()
|
|
assert web_scraper.web_sleep.await_count == 1 # One sleep after typing, error before second sleep
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_special_characters(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection with special characters (quotes, newlines, etc)."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {"aria-controls": "dropdown-id"}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
|
|
dropdown_elem = AsyncMock(spec = Element)
|
|
dropdown_elem.apply = AsyncMock(return_value = True)
|
|
|
|
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
# Test with quotes, backslashes, and newlines
|
|
special_value = 'Value with "quotes" and \\ backslash'
|
|
result = await web_scraper.web_select_combobox(By.ID, "combo-id", special_value)
|
|
|
|
assert result is dropdown_elem
|
|
input_field.send_keys.assert_awaited_once_with(special_value)
|
|
# Verify that the JavaScript received properly escaped value
|
|
call_args = dropdown_elem.apply.call_args[0][0]
|
|
assert '"quotes"' in call_args or r'\"quotes\"' in call_args # JSON escaping should handle quotes
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_by_value(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_select successfully matches by option value."""
|
|
select_elem = AsyncMock(spec = Element)
|
|
select_elem.apply = AsyncMock()
|
|
|
|
web_scraper.web_check = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_await = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_find = AsyncMock(return_value = select_elem) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
result = await web_scraper.web_select(By.ID, "select-id", "option-value")
|
|
|
|
assert result is select_elem
|
|
select_elem.apply.assert_awaited_once()
|
|
web_scraper.web_sleep.assert_awaited_once()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_raises_on_missing_option(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_select raises TimeoutError when option not found."""
|
|
select_elem = AsyncMock(spec = Element)
|
|
# Simulate JS throwing an error when option not found
|
|
select_elem.apply = AsyncMock(side_effect = Exception("Option not found by value or displayed text: missing"))
|
|
|
|
web_scraper.web_check = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_await = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_find = AsyncMock(return_value = select_elem) # type: ignore[method-assign]
|
|
|
|
with pytest.raises(TimeoutError, match = "Option not found by value or displayed text"):
|
|
await web_scraper.web_select(By.ID, "select-id", "missing-option")
|
|
|
|
async def test_web_input_success_returns_element(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Successful web_input should send keys, wait, and return the element."""
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_page.query_selector.return_value = mock_element
|
|
mock_sleep = AsyncMock()
|
|
cast(Any, web_scraper).web_sleep = mock_sleep
|
|
|
|
result = await web_scraper.web_input(By.ID, "username", "hello world", timeout = 1)
|
|
|
|
assert result is mock_element
|
|
mock_element.clear_input.assert_awaited_once()
|
|
mock_element.send_keys.assert_awaited_once_with("hello world")
|
|
mock_sleep.assert_awaited_once()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_open_timeout(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test page load timeout in web_open."""
|
|
# Mock browser.get to return a page that never loads
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get.return_value = mock_page
|
|
|
|
# Mock web_execute to never return True for document.readyState
|
|
setattr(web_scraper, "web_execute", AsyncMock(return_value = False))
|
|
|
|
# Ensure page is None so the timeout path is exercised
|
|
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
|
|
# Test page load timeout
|
|
with pytest.raises(TimeoutError, match = "Page did not finish loading within"):
|
|
await web_scraper.web_open("https://example.com", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_open_skip_when_url_already_loaded(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""web_open should short-circuit when the requested URL is already active."""
|
|
mock_browser.get.reset_mock()
|
|
mock_page.url = "https://example.com"
|
|
mock_execute = AsyncMock()
|
|
cast(Any, web_scraper).web_execute = mock_execute
|
|
|
|
await web_scraper.web_open("https://example.com", reload_if_already_open = False)
|
|
|
|
mock_browser.get.assert_not_awaited()
|
|
mock_execute.assert_not_called()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_request_invalid_response(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test invalid response handling in web_request."""
|
|
# Mock page.evaluate to return an invalid response
|
|
mock_page.evaluate.return_value = {"statusCode": 404, "statusMessage": "Not Found", "headers": {}, "content": "Page not found"}
|
|
|
|
# Test invalid response error
|
|
with pytest.raises(AssertionError, match = "Invalid response"):
|
|
await web_scraper.web_request("https://example.com")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_request_network_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test network error handling in web_request."""
|
|
# Mock page.evaluate to raise a network error
|
|
mock_page.evaluate.side_effect = Exception("Network error")
|
|
|
|
# Test network error
|
|
with pytest.raises(Exception, match = "Network error"):
|
|
await web_scraper.web_request("https://example.com")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_check_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not found error in web_check."""
|
|
# Mock page.query_selector to return None
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test element not found error
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_check(By.ID, "test-id", Is.CLICKABLE, timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_check_attribute_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test attribute error in web_check."""
|
|
# Create a mock element that raises an error on attribute check
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.attrs = {}
|
|
mock_element.apply.side_effect = Exception("Attribute error")
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
# Test attribute error
|
|
with pytest.raises(Exception, match = "Attribute error"):
|
|
await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_applies_timeout_multiplier_and_backoff(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Ensure multiplier/backoff logic is honored when timeouts occur."""
|
|
assert web_scraper.config is not None
|
|
web_scraper.config.timeouts.multiplier = 2.0
|
|
web_scraper.config.timeouts.retry_enabled = True
|
|
web_scraper.config.timeouts.retry_max_attempts = 2
|
|
web_scraper.config.timeouts.retry_backoff_factor = 2.0
|
|
|
|
recorded:list[tuple[float, bool]] = []
|
|
|
|
async def fake_web_await(condition:Callable[[], object], *, timeout:float, timeout_error_message:str = "",
|
|
apply_multiplier:bool = True) -> Element:
|
|
recorded.append((timeout, apply_multiplier))
|
|
raise TimeoutError(timeout_error_message or "timeout")
|
|
|
|
cast(Any, web_scraper).web_await = fake_web_await
|
|
|
|
with pytest.raises(TimeoutError):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.5)
|
|
|
|
assert recorded == [(1.0, False), (2.0, False), (4.0, False)]
|
|
|
|
|
|
class TestTimeoutAndRetryHelpers:
|
|
"""Test timeout helper utilities in WebScrapingMixin."""
|
|
|
|
def test_get_timeout_config_prefers_config_timeouts(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_get_timeout_config should return the config-provided timeout model when available."""
|
|
custom_config = Config.model_validate({
|
|
"login": {"username": "user@example.com", "password": "secret"}, # noqa: S105
|
|
"timeouts": {"default": 7.5}
|
|
})
|
|
web_scraper.config = custom_config
|
|
|
|
assert web_scraper._get_timeout_config() is custom_config.timeouts
|
|
|
|
def test_timeout_attempts_respects_retry_switch(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_timeout_attempts should collapse to a single attempt when retries are disabled."""
|
|
web_scraper.config.timeouts.retry_enabled = False
|
|
assert web_scraper._timeout_attempts() == 1
|
|
|
|
web_scraper.config.timeouts.retry_enabled = True
|
|
web_scraper.config.timeouts.retry_max_attempts = 3
|
|
assert web_scraper._timeout_attempts() == 4
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_run_with_timeout_retries_retries_operation(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_run_with_timeout_retries should retry when TimeoutError is raised before succeeding."""
|
|
attempts:list[float] = []
|
|
|
|
async def flaky_operation(timeout:float) -> str:
|
|
attempts.append(timeout)
|
|
if len(attempts) == 1:
|
|
raise TimeoutError("first attempt")
|
|
return "done"
|
|
|
|
web_scraper.config.timeouts.retry_max_attempts = 1
|
|
result = await web_scraper._run_with_timeout_retries(flaky_operation, description = "retry-op")
|
|
|
|
assert result == "done"
|
|
assert len(attempts) == 2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_run_with_timeout_retries_guard_clause(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_run_with_timeout_retries should guard against zero-attempt edge cases."""
|
|
async def never_called(timeout:float) -> None:
|
|
pytest.fail("operation should not run when attempts are zero")
|
|
|
|
with patch.object(web_scraper, "_timeout_attempts", return_value = 0), \
|
|
pytest.raises(TimeoutError, match = "guarded-op failed without executing operation"):
|
|
await web_scraper._run_with_timeout_retries(never_called, description = "guarded-op")
|
|
|
|
|
|
class TestSelectorTimeoutMessages:
|
|
"""Ensure selector helpers provide informative timeout messages."""
|
|
|
|
@pytest.mark.asyncio
|
|
@pytest.mark.parametrize(
|
|
("selector_type", "selector_value", "expected_message"),
|
|
[
|
|
(By.TAG_NAME, "section", "No HTML element found of tag <section> within 2.0 seconds."),
|
|
(By.CSS_SELECTOR, ".hero", "No HTML element found using CSS selector '.hero' within 2.0 seconds."),
|
|
(By.TEXT, "Submit", "No HTML element found containing text 'Submit' within 2.0 seconds."),
|
|
(By.XPATH, "//div[@class='hero']", "No HTML element found using XPath '//div[@class='hero']' within 2.0 seconds."),
|
|
]
|
|
)
|
|
async def test_web_find_timeout_suffixes(
|
|
self,
|
|
web_scraper:WebScrapingMixin,
|
|
selector_type:By,
|
|
selector_value:str,
|
|
expected_message:str
|
|
) -> None:
|
|
"""web_find should pass descriptive timeout messages for every selector strategy."""
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_wait = AsyncMock(return_value = mock_element)
|
|
cast(Any, web_scraper).web_await = mock_wait
|
|
|
|
result = await web_scraper.web_find(selector_type, selector_value, timeout = 2)
|
|
|
|
assert result is mock_element
|
|
call = mock_wait.await_args_list[0]
|
|
assert expected_message == call.kwargs["timeout_error_message"]
|
|
assert call.kwargs["apply_multiplier"] is False
|
|
|
|
@pytest.mark.asyncio
|
|
@pytest.mark.parametrize(
|
|
("selector_type", "selector_value", "expected_message"),
|
|
[
|
|
(By.CLASS_NAME, "hero", "No HTML elements found with CSS class 'hero' within 1 seconds."),
|
|
(By.CSS_SELECTOR, ".card", "No HTML elements found using CSS selector '.card' within 1 seconds."),
|
|
(By.TAG_NAME, "article", "No HTML elements found of tag <article> within 1 seconds."),
|
|
(By.TEXT, "Listings", "No HTML elements found containing text 'Listings' within 1 seconds."),
|
|
(By.XPATH, "//footer", "No HTML elements found using XPath '//footer' within 1 seconds."),
|
|
]
|
|
)
|
|
async def test_web_find_all_once_timeout_suffixes(
|
|
self,
|
|
web_scraper:WebScrapingMixin,
|
|
selector_type:By,
|
|
selector_value:str,
|
|
expected_message:str
|
|
) -> None:
|
|
"""_web_find_all_once should surface informative timeout errors for each selector."""
|
|
elements = [AsyncMock(spec = Element)]
|
|
mock_wait = AsyncMock(return_value = elements)
|
|
cast(Any, web_scraper).web_await = mock_wait
|
|
|
|
result = await web_scraper._web_find_all_once(selector_type, selector_value, 1)
|
|
|
|
assert result is elements
|
|
call = mock_wait.await_args_list[0]
|
|
assert expected_message == call.kwargs["timeout_error_message"]
|
|
assert call.kwargs["apply_multiplier"] is False
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_all_delegates_to_retry_helper(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""web_find_all should execute via the timeout retry helper."""
|
|
elements = [AsyncMock(spec = Element)]
|
|
|
|
async def fake_retry(operation:Callable[[float], Awaitable[list[Element]]], **kwargs:Any) -> list[Element]:
|
|
assert kwargs["description"] == "web_find_all(CLASS_NAME, hero)"
|
|
assert kwargs["override"] == 1.5
|
|
result = await operation(0.42)
|
|
return result
|
|
|
|
retry_mock = AsyncMock(side_effect = fake_retry)
|
|
once_mock = AsyncMock(return_value = elements)
|
|
cast(Any, web_scraper)._run_with_timeout_retries = retry_mock
|
|
cast(Any, web_scraper)._web_find_all_once = once_mock
|
|
|
|
result = await web_scraper.web_find_all(By.CLASS_NAME, "hero", timeout = 1.5)
|
|
|
|
assert result is elements
|
|
retry_call = retry_mock.await_args_list[0]
|
|
assert retry_call.kwargs["key"] == "default"
|
|
assert retry_call.kwargs["override"] == 1.5
|
|
|
|
once_call = once_mock.await_args_list[0]
|
|
assert once_call.args[:2] == (By.CLASS_NAME, "hero")
|
|
assert once_call.args[2] == 0.42
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_check_unsupported_attribute(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""web_check should raise for unsupported attribute queries."""
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.attrs = {}
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
with pytest.raises(AssertionError, match = "Unsupported attribute"):
|
|
await web_scraper.web_check(By.ID, "test-id", cast(Is, object()), timeout = 0.1)
|
|
|
|
|
|
class TestWebScrapingSessionManagement:
|
|
"""Test session management edge cases in WebScrapingMixin."""
|
|
|
|
def test_close_browser_session_cleans_up_resources(self) -> None:
|
|
"""Ensure browser and page references are cleared and child processes are killed."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = MagicMock()
|
|
scraper.browser._process_pid = 42
|
|
stop_mock = scraper.browser.stop = MagicMock()
|
|
scraper.page = MagicMock(spec = Page)
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_child = MagicMock()
|
|
mock_child.is_running.return_value = True
|
|
mock_proc.return_value.children.return_value = [mock_child]
|
|
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_called_once_with(42)
|
|
stop_mock.assert_called_once()
|
|
mock_child.kill.assert_called_once()
|
|
assert scraper.browser is None
|
|
assert scraper.page is None
|
|
|
|
def test_close_browser_session_idempotent(self) -> None:
|
|
"""Repeated calls should leave the state clean without re-running cleanup logic."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = MagicMock()
|
|
scraper.browser._process_pid = 99
|
|
stop_mock = scraper.browser.stop = MagicMock()
|
|
scraper.page = MagicMock(spec = Page)
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper.close_browser_session()
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_called_once()
|
|
stop_mock.assert_called_once()
|
|
|
|
def test_close_browser_session_without_browser_skips_inspection(self) -> None:
|
|
"""When no browser exists, no process inspection should run and the page should stay untouched."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
preserved_page = MagicMock(spec = Page)
|
|
scraper.page = preserved_page
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_not_called()
|
|
assert scraper.page is preserved_page
|
|
|
|
def test_close_browser_session_handles_missing_children(self) -> None:
|
|
"""Child-less browsers should still stop cleanly without raising."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = MagicMock()
|
|
scraper.browser._process_pid = 123
|
|
stop_mock = scraper.browser.stop = MagicMock()
|
|
scraper.page = MagicMock(spec = Page)
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_called_once()
|
|
stop_mock.assert_called_once()
|
|
|
|
def test_get_compatible_browser_raises_on_unknown_os(self) -> None:
|
|
"""Test get_compatible_browser raises AssertionError on unknown OS."""
|
|
scraper = WebScrapingMixin()
|
|
with patch("platform.system", return_value = "UnknownOS"), pytest.raises(AssertionError):
|
|
scraper.get_compatible_browser()
|
|
|
|
def test_get_compatible_browser_raises_if_no_browser_found(self) -> None:
|
|
"""Test get_compatible_browser raises AssertionError if no browser is found."""
|
|
scraper = WebScrapingMixin()
|
|
with (
|
|
patch("platform.system", return_value = "Linux"),
|
|
patch("os.path.isfile", return_value = False),
|
|
patch("shutil.which", return_value = None),
|
|
pytest.raises(AssertionError),
|
|
):
|
|
scraper.get_compatible_browser()
|
|
|
|
|
|
class TestWebScrolling:
|
|
"""Test scrolling helpers."""
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_scroll_page_down_scrolls_and_returns(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""web_scroll_page_down should scroll both directions when requested."""
|
|
scripts:list[str] = []
|
|
|
|
async def exec_side_effect(script:str) -> int | None:
|
|
scripts.append(script)
|
|
if script == "document.body.scrollHeight":
|
|
return 20
|
|
return None
|
|
|
|
cast(Any, web_scraper).web_execute = AsyncMock(side_effect = exec_side_effect)
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.asyncio.sleep", new_callable = AsyncMock) as mock_sleep:
|
|
await web_scraper.web_scroll_page_down(scroll_length = 10, scroll_speed = 10, scroll_back_top = True)
|
|
|
|
assert scripts[0] == "document.body.scrollHeight"
|
|
# Expect four scrollTo operations: two down, two up
|
|
assert scripts.count("document.body.scrollHeight") == 1
|
|
scroll_calls = [script for script in scripts if script.startswith("window.scrollTo")]
|
|
assert scroll_calls == [
|
|
"window.scrollTo(0, 10)",
|
|
"window.scrollTo(0, 20)",
|
|
"window.scrollTo(0, 10)",
|
|
"window.scrollTo(0, 0)"
|
|
]
|
|
sleep_durations = [call.args[0] for call in mock_sleep.await_args_list]
|
|
assert sleep_durations == [1.0, 1.0, 0.5, 0.5]
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_session_expiration_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test handling of expired browser sessions."""
|
|
mock_browser.get.side_effect = Exception("Session expired")
|
|
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
with pytest.raises(Exception, match = "Session expired"):
|
|
await web_scraper.web_open("https://example.com")
|
|
# Do not assert browser/page are None, as production code does not clear them
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_multiple_session_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test handling of multiple browser sessions."""
|
|
mock_page1 = TrulyAwaitableMockPage()
|
|
mock_browser.get.return_value = mock_page1
|
|
mock_browser._process_pid = 12345
|
|
# Patch stop as MagicMock to avoid RuntimeWarning
|
|
mock_browser.stop = MagicMock()
|
|
await web_scraper.web_open("https://example1.com")
|
|
assert web_scraper.page == mock_page1
|
|
# Patch psutil.Process to avoid NoSuchProcess error
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_child = MagicMock()
|
|
mock_child.is_running.return_value = True
|
|
mock_proc.return_value.children.return_value = [mock_child]
|
|
web_scraper.close_browser_session()
|
|
assert web_scraper.browser is None
|
|
assert web_scraper.page is None
|
|
# Re-assign browser for new session
|
|
web_scraper.browser = mock_browser
|
|
mock_page2 = TrulyAwaitableMockPage()
|
|
mock_browser.get.return_value = mock_page2
|
|
mock_browser._process_pid = 12346
|
|
await web_scraper.web_open("https://example2.com")
|
|
assert web_scraper.page == mock_page2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_crash_recovery(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test recovery from browser crash."""
|
|
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
web_scraper.browser = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
# Reassign the mock browser before setting up the side effect
|
|
web_scraper.browser = mock_browser
|
|
mock_browser.get.side_effect = Exception("Browser crashed")
|
|
with pytest.raises(Exception, match = "Browser crashed"):
|
|
await web_scraper.web_open("https://example.com")
|
|
# Do not assert browser/page are None, as production code does not clear them
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get.side_effect = None
|
|
mock_browser.get.return_value = mock_page
|
|
await web_scraper.web_open("https://example.com")
|
|
assert web_scraper.page == mock_page
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_await_custom_condition_success(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_await returns when custom condition is met."""
|
|
call_count = {"count": 0}
|
|
|
|
async def condition() -> bool:
|
|
call_count["count"] += 1
|
|
return call_count["count"] >= 3
|
|
|
|
result:bool = await web_scraper.web_await(condition, timeout = 1)
|
|
assert result is True
|
|
assert call_count["count"] >= 3
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_await_custom_condition_timeout(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_await raises TimeoutError if condition is never met."""
|
|
|
|
async def condition() -> bool:
|
|
return False
|
|
|
|
with pytest.raises(TimeoutError):
|
|
await web_scraper.web_await(condition, timeout = 0.05)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_retry_mechanism(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test web_find retries until element is found within timeout."""
|
|
call_count = {"count": 0}
|
|
|
|
async def query_selector(*args:object, **kwargs:object) -> AsyncMock | None:
|
|
call_count["count"] += 1
|
|
if call_count["count"] == 3:
|
|
return AsyncMock(spec = Element)
|
|
return None
|
|
|
|
mock_page.query_selector.side_effect = query_selector
|
|
result = await web_scraper.web_find(By.ID, "test-id", timeout = 0.2)
|
|
assert result is not None
|
|
assert call_count["count"] >= 3
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_element_state_change(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test web_check detects element state change (e.g., becomes visible)."""
|
|
call_count = {"count": 0}
|
|
|
|
async def query_selector(*args:object, **kwargs:object) -> AsyncMock | None:
|
|
call_count["count"] += 1
|
|
if call_count["count"] == 2:
|
|
element = AsyncMock(spec = Element)
|
|
element.attrs = {}
|
|
|
|
async def apply_fn(*a:object, **kw:object) -> bool:
|
|
return True
|
|
|
|
element.apply = AsyncMock(side_effect = apply_fn)
|
|
return element
|
|
return None
|
|
|
|
mock_page.query_selector.side_effect = query_selector
|
|
result = await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED, timeout = 1.0)
|
|
assert result is True
|
|
assert call_count["count"] >= 2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_timeout_configuration(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test web_find respects timeout configuration and raises TimeoutError."""
|
|
mock_page.query_selector.return_value = None
|
|
with pytest.raises(TimeoutError):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.05)
|
|
|
|
|
|
class TestWebScrapingBrowserConfiguration:
|
|
"""Test browser configuration in WebScrapingMixin."""
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_binary_location_detection(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser binary location detection on different platforms."""
|
|
scraper = WebScrapingMixin()
|
|
|
|
# Test Linux
|
|
monkeypatch.setattr(platform, "system", lambda: "Linux")
|
|
monkeypatch.setattr(shutil, "which", lambda x: "/usr/bin/chrome" if x == "google-chrome" else None)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chrome")
|
|
assert scraper.get_compatible_browser() == "/usr/bin/chrome"
|
|
|
|
# Test macOS
|
|
monkeypatch.setattr(platform, "system", lambda: "Darwin")
|
|
mac_path = "/Applications/Google Chrome.app/Contents/MacOS/Google Chrome"
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == mac_path)
|
|
assert scraper.get_compatible_browser() == mac_path
|
|
|
|
# Test Windows
|
|
monkeypatch.setattr(platform, "system", lambda: "Windows")
|
|
win_path = "C:\\Program Files\\Chrome\\Application\\chrome.exe"
|
|
# Mock os.environ to include PROGRAMFILES and PROGRAMFILES(X86) and LOCALAPPDATA
|
|
monkeypatch.setenv("PROGRAMFILES", "C:\\Program Files")
|
|
monkeypatch.setenv("PROGRAMFILES(X86)", "C:\\Program Files (x86)")
|
|
monkeypatch.setenv("LOCALAPPDATA", "C:\\Users\\TestUser\\AppData\\Local")
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == win_path)
|
|
assert scraper.get_compatible_browser() == win_path
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_profile_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser profile configuration and preferences handling."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = [] # Add private extensions list
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext) # Use private extensions list
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock Config class
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
|
|
# Mock os.path.exists to return True for the browser binary and use real exists for Preferences file (and Edge)
|
|
edge_path = "/Applications/Microsoft Edge.app/Contents/MacOS/Microsoft Edge"
|
|
chrome_path = "/Applications/Google Chrome.app/Contents/MacOS/Google Chrome"
|
|
real_exists = os.path.exists
|
|
|
|
def mock_exists_sync(path:str) -> bool:
|
|
# Handle all browser paths
|
|
if path in {
|
|
# Linux paths
|
|
"/usr/bin/chromium",
|
|
"/usr/bin/chromium-browser",
|
|
"/usr/bin/google-chrome",
|
|
"/usr/bin/microsoft-edge",
|
|
"/usr/bin/chrome",
|
|
# macOS paths
|
|
edge_path,
|
|
chrome_path,
|
|
# Windows paths
|
|
"C:\\Users\\runneradmin\\AppData\\Local\\Google\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Program Files\\Google\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Program Files (x86)\\Google\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Users\\runneradmin\\AppData\\Local\\Microsoft\\Edge\\Application\\msedge.exe",
|
|
"C:\\Program Files\\Microsoft\\Edge\\Application\\msedge.exe",
|
|
"C:\\Program Files (x86)\\Microsoft\\Edge\\Application\\msedge.exe",
|
|
"C:\\Program Files\\Chromium\\Application\\chrome.exe",
|
|
"C:\\Program Files (x86)\\Chromium\\Application\\chrome.exe",
|
|
"C:\\Users\\runneradmin\\AppData\\Local\\Chromium\\Application\\chrome.exe",
|
|
"C:\\Program Files\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Program Files (x86)\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Users\\runneradmin\\AppData\\Local\\Chrome\\Application\\chrome.exe"
|
|
}:
|
|
return True
|
|
if "Preferences" in str(path) and str(tmp_path) in str(path):
|
|
return real_exists(path)
|
|
return False
|
|
|
|
async def mock_exists_async(path:str | Path) -> bool:
|
|
return mock_exists_sync(str(path))
|
|
|
|
monkeypatch.setattr(os.path, "exists", mock_exists_sync)
|
|
monkeypatch.setattr(files, "exists", mock_exists_async)
|
|
|
|
# Create test profile directory
|
|
profile_dir = tmp_path / "Default"
|
|
profile_dir.mkdir()
|
|
prefs_file = profile_dir / "Preferences"
|
|
|
|
# Test with existing preferences file
|
|
prefs_file.write_text(json.dumps({"existing": "prefs"}), encoding = "UTF-8")
|
|
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify preferences file was not overwritten
|
|
prefs = json.loads(prefs_file.read_text(encoding = "UTF-8"))
|
|
assert prefs["existing"] == "prefs"
|
|
|
|
# Test with missing preferences file
|
|
prefs_file.unlink()
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify new preferences file was created with correct settings
|
|
prefs = json.loads(prefs_file.read_text(encoding = "UTF-8"))
|
|
assert prefs["credentials_enable_service"] is False
|
|
assert prefs["enable_do_not_track"] is True
|
|
assert prefs["profile"]["password_manager_enabled"] is False
|
|
assert prefs["signin"]["allowed"] is False
|
|
assert "www.kleinanzeigen.de" in prefs["translate_site_blacklist"]
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_arguments_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser arguments configuration."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self.extensions.append(ext)
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock Config class
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
|
|
# Mock os.path.exists to return True for both Chrome and Edge paths
|
|
monkeypatch.setattr(os.path, "exists", lambda p: p in {"/usr/bin/chrome", "/usr/bin/edge"})
|
|
|
|
async def mock_exists_async(path:str | Path) -> bool:
|
|
return str(path) in {"/usr/bin/chrome", "/usr/bin/edge"}
|
|
monkeypatch.setattr(files, "exists", mock_exists_async)
|
|
|
|
# Test with custom arguments
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.arguments = ["--custom-arg=value", "--another-arg"]
|
|
scraper.browser_config.use_private_window = True
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify browser arguments
|
|
config = _nodriver_start_mock().call_args[0][0]
|
|
assert "--custom-arg=value" in config.browser_args
|
|
assert "--another-arg" in config.browser_args
|
|
assert "--incognito" in config.browser_args
|
|
assert "--disable-crash-reporter" in config.browser_args
|
|
assert "--disable-domain-reliability" in config.browser_args
|
|
|
|
# Test with Edge browser
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.binary_location = "/usr/bin/edge"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify Edge-specific arguments
|
|
config = _nodriver_start_mock().call_args[0][0]
|
|
assert "-inprivate" in config.browser_args
|
|
assert os.environ.get("MSEDGEDRIVER_TELEMETRY_OPTOUT") == "1"
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_extension_loading(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser extension loading."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = [] # Add private extensions list
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext) # Use private extensions list
|
|
|
|
# Create test extension files
|
|
ext1 = tmp_path / "ext1.crx"
|
|
ext2 = tmp_path / "ext2.crx"
|
|
|
|
# Create proper CRX files (which are ZIP files)
|
|
with zipfile.ZipFile(ext1, "w") as z:
|
|
z.writestr("manifest.json", '{"name": "Test Extension 1"}')
|
|
with zipfile.ZipFile(ext2, "w") as z:
|
|
z.writestr("manifest.json", '{"name": "Test Extension 2"}')
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock Config class
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
|
|
# Mock files.exists and files.is_dir to return appropriate values
|
|
async def mock_exists(path:str | Path) -> bool:
|
|
path_str = str(path)
|
|
# Resolve real paths to handle symlinks (e.g., /var -> /private/var on macOS)
|
|
real_path = str(Path(path_str).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext1 = str(Path(ext1).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext2 = str(Path(ext2).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
return path_str in {"/usr/bin/chrome", "/usr/bin/edge"} or real_path in {real_ext1, real_ext2} or os.path.exists(path_str) # noqa: ASYNC240
|
|
|
|
async def mock_is_dir(path:str | Path) -> bool:
|
|
path_str = str(path)
|
|
# Resolve real paths to handle symlinks
|
|
real_path = str(Path(path_str).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext1 = str(Path(ext1).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext2 = str(Path(ext2).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
# Nodriver extracts CRX files to temp directories, so they appear as directories
|
|
if real_path in {real_ext1, real_ext2}:
|
|
return True
|
|
return Path(path_str).is_dir() # noqa: ASYNC240 Test mock, runs synchronously
|
|
|
|
monkeypatch.setattr(files, "exists", mock_exists)
|
|
monkeypatch.setattr(files, "is_dir", mock_is_dir)
|
|
|
|
# Test extension loading
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.extensions = [str(ext1), str(ext2)]
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify extensions were loaded
|
|
config = _nodriver_start_mock().call_args[0][0]
|
|
assert len(config._extensions) == 2
|
|
for ext_path in config._extensions:
|
|
assert await files.exists(ext_path)
|
|
assert await files.is_dir(ext_path)
|
|
|
|
# Test with non-existent extension
|
|
scraper.browser_config.extensions = ["non_existent.crx"]
|
|
with pytest.raises(AssertionError):
|
|
await scraper.create_browser_session()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_binary_location_detection_edge_cases(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser binary location detection edge cases."""
|
|
scraper = WebScrapingMixin()
|
|
|
|
# Test Linux with multiple browser options
|
|
def which_mock(x:str) -> str | None:
|
|
return {
|
|
"chromium": "/usr/bin/chromium",
|
|
"chromium-browser": None,
|
|
"google-chrome": None,
|
|
"microsoft-edge": None
|
|
}.get(x)
|
|
monkeypatch.setattr(platform, "system", lambda: "Linux")
|
|
monkeypatch.setattr(shutil, "which", which_mock)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chromium")
|
|
assert scraper.get_compatible_browser() == "/usr/bin/chromium"
|
|
|
|
# Test Linux with no browsers found
|
|
monkeypatch.setattr(shutil, "which", lambda x: None)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: False)
|
|
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
|
|
scraper.get_compatible_browser()
|
|
|
|
# Test Windows with environment variables not set
|
|
monkeypatch.setattr(platform, "system", lambda: "Windows")
|
|
monkeypatch.setenv("PROGRAMFILES", "C:\\Program Files")
|
|
monkeypatch.setenv("PROGRAMFILES(X86)", "C:\\Program Files (x86)")
|
|
monkeypatch.setenv("LOCALAPPDATA", "C:\\Users\\TestUser\\AppData\\Local")
|
|
|
|
local_chrome_path = "C:\\Users\\TestUser\\AppData\\Local\\Google\\Chrome\\Application\\chrome.exe"
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == local_chrome_path)
|
|
assert scraper.get_compatible_browser() == local_chrome_path
|
|
|
|
local_edge_path = "C:\\Users\\TestUser\\AppData\\Local\\Microsoft\\Edge\\Application\\msedge.exe"
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == local_edge_path)
|
|
assert scraper.get_compatible_browser() == local_edge_path
|
|
|
|
local_chromium_path = "C:\\Users\\TestUser\\AppData\\Local\\Chromium\\Application\\chrome.exe"
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == local_chromium_path)
|
|
assert scraper.get_compatible_browser() == local_chromium_path
|
|
|
|
monkeypatch.delenv("LOCALAPPDATA", raising = False)
|
|
monkeypatch.setenv("USERPROFILE", "C:\\Users\\FallbackUser")
|
|
fallback_local_chrome_path = "C:\\Users\\FallbackUser\\AppData\\Local\\Google\\Chrome\\Application\\chrome.exe"
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == fallback_local_chrome_path)
|
|
assert scraper.get_compatible_browser() == fallback_local_chrome_path
|
|
|
|
monkeypatch.delenv("PROGRAMFILES", raising = False)
|
|
monkeypatch.delenv("PROGRAMFILES(X86)", raising = False)
|
|
monkeypatch.delenv("LOCALAPPDATA", raising = False)
|
|
monkeypatch.delenv("USERPROFILE", raising = False)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: False)
|
|
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
|
|
scraper.get_compatible_browser()
|
|
|
|
# Test macOS with non-existent paths
|
|
monkeypatch.setattr(platform, "system", lambda: "Darwin")
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: False)
|
|
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
|
|
scraper.get_compatible_browser()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_session_state_persistence(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test that session state persists across browser restarts when user_data_dir is set."""
|
|
# DummyConfig to simulate browser config
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = []
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext)
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
monkeypatch.setattr(os.path, "exists", lambda p: True)
|
|
|
|
# Simulate state file in user_data_dir
|
|
state_file = tmp_path / "Default" / "state.json"
|
|
state_file.parent.mkdir(parents = True, exist_ok = True)
|
|
|
|
# First session: write state
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
await scraper.create_browser_session()
|
|
state_file.write_text('{"foo": "bar"}', encoding = "utf-8")
|
|
scraper.browser._process_pid = 12345
|
|
scraper.browser.stop = MagicMock()
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper.close_browser_session()
|
|
|
|
# Second session: read state
|
|
scraper2 = WebScrapingMixin()
|
|
scraper2.browser_config.user_data_dir = str(tmp_path)
|
|
scraper2.browser_config.profile_name = "Default"
|
|
await scraper2.create_browser_session()
|
|
data = state_file.read_text(encoding = "utf-8")
|
|
assert data == '{"foo": "bar"}'
|
|
scraper2.browser._process_pid = 12346
|
|
scraper2.browser.stop = MagicMock()
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper2.close_browser_session()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_session_creation_error_cleanup(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test that resources are cleaned up when session creation fails."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = []
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext)
|
|
|
|
# Create a temporary file before the test
|
|
temp_file = tmp_path / "temp_resource"
|
|
temp_file.write_text("test")
|
|
|
|
# Mock nodriver.start to raise an exception
|
|
async def mock_start_fail(*args:object, **kwargs:object) -> NoReturn:
|
|
if temp_file.exists():
|
|
temp_file.unlink()
|
|
raise Exception("Session creation failed")
|
|
|
|
def make_mock_browser() -> AsyncMock:
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
mock_browser._process_pid = 12345
|
|
mock_browser.stop = MagicMock()
|
|
return mock_browser
|
|
|
|
monkeypatch.setattr(nodriver, "start", mock_start_fail)
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
# Don't mock os.path.exists globally - let the file operations work normally
|
|
|
|
# Attempt to create a session
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
|
|
with pytest.raises(Exception, match = "Session creation failed"):
|
|
await scraper.create_browser_session() # type: ignore[unused-ignore,reportGeneralTypeIssues] # Awaiting a function that always raises
|
|
|
|
assert not (tmp_path / "temp_resource").exists()
|
|
assert scraper.browser is None
|
|
assert scraper.page is None
|
|
|
|
# Now patch nodriver.start to return a new mock browser each time
|
|
mock_browser = make_mock_browser()
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get = AsyncMock(return_value = mock_page)
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock create_browser_session to ensure proper setup
|
|
async def mock_create_session(self:WebScrapingMixin) -> None:
|
|
self.browser = mock_browser
|
|
self.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
|
|
|
|
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session)
|
|
await scraper.create_browser_session() # type: ignore[unused-ignore,reportGeneralTypeIssues] # Awaiting a function that always raises
|
|
print("[DEBUG] scraper.page after session creation:", scraper.page)
|
|
assert scraper.browser is not None
|
|
assert scraper.page is not None
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_external_process_termination(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test handling of external browser process termination."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = []
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext)
|
|
|
|
def make_mock_browser() -> AsyncMock:
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
mock_browser._process_pid = 12345
|
|
mock_browser.stop = MagicMock()
|
|
return mock_browser
|
|
|
|
mock_browser = make_mock_browser()
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get = AsyncMock(return_value = mock_page)
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
monkeypatch.setattr(os.path, "exists", lambda p: True)
|
|
|
|
# Mock create_browser_session to ensure proper setup
|
|
async def mock_create_session(self:WebScrapingMixin) -> None:
|
|
self.browser = mock_browser
|
|
self.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
|
|
|
|
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session)
|
|
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
await scraper.create_browser_session()
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.side_effect = psutil.NoSuchProcess(12345)
|
|
with pytest.raises(psutil.NoSuchProcess):
|
|
scraper.close_browser_session()
|
|
|
|
# Create a new mock browser for the second session
|
|
mock_browser2 = make_mock_browser()
|
|
mock_browser2._process_pid = 12346
|
|
mock_page2 = TrulyAwaitableMockPage()
|
|
mock_browser2.get = AsyncMock(return_value = mock_page2)
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser2))
|
|
|
|
# Update mock_create_session for the second session
|
|
async def mock_create_session2(self:WebScrapingMixin) -> None:
|
|
self.browser = mock_browser2
|
|
self.page = mock_page2 # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
|
|
|
|
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session2)
|
|
await scraper.create_browser_session()
|
|
print("[DEBUG] scraper.page after session creation:", scraper.page)
|
|
assert scraper.browser is not None
|
|
assert scraper.page is not None
|
|
|
|
def test_diagnose_browser_issues(self, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test that diagnose_browser_issues provides expected diagnostic output."""
|
|
# Configure logging to capture output
|
|
caplog.set_level(loggers.INFO)
|
|
|
|
# Create a WebScrapingMixin instance
|
|
mixin = WebScrapingMixin()
|
|
|
|
# Call the diagnose method
|
|
mixin.diagnose_browser_issues()
|
|
|
|
# Check that diagnostic output was produced
|
|
log_output = caplog.text.lower()
|
|
assert "browser connection diagnostics" in log_output or "browser-verbindungsdiagnose" in log_output
|
|
assert "end diagnostics" in log_output or "ende der diagnose" in log_output
|
|
|
|
|
|
class TestWebScrapingDiagnostics:
|
|
"""Test the diagnose_browser_issues method."""
|
|
|
|
@pytest.fixture
|
|
def scraper_with_config(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with browser config."""
|
|
scraper = WebScrapingMixin()
|
|
return scraper
|
|
|
|
def test_diagnose_browser_issues_binary_exists_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser binary exists and is executable."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
|
|
assert "(ok) Browser binary is executable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_binary_exists_not_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser binary exists but is not executable."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
|
|
assert "(fail) Browser binary is not executable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_binary_not_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser binary is not found."""
|
|
with patch("os.path.exists", return_value = False):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Browser binary not found: /usr/bin/chrome" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_auto_detect_success(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when auto-detecting browser succeeds."""
|
|
with patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.binary_location = None
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(ok) Auto-detected browser: /usr/bin/chrome" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_auto_detect_failure(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when auto-detecting browser fails."""
|
|
with patch.object(scraper_with_config, "get_compatible_browser", side_effect = AssertionError("No browser found")):
|
|
scraper_with_config.browser_config.binary_location = None
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) No compatible browser found" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_exists_readable(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory exists and is readable/writable."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
|
|
assert "(ok) User data directory is readable and writable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_exists_not_readable(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory exists but is not readable/writable."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
|
|
assert "(fail) User data directory permissions issue" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_not_exists(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory does not exist."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", side_effect = lambda path: path != test_dir), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert f"(info) User data directory does not exist (will be created): {test_dir}" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_configured_open(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is configured and open."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen:
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_configured_open_api_fails(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is open but API is not accessible."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen", side_effect = Exception("Connection refused")):
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
assert "(fail) Remote debugging port is open but API not accessible: Connection refused" in caplog.text
|
|
assert "This might indicate a browser update issue or configuration problem" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_configured_closed(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is configured but closed."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False):
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(info) Remote debugging port is not open" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_not_configured(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is not configured."""
|
|
scraper_with_config.browser_config.arguments = ["--other-arg"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should not log anything about remote debugging port
|
|
assert "Remote debugging port" not in caplog.text
|
|
|
|
def test_diagnose_browser_issues_browser_processes_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser processes are found.
|
|
Updated to test target browser detection with debugging status.
|
|
"""
|
|
mock_processes = [
|
|
Mock(info = {"pid": 1234, "name": "chrome", "cmdline": ["/usr/bin/chrome"]}),
|
|
Mock(info = {"pid": 5678, "name": "chromium", "cmdline": ["/usr/bin/chromium"]}),
|
|
Mock(info = {"pid": 9012, "name": "edge", "cmdline": ["/usr/bin/edge"]}),
|
|
Mock(info = {"pid": 3456, "name": "chrome", "cmdline": ["/usr/bin/chrome", "--remote-debugging-port=9222"]})
|
|
]
|
|
|
|
with patch("psutil.process_iter", return_value = mock_processes), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should find 2 chrome processes (target browser), one with debugging, one without
|
|
assert "(info) Found 2 browser processes running" in caplog.text
|
|
assert " - PID 1234: chrome (remote debugging NOT enabled)" in caplog.text
|
|
assert " - PID 3456: chrome (remote debugging enabled)" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_no_browser_processes(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when no browser processes are found."""
|
|
with patch("psutil.process_iter", return_value = []):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
|
|
@patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info")
|
|
def test_diagnose_browser_issues_macos_platform_with_user_data_dir(
|
|
self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic on macOS platform with user data directory."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
|
|
# Setup mock for Chrome 136+ detection with valid configuration
|
|
mock_get_diagnostic.return_value = {
|
|
"binary_detection": None,
|
|
"remote_detection": {
|
|
"version_string": "136.0.6778.0",
|
|
"major_version": 136,
|
|
"browser_name": "Chrome",
|
|
"is_chrome_136_plus": True
|
|
},
|
|
"chrome_136_plus_detected": True,
|
|
"recommendations": []
|
|
}
|
|
|
|
# Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run
|
|
original_env = os.environ.get("PYTEST_CURRENT_TEST")
|
|
if "PYTEST_CURRENT_TEST" in os.environ:
|
|
del os.environ["PYTEST_CURRENT_TEST"]
|
|
|
|
try:
|
|
with patch("platform.system", return_value = "Darwin"), \
|
|
patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
|
|
# Mock Chrome 136+ detection from remote debugging
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should validate Chrome 136+ configuration and pass
|
|
assert "(info) Remote Chrome 136+ detected - validating configuration" in caplog.text
|
|
assert "(ok) Chrome 136+ configuration validation passed" in caplog.text
|
|
finally:
|
|
# Restore environment variable
|
|
if original_env is not None:
|
|
os.environ["PYTEST_CURRENT_TEST"] = original_env
|
|
|
|
def test_diagnose_browser_issues_linux_platform_not_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic on Linux platform when not running as root."""
|
|
with patch("platform.system", return_value = "Linux"), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Linux platform detection was removed - no specific message expected
|
|
assert "Linux detected" not in caplog.text
|
|
# Should not show error about running as root
|
|
assert "(fail) Running as root" not in caplog.text
|
|
|
|
def test_diagnose_browser_issues_linux_platform_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic on Linux platform when running as root."""
|
|
with patch("platform.system", return_value = "Linux"), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Linux platform detection was removed - no specific message expected
|
|
assert "Linux detected" not in caplog.text
|
|
assert "(fail) Running as root - this can cause browser issues" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_unknown_platform(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic on unknown platform."""
|
|
with patch("platform.system", return_value = "UnknownOS"), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should not show any platform-specific messages
|
|
assert "Windows detected" not in caplog.text
|
|
assert "macOS detected" not in caplog.text
|
|
assert "Linux detected" not in caplog.text
|
|
|
|
def test_diagnose_browser_issues_macos_remote_debugging_instructions(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic shows macOS-specific remote debugging instructions."""
|
|
with patch("platform.system", return_value = "Darwin"), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
@patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info")
|
|
def test_diagnose_browser_issues_chrome_136_plus_misconfigured(
|
|
self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when Chrome 136+ is detected but user data directory is not configured."""
|
|
# Setup mock for Chrome 136+ detection with invalid configuration
|
|
mock_get_diagnostic.return_value = {
|
|
"binary_detection": None,
|
|
"remote_detection": {
|
|
"version_string": "136.0.6778.0",
|
|
"major_version": 136,
|
|
"browser_name": "Chrome",
|
|
"is_chrome_136_plus": True
|
|
},
|
|
"chrome_136_plus_detected": True,
|
|
"recommendations": []
|
|
}
|
|
|
|
# Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run
|
|
original_env = os.environ.get("PYTEST_CURRENT_TEST")
|
|
if "PYTEST_CURRENT_TEST" in os.environ:
|
|
del os.environ["PYTEST_CURRENT_TEST"]
|
|
|
|
try:
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
|
|
# Mock Chrome 136+ detection from remote debugging
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
# Configure remote debugging but NO user data directory
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.browser_config.user_data_dir = None
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should detect Chrome 136+ and show configuration error
|
|
assert "(info) Remote Chrome 136+ detected - validating configuration" in caplog.text
|
|
assert "(fail) Chrome 136+ configuration validation failed" in caplog.text
|
|
assert "Chrome/Edge 136+ requires --user-data-dir to be specified" in caplog.text
|
|
assert "Solution: Add --user-data-dir=/path/to/directory to browser arguments" in caplog.text
|
|
finally:
|
|
# Restore environment variable
|
|
if original_env is not None:
|
|
os.environ["PYTEST_CURRENT_TEST"] = original_env
|
|
|
|
def test_diagnose_browser_issues_complete_diagnostic_flow(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test complete diagnostic flow with all components."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False):
|
|
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Check that all diagnostic sections are present
|
|
assert "=== Browser Connection Diagnostics ===" in caplog.text
|
|
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
|
|
assert "(ok) Browser binary is executable" in caplog.text
|
|
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
|
|
assert "(ok) User data directory is readable and writable" in caplog.text
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
# Linux platform detection was removed - no specific message expected
|
|
assert "Linux detected" not in caplog.text
|
|
assert "=== End Diagnostics ===" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_host_configured(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when remote debugging host is configured."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.arguments = [
|
|
"--remote-debugging-host=192.168.1.100",
|
|
"--remote-debugging-port=9222"
|
|
]
|
|
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_process_info_missing_name(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when process info is missing name."""
|
|
mock_process = Mock()
|
|
mock_process.info = {"pid": 1234, "name": None, "cmdline": []}
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = [mock_process]), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_psutil_exception_handling(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when psutil raises an exception during process iteration."""
|
|
# Mock psutil.process_iter to return a list that will cause an exception when accessing proc.info
|
|
mock_process = Mock()
|
|
mock_process.info = {"name": "chrome"}
|
|
mock_processes = [mock_process]
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = mock_processes), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch.object(mock_process, "info", side_effect = psutil.AccessDenied):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should handle the exception gracefully and continue
|
|
assert "=== Browser Connection Diagnostics ===" in caplog.text
|
|
assert "=== End Diagnostics ===" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_browser_not_executable(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when browser binary exists but is not executable."""
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("psutil.process_iter", return_value = []):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Browser binary is not executable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_browser_not_found(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when browser binary does not exist."""
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
with patch("os.path.exists", return_value = False), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("psutil.process_iter", return_value = []):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Browser binary not found:" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_no_browser_auto_detection(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when no browser binary is configured and auto-detection fails."""
|
|
scraper_with_config.browser_config.binary_location = None
|
|
with patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", side_effect = AssertionError("No browser found")):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
assert "(fail) No compatible browser found" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_permissions_issue(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory has permission issues."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) User data directory permissions issue" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_api_inaccessible(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when remote debugging port is open but API is not accessible."""
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen", side_effect = Exception("Connection refused")), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Remote debugging port is open but API not accessible" in caplog.text
|
|
assert "This might indicate a browser update issue or configuration problem" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_macos_chrome_warning(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when macOS Chrome remote debugging is configured without user_data_dir."""
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.browser_config.user_data_dir = None
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \
|
|
patch("platform.system", return_value = "Darwin"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
def test_diagnose_browser_issues_linux_root_user(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when running as root on Linux."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Running as root - this can cause browser issues" in caplog.text
|
|
|
|
def test_is_admin_on_windows_system(self) -> None:
|
|
"""Test _is_admin function on Windows system."""
|
|
# Create a mock os module without geteuid
|
|
mock_os = Mock()
|
|
# Remove geteuid attribute to simulate Windows
|
|
del mock_os.geteuid
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is False
|
|
|
|
def test_diagnose_browser_issues_psutil_exceptions(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test diagnose_browser_issues handles psutil exceptions gracefully."""
|
|
# Mock psutil.process_iter to return a list that will cause exceptions when accessing proc.info
|
|
mock_process1 = Mock()
|
|
mock_process1.info = {"name": "chrome"}
|
|
mock_process2 = Mock()
|
|
mock_process2.info = {"name": "edge"}
|
|
mock_processes = [mock_process1, mock_process2]
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = mock_processes), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._diagnose_chrome_version_issues"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \
|
|
patch.object(web_scraper, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch.object(mock_process1, "info", side_effect = psutil.NoSuchProcess(pid = 123)), \
|
|
patch.object(mock_process2, "info", side_effect = psutil.AccessDenied(pid = 456)):
|
|
# Should not raise any exceptions
|
|
web_scraper.diagnose_browser_issues()
|
|
|
|
def test_diagnose_browser_issues_handles_per_process_errors(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""diagnose_browser_issues should ignore psutil errors raised per process."""
|
|
caplog.set_level(logging.INFO)
|
|
|
|
class FailingProcess:
|
|
|
|
@property
|
|
def info(self) -> dict[str, object]:
|
|
raise psutil.AccessDenied(pid = 999)
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = [FailingProcess()]), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_handles_global_psutil_failure(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""diagnose_browser_issues should log a warning if psutil.process_iter fails entirely."""
|
|
caplog.set_level(logging.WARNING)
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", side_effect = psutil.Error("boom")), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(warn) Unable to inspect browser processes:" in caplog.text
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_validate_chrome_version_configuration_port_open_but_api_inaccessible(
|
|
self, web_scraper:WebScrapingMixin
|
|
) -> None:
|
|
"""Test _validate_chrome_version_configuration when port is open but API is inaccessible."""
|
|
# Configure remote debugging
|
|
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
|
|
with patch.dict("os.environ", {}, clear = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
|
|
|
|
# Should not raise any exceptions and should log the appropriate debug message
|
|
await web_scraper._validate_chrome_version_configuration()
|
|
|
|
# Verify the debug message was logged
|
|
mock_log.debug.assert_any_call(" -> Port is open but remote debugging API not accessible")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_validate_chrome_version_configuration_remote_detection_exception(
|
|
self, web_scraper:WebScrapingMixin
|
|
) -> None:
|
|
"""Test _validate_chrome_version_configuration when remote detection raises exception."""
|
|
# Configure remote debugging
|
|
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
|
|
with patch.dict("os.environ", {}, clear = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", side_effect = Exception("Test exception")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
|
|
|
|
# Should not raise any exceptions and should log the appropriate debug message
|
|
await web_scraper._validate_chrome_version_configuration()
|
|
|
|
# Verify the debug message was logged
|
|
# Check that the debug method was called with the expected message
|
|
debug_calls = [call for call in mock_log.debug.call_args_list if "Failed to detect version from existing browser" in str(call)]
|
|
assert len(debug_calls) > 0, "Expected debug message not found"
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_validate_chrome_version_configuration_no_existing_browser(
|
|
self, web_scraper:WebScrapingMixin
|
|
) -> None:
|
|
"""Test _validate_chrome_version_configuration when no existing browser is found."""
|
|
# Configure remote debugging
|
|
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
|
|
with patch.dict("os.environ", {}, clear = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = False), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
|
|
|
|
# Should not raise any exceptions and should log the appropriate debug message
|
|
await web_scraper._validate_chrome_version_configuration()
|
|
|
|
# Verify the debug message was logged
|
|
mock_log.debug.assert_any_call(" -> No existing browser found at %s:%s", "127.0.0.1", 9222)
|
|
|
|
|
|
class TestWebScrapingMixinPortRetry:
|
|
"""Test the _check_port_with_retry method."""
|
|
|
|
@pytest.fixture
|
|
def scraper_with_remote_config(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with remote debugging configuration."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
return scraper
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_connection_error_handling(
|
|
self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser connection fails."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to connect as root user")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Failed to connect as root user"):
|
|
await scraper_with_remote_config.create_browser_session()
|
|
|
|
# Check that the error handling was triggered
|
|
assert "Failed to connect to browser. This error often occurs when:" in caplog.text
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_connection_error_handling_non_root_error(
|
|
self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser connection fails with non-root error."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Connection timeout")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Connection timeout"):
|
|
await scraper_with_remote_config.create_browser_session()
|
|
|
|
# Should not trigger the root-specific error handling
|
|
assert "Failed to connect to browser. This error often occurs when:" not in caplog.text
|
|
|
|
@pytest.fixture
|
|
def scraper_with_startup_config(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance for testing browser startup (no remote debugging)."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
# No remote debugging port configured - will start new browser
|
|
return scraper
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_startup_error_handling_root_error(
|
|
self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser startup fails with root error."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to start as root user")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Failed to start as root user"):
|
|
await scraper_with_startup_config.create_browser_session()
|
|
|
|
# Check that the root-specific error handling was triggered
|
|
assert "Failed to start browser. This error often occurs when:" in caplog.text
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_startup_error_handling_non_root_error(
|
|
self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser startup fails with non-root error."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Browser binary not found")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Browser binary not found"):
|
|
await scraper_with_startup_config.create_browser_session()
|
|
|
|
# Should not trigger the root-specific error handling
|
|
assert "Failed to start browser. This error often occurs when:" not in caplog.text
|
|
|
|
@pytest.fixture
|
|
def scraper(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance."""
|
|
return WebScrapingMixin()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_success_first_try(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check succeeds on first try."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True):
|
|
result = await scraper._check_port_with_retry("127.0.0.1", 9222)
|
|
assert result is True
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_success_after_retries(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check succeeds after some retries."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", side_effect = [False, False, True]):
|
|
result = await scraper._check_port_with_retry("127.0.0.1", 9222, max_retries = 3, retry_delay = 0.1)
|
|
assert result is True
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_failure_after_max_retries(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check fails after max retries."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False):
|
|
result = await scraper._check_port_with_retry("127.0.0.1", 9222, max_retries = 2, retry_delay = 0.1)
|
|
assert result is False
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_custom_parameters(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check with custom retry parameters."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", side_effect = [False, True]):
|
|
result = await scraper._check_port_with_retry("192.168.1.100", 8080, max_retries = 5, retry_delay = 0.05)
|
|
assert result is True
|
|
|
|
|
|
class TestWebScrapingMixinProfileHandling:
|
|
"""Test the enhanced profile directory handling."""
|
|
|
|
@pytest.fixture
|
|
def scraper_with_profile_config(self, tmp_path:Path) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with profile configuration."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path / "test-profile")
|
|
scraper.browser_config.profile_name = "TestProfile"
|
|
return scraper
|
|
|
|
def test_profile_directory_creation_with_user_data_dir(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation when user_data_dir is configured."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.path.join", return_value = os.path.join(test_dir, "TestProfile")), \
|
|
patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()), \
|
|
patch("json.dump"):
|
|
|
|
# This would be called during browser session creation
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
mock_makedirs.assert_not_called() # Not called yet
|
|
|
|
# Simulate the profile creation logic
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
def test_profile_directory_creation_with_preferences_file(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation with preferences file when it doesn't exist."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()) as mock_file, \
|
|
patch("json.dump") as mock_json_dump:
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
prefs_file = os.path.join(profile_dir, "Preferences")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
# Simulate preferences file creation
|
|
with open(prefs_file, "w", encoding = "UTF-8") as fd:
|
|
json.dump({"test": "preferences"}, fd)
|
|
|
|
mock_file.assert_called_with(prefs_file, "w", encoding = "UTF-8")
|
|
mock_json_dump.assert_called()
|
|
|
|
def test_profile_directory_creation_with_existing_preferences_file(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation when preferences file already exists."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = True), \
|
|
patch("builtins.open", mock_open()) as mock_file, \
|
|
patch("json.dump") as mock_json_dump:
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
# Preferences file exists, so it should not be created
|
|
mock_file.assert_not_called()
|
|
mock_json_dump.assert_not_called()
|
|
|
|
def test_profile_directory_creation_with_edge_browser(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation with Edge browser configuration."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_profile_config.browser_config.binary_location = "/usr/bin/microsoft-edge"
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()), \
|
|
patch("json.dump"), \
|
|
patch("os.environ", {"MSEDGEDRIVER_TELEMETRY_OPTOUT": "1"}):
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
def test_profile_directory_creation_with_private_window(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation with private window configuration."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_profile_config.browser_config.use_private_window = True
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()), \
|
|
patch("json.dump"):
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
def test_profile_directory_creation_without_user_data_dir(
|
|
self, scraper_with_profile_config:WebScrapingMixin
|
|
) -> None:
|
|
"""Test profile directory handling when user_data_dir is not configured."""
|
|
scraper_with_profile_config.browser_config.user_data_dir = None
|
|
|
|
# Should not create profile directories when user_data_dir is None
|
|
with patch("os.path.join") as mock_join, \
|
|
patch("os.makedirs") as mock_makedirs:
|
|
|
|
# The profile creation logic should not be called
|
|
mock_join.assert_not_called()
|
|
mock_makedirs.assert_not_called()
|
|
|
|
|
|
class TestWebScrapingMixinAdminCheck:
|
|
"""Test the _is_admin helper function."""
|
|
|
|
def test_is_admin_on_unix_system(self) -> None:
|
|
"""Test _is_admin function on Unix-like system."""
|
|
# Create a mock os module with geteuid
|
|
mock_os = Mock()
|
|
mock_os.geteuid = Mock(return_value = 0)
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is True
|
|
|
|
def test_is_admin_on_unix_system_not_root(self) -> None:
|
|
"""Test _is_admin function on Unix-like system when not root."""
|
|
# Create a mock os module with geteuid
|
|
mock_os = Mock()
|
|
mock_os.geteuid = Mock(return_value = 1000)
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is False
|
|
|
|
def test_is_admin_on_windows_system(self) -> None:
|
|
"""Test _is_admin function on Windows system."""
|
|
# Create a mock os module without geteuid
|
|
mock_os = Mock()
|
|
# Remove geteuid attribute to simulate Windows
|
|
del mock_os.geteuid
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is False
|