mirror of
https://github.com/Second-Hand-Friends/kleinanzeigen-bot.git
synced 2026-03-12 10:31:50 +01:00
## ℹ️ Description Added Webselect-Function for Input/Dropdown Combobox PR for issue/missing feature #677 # Fixes / Enhancements Finding Special Attributes Elements can fail because they are currently only selected using the name="..." attributes of the HTML elements. If it fails, ALSO fallback-handle selecting special attribute HTML elements by ID instead / additionally. (For example the "brands" Input/Combobox for Mens Shoes... When trying to select a Value in a <select>, it does not only rely on the actual Option value (xxx in the example <options value="xxx">yyy</...>) but instead also on the displayed HTML value (i.e. yyy in above example). This improves UX because the User doesnt have to check the actual "value" of the Option but instead can check the displayed Value from the Browsers Display directly. Testcases for Webselect_Combobox were not added due to missing knowledge about Async Mocking properly. ## 📋 Changes Summary ✅ Fixes & Enhancements - New WebSelect Functionality - Improved Element Detection for Special Attributes - Enhanced <select> Option Matching Logic This improves UX and test robustness — users no longer need to know the exact underlying value, as matching also works with the visible label shown in the browser. 🧩 Result These updates make dropdown and combobox interactions more intuitive, resilient, and user-friendly across diverse HTML structures. ### ⚙️ Type of Change Select the type(s) of change(s) included in this pull request: - [x] 🐞 Bug fix (non-breaking change which fixes an issue) - [x] ✨ New feature (adds new functionality without breaking existing usage) - [ ] 💥 Breaking change (changes that might break existing user setups, scripts, or configurations) ## ✅ Checklist Before requesting a review, confirm the following: - [x] I have reviewed my changes to ensure they meet the project's standards. - [ ] I have tested my changes and ensured that all tests pass (`pdm run test`). - [x] I have formatted the code (`pdm run format`). - [x] I have verified that linting passes (`pdm run lint`). - [x] I have updated documentation where necessary. By submitting this pull request, I confirm that you can use, modify, copy, and redistribute this contribution, under the terms of your choice. <!-- This is an auto-generated comment: release notes by coderabbit.ai --> ## Summary by CodeRabbit * **Bug Fixes** * Field lookup now falls back to locating by ID when name lookup times out. * Option selection uses a two-pass match (value then displayed text); JS-path failures now surface as timeouts. * Error and log messages localized and clarified. * **New Features** * Support for combobox-style inputs: type into the input, open dropdown, and select by visible text (handles special characters). * **Tests** * Added tests for combobox selection, missing dropdowns, no-match errors, value-path selection, and special-character handling. <!-- end of auto-generated comment: release notes by coderabbit.ai --> --------- Co-authored-by: Jens <1742418+1cu@users.noreply.github.com> Co-authored-by: Claude <claude@anthropic.com>
2254 lines
113 KiB
Python
2254 lines
113 KiB
Python
# SPDX-FileCopyrightText: © Jens Bergmann and contributors
|
|
# SPDX-License-Identifier: AGPL-3.0-or-later
|
|
# SPDX-ArtifactOfProjectHomePage: https://github.com/Second-Hand-Friends/kleinanzeigen-bot/
|
|
"""Unit tests for web_scraping_mixin.py focusing on error handling scenarios.
|
|
|
|
Copyright (c) 2024, kleinanzeigen-bot contributors.
|
|
All rights reserved.
|
|
"""
|
|
|
|
import json
|
|
import logging
|
|
import os
|
|
import platform
|
|
import shutil
|
|
import zipfile
|
|
from collections.abc import Awaitable, Callable
|
|
from pathlib import Path
|
|
from typing import Any, NoReturn, Protocol, cast
|
|
from unittest.mock import AsyncMock, MagicMock, Mock, mock_open, patch
|
|
|
|
import nodriver
|
|
import psutil
|
|
import pytest
|
|
from nodriver.core.element import Element
|
|
from nodriver.core.tab import Tab as Page
|
|
|
|
from kleinanzeigen_bot.model.config_model import Config
|
|
from kleinanzeigen_bot.utils import files, loggers
|
|
from kleinanzeigen_bot.utils.web_scraping_mixin import By, Is, WebScrapingMixin, _is_admin # noqa: PLC2701
|
|
|
|
|
|
class ConfigProtocol(Protocol):
|
|
"""Protocol for Config objects used in tests."""
|
|
extensions:list[str]
|
|
browser_args:list[str]
|
|
user_data_dir:str | None
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
...
|
|
|
|
|
|
def _nodriver_start_mock() -> Mock:
|
|
"""Return the nodriver.start mock with proper typing."""
|
|
return cast(Mock, cast(Any, nodriver).start)
|
|
|
|
|
|
class TrulyAwaitableMockPage:
|
|
"""A helper to make a mock Page object truly awaitable for tests."""
|
|
|
|
def __init__(self) -> None:
|
|
self._mock = AsyncMock(spec = Page)
|
|
self.url = "https://example.com"
|
|
self.query_selector = AsyncMock()
|
|
self.evaluate = AsyncMock()
|
|
|
|
def __getattr__(self, item:str) -> object:
|
|
return getattr(self._mock, item)
|
|
|
|
def __await__(self) -> object:
|
|
async def _noop() -> "TrulyAwaitableMockPage":
|
|
return self
|
|
|
|
return _noop().__await__()
|
|
|
|
# Allow setting attributes on the mock
|
|
def __setattr__(self, key:str, value:object) -> None:
|
|
if key in {"_mock", "url", "query_selector", "evaluate"}:
|
|
object.__setattr__(self, key, value)
|
|
else:
|
|
setattr(self._mock, key, value)
|
|
|
|
|
|
@pytest.fixture
|
|
def mock_page() -> TrulyAwaitableMockPage:
|
|
"""Create a truly awaitable mock Page object."""
|
|
page = TrulyAwaitableMockPage()
|
|
return page
|
|
|
|
|
|
@pytest.fixture
|
|
def mock_browser() -> AsyncMock:
|
|
"""Create a mock Browser object."""
|
|
browser = AsyncMock()
|
|
browser.websocket_url = "ws://localhost:9222"
|
|
return browser
|
|
|
|
|
|
@pytest.fixture
|
|
def web_scraper(mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with mocked browser and page."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = mock_browser
|
|
scraper.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
scraper.config = Config.model_validate({"login": {"username": "user@example.com", "password": "secret"}}) # noqa: S105
|
|
return scraper
|
|
|
|
|
|
def test_write_initial_prefs(tmp_path:Path) -> None:
|
|
"""Test _write_initial_prefs helper function."""
|
|
from kleinanzeigen_bot.utils.web_scraping_mixin import _write_initial_prefs # noqa: PLC0415, PLC2701
|
|
|
|
prefs_file = tmp_path / "Preferences"
|
|
_write_initial_prefs(str(prefs_file))
|
|
|
|
# Verify file was created
|
|
assert prefs_file.exists()
|
|
|
|
# Verify content is valid JSON with expected structure
|
|
with open(prefs_file, encoding = "UTF-8") as f:
|
|
prefs = json.load(f)
|
|
|
|
assert prefs["credentials_enable_service"] is False
|
|
assert prefs["enable_do_not_track"] is True
|
|
assert prefs["google"]["services"]["consented_to_sync"] is False
|
|
assert prefs["profile"]["password_manager_enabled"] is False
|
|
assert prefs["profile"]["default_content_setting_values"]["notifications"] == 2
|
|
assert prefs["signin"]["allowed"] is False
|
|
assert "www.kleinanzeigen.de" in prefs["translate_site_blacklist"]
|
|
assert prefs["devtools"]["preferences"]["currentDockState"] == '"bottom"'
|
|
|
|
|
|
class TestWebScrapingErrorHandling:
|
|
"""Test error handling scenarios in WebScrapingMixin."""
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_timeout(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test timeout handling in web_find."""
|
|
# Mock page.query_selector to return None, simulating element not found
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test timeout for ID selector
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.1)
|
|
|
|
# Test timeout for class selector
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with CSS class 'test-class'"):
|
|
await web_scraper.web_find(By.CLASS_NAME, "test-class", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_network_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test network error handling in web_find."""
|
|
# Mock page.query_selector to raise a network error
|
|
mock_page.query_selector.side_effect = Exception("Network error")
|
|
|
|
# Test network error for ID selector
|
|
with pytest.raises(Exception, match = "Network error"):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_click_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not found error in web_click."""
|
|
# Mock page.query_selector to return None
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test element not found error
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_click(By.ID, "test-id", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_click_element_not_clickable(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not clickable error in web_click."""
|
|
# Create a mock element that raises an error on click
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.click.side_effect = Exception("Element not clickable")
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
# Test element not clickable error
|
|
with pytest.raises(Exception, match = "Element not clickable"):
|
|
await web_scraper.web_click(By.ID, "test-id")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_input_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not found error in web_input."""
|
|
# Mock page.query_selector to return None
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test element not found error
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_input(By.ID, "test-id", "test text", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_input_clear_failure(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test input clear failure in web_input."""
|
|
# Create a mock element that raises an error on clear_input
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.clear_input.side_effect = Exception("Cannot clear input")
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
# Test input clear failure
|
|
with pytest.raises(Exception, match = "Cannot clear input"):
|
|
await web_scraper.web_input(By.ID, "test-id", "test text")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_missing_dropdown_options(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection when aria-controls attribute is missing."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
web_scraper.web_find = AsyncMock(return_value = input_field) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
with pytest.raises(TimeoutError, match = "Combobox missing aria-controls attribute"):
|
|
await web_scraper.web_select_combobox(By.ID, "combo-id", "Option", timeout = 0.1)
|
|
|
|
input_field.clear_input.assert_awaited_once()
|
|
input_field.send_keys.assert_awaited_once_with("Option")
|
|
assert web_scraper.web_sleep.await_count == 1 # Only one sleep before checking aria-controls
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_selects_matching_option(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection matches a visible <li> option."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {"aria-controls": "dropdown-id"}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
|
|
dropdown_elem = AsyncMock(spec = Element)
|
|
dropdown_elem.apply = AsyncMock(return_value = True)
|
|
|
|
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
result = await web_scraper.web_select_combobox(By.ID, "combo-id", "Visible Label")
|
|
|
|
assert result is dropdown_elem
|
|
input_field.clear_input.assert_awaited_once()
|
|
input_field.send_keys.assert_awaited_once_with("Visible Label")
|
|
dropdown_elem.apply.assert_awaited_once()
|
|
assert web_scraper.web_sleep.await_count == 2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_no_matching_option_raises(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection raises when no <li> matches the entered text."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {"aria-controls": "dropdown-id"}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
|
|
dropdown_elem = AsyncMock(spec = Element)
|
|
dropdown_elem.apply = AsyncMock(return_value = False)
|
|
|
|
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
with pytest.raises(TimeoutError, match = "No matching option found in combobox"):
|
|
await web_scraper.web_select_combobox(By.ID, "combo-id", "Missing Label")
|
|
|
|
dropdown_elem.apply.assert_awaited_once()
|
|
assert web_scraper.web_sleep.await_count == 1 # One sleep after typing, error before second sleep
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_combobox_special_characters(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test combobox selection with special characters (quotes, newlines, etc)."""
|
|
input_field = AsyncMock(spec = Element)
|
|
input_field.attrs = {"aria-controls": "dropdown-id"}
|
|
input_field.clear_input = AsyncMock()
|
|
input_field.send_keys = AsyncMock()
|
|
|
|
dropdown_elem = AsyncMock(spec = Element)
|
|
dropdown_elem.apply = AsyncMock(return_value = True)
|
|
|
|
web_scraper.web_find = AsyncMock(side_effect = [input_field, dropdown_elem]) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
# Test with quotes, backslashes, and newlines
|
|
special_value = 'Value with "quotes" and \\ backslash'
|
|
result = await web_scraper.web_select_combobox(By.ID, "combo-id", special_value)
|
|
|
|
assert result is dropdown_elem
|
|
input_field.send_keys.assert_awaited_once_with(special_value)
|
|
# Verify that the JavaScript received properly escaped value
|
|
call_args = dropdown_elem.apply.call_args[0][0]
|
|
assert '"quotes"' in call_args or r'\"quotes\"' in call_args # JSON escaping should handle quotes
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_by_value(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_select successfully matches by option value."""
|
|
select_elem = AsyncMock(spec = Element)
|
|
select_elem.apply = AsyncMock()
|
|
|
|
web_scraper.web_check = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_await = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_find = AsyncMock(return_value = select_elem) # type: ignore[method-assign]
|
|
web_scraper.web_sleep = AsyncMock() # type: ignore[method-assign]
|
|
|
|
result = await web_scraper.web_select(By.ID, "select-id", "option-value")
|
|
|
|
assert result is select_elem
|
|
select_elem.apply.assert_awaited_once()
|
|
web_scraper.web_sleep.assert_awaited_once()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_select_raises_on_missing_option(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_select raises TimeoutError when option not found."""
|
|
select_elem = AsyncMock(spec = Element)
|
|
# Simulate JS throwing an error when option not found
|
|
select_elem.apply = AsyncMock(side_effect = Exception("Option not found by value or displayed text: missing"))
|
|
|
|
web_scraper.web_check = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_await = AsyncMock(return_value = True) # type: ignore[method-assign]
|
|
web_scraper.web_find = AsyncMock(return_value = select_elem) # type: ignore[method-assign]
|
|
|
|
with pytest.raises(TimeoutError, match = "Option not found by value or displayed text"):
|
|
await web_scraper.web_select(By.ID, "select-id", "missing-option")
|
|
|
|
async def test_web_input_success_returns_element(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Successful web_input should send keys, wait, and return the element."""
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_page.query_selector.return_value = mock_element
|
|
mock_sleep = AsyncMock()
|
|
cast(Any, web_scraper).web_sleep = mock_sleep
|
|
|
|
result = await web_scraper.web_input(By.ID, "username", "hello world", timeout = 1)
|
|
|
|
assert result is mock_element
|
|
mock_element.clear_input.assert_awaited_once()
|
|
mock_element.send_keys.assert_awaited_once_with("hello world")
|
|
mock_sleep.assert_awaited_once()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_open_timeout(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test page load timeout in web_open."""
|
|
# Mock browser.get to return a page that never loads
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get.return_value = mock_page
|
|
|
|
# Mock web_execute to never return True for document.readyState
|
|
setattr(web_scraper, "web_execute", AsyncMock(return_value = False))
|
|
|
|
# Ensure page is None so the timeout path is exercised
|
|
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
|
|
# Test page load timeout
|
|
with pytest.raises(TimeoutError, match = "Page did not finish loading within"):
|
|
await web_scraper.web_open("https://example.com", timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_open_skip_when_url_already_loaded(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""web_open should short-circuit when the requested URL is already active."""
|
|
mock_browser.get.reset_mock()
|
|
mock_page.url = "https://example.com"
|
|
mock_execute = AsyncMock()
|
|
cast(Any, web_scraper).web_execute = mock_execute
|
|
|
|
await web_scraper.web_open("https://example.com", reload_if_already_open = False)
|
|
|
|
mock_browser.get.assert_not_awaited()
|
|
mock_execute.assert_not_called()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_request_invalid_response(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test invalid response handling in web_request."""
|
|
# Mock page.evaluate to return an invalid response
|
|
mock_page.evaluate.return_value = {"statusCode": 404, "statusMessage": "Not Found", "headers": {}, "content": "Page not found"}
|
|
|
|
# Test invalid response error
|
|
with pytest.raises(AssertionError, match = "Invalid response"):
|
|
await web_scraper.web_request("https://example.com")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_request_network_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test network error handling in web_request."""
|
|
# Mock page.evaluate to raise a network error
|
|
mock_page.evaluate.side_effect = Exception("Network error")
|
|
|
|
# Test network error
|
|
with pytest.raises(Exception, match = "Network error"):
|
|
await web_scraper.web_request("https://example.com")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_check_element_not_found(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test element not found error in web_check."""
|
|
# Mock page.query_selector to return None
|
|
mock_page.query_selector.return_value = None
|
|
|
|
# Test element not found error
|
|
with pytest.raises(TimeoutError, match = "No HTML element found with ID 'test-id'"):
|
|
await web_scraper.web_check(By.ID, "test-id", Is.CLICKABLE, timeout = 0.1)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_check_attribute_error(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test attribute error in web_check."""
|
|
# Create a mock element that raises an error on attribute check
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.attrs = {}
|
|
mock_element.apply.side_effect = Exception("Attribute error")
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
# Test attribute error
|
|
with pytest.raises(Exception, match = "Attribute error"):
|
|
await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_applies_timeout_multiplier_and_backoff(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Ensure multiplier/backoff logic is honored when timeouts occur."""
|
|
assert web_scraper.config is not None
|
|
web_scraper.config.timeouts.multiplier = 2.0
|
|
web_scraper.config.timeouts.retry_enabled = True
|
|
web_scraper.config.timeouts.retry_max_attempts = 2
|
|
web_scraper.config.timeouts.retry_backoff_factor = 2.0
|
|
|
|
recorded:list[tuple[float, bool]] = []
|
|
|
|
async def fake_web_await(condition:Callable[[], object], *, timeout:float, timeout_error_message:str = "",
|
|
apply_multiplier:bool = True) -> Element:
|
|
recorded.append((timeout, apply_multiplier))
|
|
raise TimeoutError(timeout_error_message or "timeout")
|
|
|
|
cast(Any, web_scraper).web_await = fake_web_await
|
|
|
|
with pytest.raises(TimeoutError):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.5)
|
|
|
|
assert recorded == [(1.0, False), (2.0, False), (4.0, False)]
|
|
|
|
|
|
class TestTimeoutAndRetryHelpers:
|
|
"""Test timeout helper utilities in WebScrapingMixin."""
|
|
|
|
def test_get_timeout_config_prefers_config_timeouts(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_get_timeout_config should return the config-provided timeout model when available."""
|
|
custom_config = Config.model_validate({
|
|
"login": {"username": "user@example.com", "password": "secret"}, # noqa: S105
|
|
"timeouts": {"default": 7.5}
|
|
})
|
|
web_scraper.config = custom_config
|
|
|
|
assert web_scraper._get_timeout_config() is custom_config.timeouts
|
|
|
|
def test_timeout_attempts_respects_retry_switch(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_timeout_attempts should collapse to a single attempt when retries are disabled."""
|
|
web_scraper.config.timeouts.retry_enabled = False
|
|
assert web_scraper._timeout_attempts() == 1
|
|
|
|
web_scraper.config.timeouts.retry_enabled = True
|
|
web_scraper.config.timeouts.retry_max_attempts = 3
|
|
assert web_scraper._timeout_attempts() == 4
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_run_with_timeout_retries_retries_operation(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_run_with_timeout_retries should retry when TimeoutError is raised before succeeding."""
|
|
attempts:list[float] = []
|
|
|
|
async def flaky_operation(timeout:float) -> str:
|
|
attempts.append(timeout)
|
|
if len(attempts) == 1:
|
|
raise TimeoutError("first attempt")
|
|
return "done"
|
|
|
|
web_scraper.config.timeouts.retry_max_attempts = 1
|
|
result = await web_scraper._run_with_timeout_retries(flaky_operation, description = "retry-op")
|
|
|
|
assert result == "done"
|
|
assert len(attempts) == 2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_run_with_timeout_retries_guard_clause(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""_run_with_timeout_retries should guard against zero-attempt edge cases."""
|
|
async def never_called(timeout:float) -> None:
|
|
pytest.fail("operation should not run when attempts are zero")
|
|
|
|
with patch.object(web_scraper, "_timeout_attempts", return_value = 0), \
|
|
pytest.raises(TimeoutError, match = "guarded-op failed without executing operation"):
|
|
await web_scraper._run_with_timeout_retries(never_called, description = "guarded-op")
|
|
|
|
|
|
class TestSelectorTimeoutMessages:
|
|
"""Ensure selector helpers provide informative timeout messages."""
|
|
|
|
@pytest.mark.asyncio
|
|
@pytest.mark.parametrize(
|
|
("selector_type", "selector_value", "expected_message"),
|
|
[
|
|
(By.TAG_NAME, "section", "No HTML element found of tag <section> within 2.0 seconds."),
|
|
(By.CSS_SELECTOR, ".hero", "No HTML element found using CSS selector '.hero' within 2.0 seconds."),
|
|
(By.TEXT, "Submit", "No HTML element found containing text 'Submit' within 2.0 seconds."),
|
|
(By.XPATH, "//div[@class='hero']", "No HTML element found using XPath '//div[@class='hero']' within 2.0 seconds."),
|
|
]
|
|
)
|
|
async def test_web_find_timeout_suffixes(
|
|
self,
|
|
web_scraper:WebScrapingMixin,
|
|
selector_type:By,
|
|
selector_value:str,
|
|
expected_message:str
|
|
) -> None:
|
|
"""web_find should pass descriptive timeout messages for every selector strategy."""
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_wait = AsyncMock(return_value = mock_element)
|
|
cast(Any, web_scraper).web_await = mock_wait
|
|
|
|
result = await web_scraper.web_find(selector_type, selector_value, timeout = 2)
|
|
|
|
assert result is mock_element
|
|
call = mock_wait.await_args_list[0]
|
|
assert expected_message == call.kwargs["timeout_error_message"]
|
|
assert call.kwargs["apply_multiplier"] is False
|
|
|
|
@pytest.mark.asyncio
|
|
@pytest.mark.parametrize(
|
|
("selector_type", "selector_value", "expected_message"),
|
|
[
|
|
(By.CLASS_NAME, "hero", "No HTML elements found with CSS class 'hero' within 1 seconds."),
|
|
(By.CSS_SELECTOR, ".card", "No HTML elements found using CSS selector '.card' within 1 seconds."),
|
|
(By.TAG_NAME, "article", "No HTML elements found of tag <article> within 1 seconds."),
|
|
(By.TEXT, "Listings", "No HTML elements found containing text 'Listings' within 1 seconds."),
|
|
(By.XPATH, "//footer", "No HTML elements found using XPath '//footer' within 1 seconds."),
|
|
]
|
|
)
|
|
async def test_web_find_all_once_timeout_suffixes(
|
|
self,
|
|
web_scraper:WebScrapingMixin,
|
|
selector_type:By,
|
|
selector_value:str,
|
|
expected_message:str
|
|
) -> None:
|
|
"""_web_find_all_once should surface informative timeout errors for each selector."""
|
|
elements = [AsyncMock(spec = Element)]
|
|
mock_wait = AsyncMock(return_value = elements)
|
|
cast(Any, web_scraper).web_await = mock_wait
|
|
|
|
result = await web_scraper._web_find_all_once(selector_type, selector_value, 1)
|
|
|
|
assert result is elements
|
|
call = mock_wait.await_args_list[0]
|
|
assert expected_message == call.kwargs["timeout_error_message"]
|
|
assert call.kwargs["apply_multiplier"] is False
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_all_delegates_to_retry_helper(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""web_find_all should execute via the timeout retry helper."""
|
|
elements = [AsyncMock(spec = Element)]
|
|
|
|
async def fake_retry(operation:Callable[[float], Awaitable[list[Element]]], **kwargs:Any) -> list[Element]:
|
|
assert kwargs["description"] == "web_find_all(CLASS_NAME, hero)"
|
|
assert kwargs["override"] == 1.5
|
|
result = await operation(0.42)
|
|
return result
|
|
|
|
retry_mock = AsyncMock(side_effect = fake_retry)
|
|
once_mock = AsyncMock(return_value = elements)
|
|
cast(Any, web_scraper)._run_with_timeout_retries = retry_mock
|
|
cast(Any, web_scraper)._web_find_all_once = once_mock
|
|
|
|
result = await web_scraper.web_find_all(By.CLASS_NAME, "hero", timeout = 1.5)
|
|
|
|
assert result is elements
|
|
retry_call = retry_mock.await_args_list[0]
|
|
assert retry_call.kwargs["key"] == "default"
|
|
assert retry_call.kwargs["override"] == 1.5
|
|
|
|
once_call = once_mock.await_args_list[0]
|
|
assert once_call.args[:2] == (By.CLASS_NAME, "hero")
|
|
assert once_call.args[2] == 0.42
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_check_unsupported_attribute(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""web_check should raise for unsupported attribute queries."""
|
|
mock_element = AsyncMock(spec = Element)
|
|
mock_element.attrs = {}
|
|
mock_page.query_selector.return_value = mock_element
|
|
|
|
with pytest.raises(AssertionError, match = "Unsupported attribute"):
|
|
await web_scraper.web_check(By.ID, "test-id", cast(Is, object()), timeout = 0.1)
|
|
|
|
|
|
class TestWebScrapingSessionManagement:
|
|
"""Test session management edge cases in WebScrapingMixin."""
|
|
|
|
def test_close_browser_session_cleans_up_resources(self) -> None:
|
|
"""Ensure browser and page references are cleared and child processes are killed."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = MagicMock()
|
|
scraper.browser._process_pid = 42
|
|
stop_mock = scraper.browser.stop = MagicMock()
|
|
scraper.page = MagicMock(spec = Page)
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_child = MagicMock()
|
|
mock_child.is_running.return_value = True
|
|
mock_proc.return_value.children.return_value = [mock_child]
|
|
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_called_once_with(42)
|
|
stop_mock.assert_called_once()
|
|
mock_child.kill.assert_called_once()
|
|
assert scraper.browser is None
|
|
assert scraper.page is None
|
|
|
|
def test_close_browser_session_idempotent(self) -> None:
|
|
"""Repeated calls should leave the state clean without re-running cleanup logic."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = MagicMock()
|
|
scraper.browser._process_pid = 99
|
|
stop_mock = scraper.browser.stop = MagicMock()
|
|
scraper.page = MagicMock(spec = Page)
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper.close_browser_session()
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_called_once()
|
|
stop_mock.assert_called_once()
|
|
|
|
def test_close_browser_session_without_browser_skips_inspection(self) -> None:
|
|
"""When no browser exists, no process inspection should run and the page should stay untouched."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
preserved_page = MagicMock(spec = Page)
|
|
scraper.page = preserved_page
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_not_called()
|
|
assert scraper.page is preserved_page
|
|
|
|
def test_close_browser_session_handles_missing_children(self) -> None:
|
|
"""Child-less browsers should still stop cleanly without raising."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser = MagicMock()
|
|
scraper.browser._process_pid = 123
|
|
stop_mock = scraper.browser.stop = MagicMock()
|
|
scraper.page = MagicMock(spec = Page)
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper.close_browser_session()
|
|
|
|
mock_proc.assert_called_once()
|
|
stop_mock.assert_called_once()
|
|
|
|
def test_get_compatible_browser_raises_on_unknown_os(self) -> None:
|
|
"""Test get_compatible_browser raises AssertionError on unknown OS."""
|
|
scraper = WebScrapingMixin()
|
|
with patch("platform.system", return_value = "UnknownOS"), pytest.raises(AssertionError):
|
|
scraper.get_compatible_browser()
|
|
|
|
def test_get_compatible_browser_raises_if_no_browser_found(self) -> None:
|
|
"""Test get_compatible_browser raises AssertionError if no browser is found."""
|
|
scraper = WebScrapingMixin()
|
|
with (
|
|
patch("platform.system", return_value = "Linux"),
|
|
patch("os.path.isfile", return_value = False),
|
|
patch("shutil.which", return_value = None),
|
|
pytest.raises(AssertionError),
|
|
):
|
|
scraper.get_compatible_browser()
|
|
|
|
|
|
class TestWebScrolling:
|
|
"""Test scrolling helpers."""
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_scroll_page_down_scrolls_and_returns(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""web_scroll_page_down should scroll both directions when requested."""
|
|
scripts:list[str] = []
|
|
|
|
async def exec_side_effect(script:str) -> int | None:
|
|
scripts.append(script)
|
|
if script == "document.body.scrollHeight":
|
|
return 20
|
|
return None
|
|
|
|
cast(Any, web_scraper).web_execute = AsyncMock(side_effect = exec_side_effect)
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.asyncio.sleep", new_callable = AsyncMock) as mock_sleep:
|
|
await web_scraper.web_scroll_page_down(scroll_length = 10, scroll_speed = 10, scroll_back_top = True)
|
|
|
|
assert scripts[0] == "document.body.scrollHeight"
|
|
# Expect four scrollTo operations: two down, two up
|
|
assert scripts.count("document.body.scrollHeight") == 1
|
|
scroll_calls = [script for script in scripts if script.startswith("window.scrollTo")]
|
|
assert scroll_calls == [
|
|
"window.scrollTo(0, 10)",
|
|
"window.scrollTo(0, 20)",
|
|
"window.scrollTo(0, 10)",
|
|
"window.scrollTo(0, 0)"
|
|
]
|
|
sleep_durations = [call.args[0] for call in mock_sleep.await_args_list]
|
|
assert sleep_durations == [1.0, 1.0, 0.5, 0.5]
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_session_expiration_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test handling of expired browser sessions."""
|
|
mock_browser.get.side_effect = Exception("Session expired")
|
|
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
with pytest.raises(Exception, match = "Session expired"):
|
|
await web_scraper.web_open("https://example.com")
|
|
# Do not assert browser/page are None, as production code does not clear them
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_multiple_session_handling(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test handling of multiple browser sessions."""
|
|
mock_page1 = TrulyAwaitableMockPage()
|
|
mock_browser.get.return_value = mock_page1
|
|
mock_browser._process_pid = 12345
|
|
# Patch stop as MagicMock to avoid RuntimeWarning
|
|
mock_browser.stop = MagicMock()
|
|
await web_scraper.web_open("https://example1.com")
|
|
assert web_scraper.page == mock_page1
|
|
# Patch psutil.Process to avoid NoSuchProcess error
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_child = MagicMock()
|
|
mock_child.is_running.return_value = True
|
|
mock_proc.return_value.children.return_value = [mock_child]
|
|
web_scraper.close_browser_session()
|
|
assert web_scraper.browser is None
|
|
assert web_scraper.page is None
|
|
# Re-assign browser for new session
|
|
web_scraper.browser = mock_browser
|
|
mock_page2 = TrulyAwaitableMockPage()
|
|
mock_browser.get.return_value = mock_page2
|
|
mock_browser._process_pid = 12346
|
|
await web_scraper.web_open("https://example2.com")
|
|
assert web_scraper.page == mock_page2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_crash_recovery(self, web_scraper:WebScrapingMixin, mock_browser:AsyncMock) -> None:
|
|
"""Test recovery from browser crash."""
|
|
web_scraper.page = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
web_scraper.browser = None # type: ignore[unused-ignore,reportAttributeAccessIssue]
|
|
# Reassign the mock browser before setting up the side effect
|
|
web_scraper.browser = mock_browser
|
|
mock_browser.get.side_effect = Exception("Browser crashed")
|
|
with pytest.raises(Exception, match = "Browser crashed"):
|
|
await web_scraper.web_open("https://example.com")
|
|
# Do not assert browser/page are None, as production code does not clear them
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get.side_effect = None
|
|
mock_browser.get.return_value = mock_page
|
|
await web_scraper.web_open("https://example.com")
|
|
assert web_scraper.page == mock_page
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_await_custom_condition_success(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_await returns when custom condition is met."""
|
|
call_count = {"count": 0}
|
|
|
|
async def condition() -> bool:
|
|
call_count["count"] += 1
|
|
return call_count["count"] >= 3
|
|
|
|
result:bool = await web_scraper.web_await(condition, timeout = 1)
|
|
assert result is True
|
|
assert call_count["count"] >= 3
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_await_custom_condition_timeout(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test web_await raises TimeoutError if condition is never met."""
|
|
|
|
async def condition() -> bool:
|
|
return False
|
|
|
|
with pytest.raises(TimeoutError):
|
|
await web_scraper.web_await(condition, timeout = 0.05)
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_retry_mechanism(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test web_find retries until element is found within timeout."""
|
|
call_count = {"count": 0}
|
|
|
|
async def query_selector(*args:object, **kwargs:object) -> AsyncMock | None:
|
|
call_count["count"] += 1
|
|
if call_count["count"] == 3:
|
|
return AsyncMock(spec = Element)
|
|
return None
|
|
|
|
mock_page.query_selector.side_effect = query_selector
|
|
result = await web_scraper.web_find(By.ID, "test-id", timeout = 0.2)
|
|
assert result is not None
|
|
assert call_count["count"] >= 3
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_element_state_change(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test web_check detects element state change (e.g., becomes visible)."""
|
|
call_count = {"count": 0}
|
|
|
|
async def query_selector(*args:object, **kwargs:object) -> AsyncMock | None:
|
|
call_count["count"] += 1
|
|
if call_count["count"] == 2:
|
|
element = AsyncMock(spec = Element)
|
|
element.attrs = {}
|
|
|
|
async def apply_fn(*a:object, **kw:object) -> bool:
|
|
return True
|
|
|
|
element.apply = AsyncMock(side_effect = apply_fn)
|
|
return element
|
|
return None
|
|
|
|
mock_page.query_selector.side_effect = query_selector
|
|
result = await web_scraper.web_check(By.ID, "test-id", Is.DISPLAYED, timeout = 1.0)
|
|
assert result is True
|
|
assert call_count["count"] >= 2
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_web_find_timeout_configuration(self, web_scraper:WebScrapingMixin, mock_page:TrulyAwaitableMockPage) -> None:
|
|
"""Test web_find respects timeout configuration and raises TimeoutError."""
|
|
mock_page.query_selector.return_value = None
|
|
with pytest.raises(TimeoutError):
|
|
await web_scraper.web_find(By.ID, "test-id", timeout = 0.05)
|
|
|
|
|
|
class TestWebScrapingBrowserConfiguration:
|
|
"""Test browser configuration in WebScrapingMixin."""
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_binary_location_detection(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser binary location detection on different platforms."""
|
|
scraper = WebScrapingMixin()
|
|
|
|
# Test Linux
|
|
monkeypatch.setattr(platform, "system", lambda: "Linux")
|
|
monkeypatch.setattr(shutil, "which", lambda x: "/usr/bin/chrome" if x == "google-chrome" else None)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chrome")
|
|
assert scraper.get_compatible_browser() == "/usr/bin/chrome"
|
|
|
|
# Test macOS
|
|
monkeypatch.setattr(platform, "system", lambda: "Darwin")
|
|
mac_path = "/Applications/Google Chrome.app/Contents/MacOS/Google Chrome"
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == mac_path)
|
|
assert scraper.get_compatible_browser() == mac_path
|
|
|
|
# Test Windows
|
|
monkeypatch.setattr(platform, "system", lambda: "Windows")
|
|
win_path = "C:\\Program Files\\Chrome\\Application\\chrome.exe"
|
|
# Mock os.environ to include PROGRAMFILES and PROGRAMFILES(X86) and LOCALAPPDATA
|
|
monkeypatch.setenv("PROGRAMFILES", "C:\\Program Files")
|
|
monkeypatch.setenv("PROGRAMFILES(X86)", "C:\\Program Files (x86)")
|
|
monkeypatch.setenv("LOCALAPPDATA", "C:\\Users\\TestUser\\AppData\\Local")
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == win_path)
|
|
assert scraper.get_compatible_browser() == win_path
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_profile_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser profile configuration and preferences handling."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = [] # Add private extensions list
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext) # Use private extensions list
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock Config class
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
|
|
# Mock os.path.exists to return True for the browser binary and use real exists for Preferences file (and Edge)
|
|
edge_path = "/Applications/Microsoft Edge.app/Contents/MacOS/Microsoft Edge"
|
|
chrome_path = "/Applications/Google Chrome.app/Contents/MacOS/Google Chrome"
|
|
real_exists = os.path.exists
|
|
|
|
def mock_exists_sync(path:str) -> bool:
|
|
# Handle all browser paths
|
|
if path in {
|
|
# Linux paths
|
|
"/usr/bin/chromium",
|
|
"/usr/bin/chromium-browser",
|
|
"/usr/bin/google-chrome",
|
|
"/usr/bin/microsoft-edge",
|
|
"/usr/bin/chrome",
|
|
# macOS paths
|
|
edge_path,
|
|
chrome_path,
|
|
# Windows paths
|
|
"C:\\Program Files\\Microsoft\\Edge\\Application\\msedge.exe",
|
|
"C:\\Program Files (x86)\\Microsoft\\Edge\\Application\\msedge.exe",
|
|
"C:\\Program Files\\Chromium\\Application\\chrome.exe",
|
|
"C:\\Program Files (x86)\\Chromium\\Application\\chrome.exe",
|
|
"C:\\Users\\runneradmin\\AppData\\Local\\Chromium\\Application\\chrome.exe",
|
|
"C:\\Program Files\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Program Files (x86)\\Chrome\\Application\\chrome.exe",
|
|
"C:\\Users\\runneradmin\\AppData\\Local\\Chrome\\Application\\chrome.exe"
|
|
}:
|
|
return True
|
|
if "Preferences" in str(path) and str(tmp_path) in str(path):
|
|
return real_exists(path)
|
|
return False
|
|
|
|
async def mock_exists_async(path:str | Path) -> bool:
|
|
return mock_exists_sync(str(path))
|
|
|
|
monkeypatch.setattr(os.path, "exists", mock_exists_sync)
|
|
monkeypatch.setattr(files, "exists", mock_exists_async)
|
|
|
|
# Create test profile directory
|
|
profile_dir = tmp_path / "Default"
|
|
profile_dir.mkdir()
|
|
prefs_file = profile_dir / "Preferences"
|
|
|
|
# Test with existing preferences file
|
|
prefs_file.write_text(json.dumps({"existing": "prefs"}), encoding = "UTF-8")
|
|
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify preferences file was not overwritten
|
|
prefs = json.loads(prefs_file.read_text(encoding = "UTF-8"))
|
|
assert prefs["existing"] == "prefs"
|
|
|
|
# Test with missing preferences file
|
|
prefs_file.unlink()
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify new preferences file was created with correct settings
|
|
prefs = json.loads(prefs_file.read_text(encoding = "UTF-8"))
|
|
assert prefs["credentials_enable_service"] is False
|
|
assert prefs["enable_do_not_track"] is True
|
|
assert prefs["profile"]["password_manager_enabled"] is False
|
|
assert prefs["signin"]["allowed"] is False
|
|
assert "www.kleinanzeigen.de" in prefs["translate_site_blacklist"]
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_arguments_configuration(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser arguments configuration."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self.extensions.append(ext)
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock Config class
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
|
|
# Mock os.path.exists to return True for both Chrome and Edge paths
|
|
monkeypatch.setattr(os.path, "exists", lambda p: p in {"/usr/bin/chrome", "/usr/bin/edge"})
|
|
|
|
async def mock_exists_async(path:str | Path) -> bool:
|
|
return str(path) in {"/usr/bin/chrome", "/usr/bin/edge"}
|
|
monkeypatch.setattr(files, "exists", mock_exists_async)
|
|
|
|
# Test with custom arguments
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.arguments = ["--custom-arg=value", "--another-arg"]
|
|
scraper.browser_config.use_private_window = True
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify browser arguments
|
|
config = _nodriver_start_mock().call_args[0][0]
|
|
assert "--custom-arg=value" in config.browser_args
|
|
assert "--another-arg" in config.browser_args
|
|
assert "--incognito" in config.browser_args
|
|
assert "--disable-crash-reporter" in config.browser_args
|
|
assert "--disable-domain-reliability" in config.browser_args
|
|
|
|
# Test with Edge browser
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.binary_location = "/usr/bin/edge"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify Edge-specific arguments
|
|
config = _nodriver_start_mock().call_args[0][0]
|
|
assert "-inprivate" in config.browser_args
|
|
assert os.environ.get("MSEDGEDRIVER_TELEMETRY_OPTOUT") == "1"
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_extension_loading(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser extension loading."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = [] # Add private extensions list
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext) # Use private extensions list
|
|
|
|
# Create test extension files
|
|
ext1 = tmp_path / "ext1.crx"
|
|
ext2 = tmp_path / "ext2.crx"
|
|
|
|
# Create proper CRX files (which are ZIP files)
|
|
with zipfile.ZipFile(ext1, "w") as z:
|
|
z.writestr("manifest.json", '{"name": "Test Extension 1"}')
|
|
with zipfile.ZipFile(ext2, "w") as z:
|
|
z.writestr("manifest.json", '{"name": "Test Extension 2"}')
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock Config class
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
|
|
# Mock files.exists and files.is_dir to return appropriate values
|
|
async def mock_exists(path:str | Path) -> bool:
|
|
path_str = str(path)
|
|
# Resolve real paths to handle symlinks (e.g., /var -> /private/var on macOS)
|
|
real_path = str(Path(path_str).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext1 = str(Path(ext1).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext2 = str(Path(ext2).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
return path_str in {"/usr/bin/chrome", "/usr/bin/edge"} or real_path in {real_ext1, real_ext2} or os.path.exists(path_str) # noqa: ASYNC240
|
|
|
|
async def mock_is_dir(path:str | Path) -> bool:
|
|
path_str = str(path)
|
|
# Resolve real paths to handle symlinks
|
|
real_path = str(Path(path_str).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext1 = str(Path(ext1).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
real_ext2 = str(Path(ext2).resolve()) # noqa: ASYNC240 Test mock, runs synchronously
|
|
# Nodriver extracts CRX files to temp directories, so they appear as directories
|
|
if real_path in {real_ext1, real_ext2}:
|
|
return True
|
|
return Path(path_str).is_dir() # noqa: ASYNC240 Test mock, runs synchronously
|
|
|
|
monkeypatch.setattr(files, "exists", mock_exists)
|
|
monkeypatch.setattr(files, "is_dir", mock_is_dir)
|
|
|
|
# Test extension loading
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.extensions = [str(ext1), str(ext2)]
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
await scraper.create_browser_session()
|
|
|
|
# Verify extensions were loaded
|
|
config = _nodriver_start_mock().call_args[0][0]
|
|
assert len(config._extensions) == 2
|
|
for ext_path in config._extensions:
|
|
assert await files.exists(ext_path)
|
|
assert await files.is_dir(ext_path)
|
|
|
|
# Test with non-existent extension
|
|
scraper.browser_config.extensions = ["non_existent.crx"]
|
|
with pytest.raises(AssertionError):
|
|
await scraper.create_browser_session()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_binary_location_detection_edge_cases(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test browser binary location detection edge cases."""
|
|
scraper = WebScrapingMixin()
|
|
|
|
# Test Linux with multiple browser options
|
|
def which_mock(x:str) -> str | None:
|
|
return {
|
|
"chromium": "/usr/bin/chromium",
|
|
"chromium-browser": None,
|
|
"google-chrome": None,
|
|
"microsoft-edge": None
|
|
}.get(x)
|
|
monkeypatch.setattr(platform, "system", lambda: "Linux")
|
|
monkeypatch.setattr(shutil, "which", which_mock)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: p == "/usr/bin/chromium")
|
|
assert scraper.get_compatible_browser() == "/usr/bin/chromium"
|
|
|
|
# Test Linux with no browsers found
|
|
monkeypatch.setattr(shutil, "which", lambda x: None)
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: False)
|
|
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
|
|
scraper.get_compatible_browser()
|
|
|
|
# Test Windows with environment variables not set
|
|
monkeypatch.setattr(platform, "system", lambda: "Windows")
|
|
# Set default values for environment variables
|
|
monkeypatch.setenv("PROGRAMFILES", "C:\\Program Files")
|
|
monkeypatch.setenv("PROGRAMFILES(X86)", "C:\\Program Files (x86)")
|
|
monkeypatch.setenv("LOCALAPPDATA", "C:\\Users\\TestUser\\AppData\\Local")
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: False)
|
|
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
|
|
scraper.get_compatible_browser()
|
|
|
|
# Test macOS with non-existent paths
|
|
monkeypatch.setattr(platform, "system", lambda: "Darwin")
|
|
monkeypatch.setattr(os.path, "isfile", lambda p: False)
|
|
with pytest.raises(AssertionError, match = "Installed browser could not be detected"):
|
|
scraper.get_compatible_browser()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_session_state_persistence(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test that session state persists across browser restarts when user_data_dir is set."""
|
|
# DummyConfig to simulate browser config
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = []
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext)
|
|
|
|
# Mock nodriver.start to return a mock browser
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
monkeypatch.setattr(os.path, "exists", lambda p: True)
|
|
|
|
# Simulate state file in user_data_dir
|
|
state_file = tmp_path / "Default" / "state.json"
|
|
state_file.parent.mkdir(parents = True, exist_ok = True)
|
|
|
|
# First session: write state
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
await scraper.create_browser_session()
|
|
state_file.write_text('{"foo": "bar"}', encoding = "utf-8")
|
|
scraper.browser._process_pid = 12345
|
|
scraper.browser.stop = MagicMock()
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper.close_browser_session()
|
|
|
|
# Second session: read state
|
|
scraper2 = WebScrapingMixin()
|
|
scraper2.browser_config.user_data_dir = str(tmp_path)
|
|
scraper2.browser_config.profile_name = "Default"
|
|
await scraper2.create_browser_session()
|
|
data = state_file.read_text(encoding = "utf-8")
|
|
assert data == '{"foo": "bar"}'
|
|
scraper2.browser._process_pid = 12346
|
|
scraper2.browser.stop = MagicMock()
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.return_value.children.return_value = []
|
|
scraper2.close_browser_session()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_session_creation_error_cleanup(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test that resources are cleaned up when session creation fails."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = []
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext)
|
|
|
|
# Create a temporary file before the test
|
|
temp_file = tmp_path / "temp_resource"
|
|
temp_file.write_text("test")
|
|
|
|
# Mock nodriver.start to raise an exception
|
|
async def mock_start_fail(*args:object, **kwargs:object) -> NoReturn:
|
|
if temp_file.exists():
|
|
temp_file.unlink()
|
|
raise Exception("Session creation failed")
|
|
|
|
def make_mock_browser() -> AsyncMock:
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
mock_browser._process_pid = 12345
|
|
mock_browser.stop = MagicMock()
|
|
return mock_browser
|
|
|
|
monkeypatch.setattr(nodriver, "start", mock_start_fail)
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
# Don't mock os.path.exists globally - let the file operations work normally
|
|
|
|
# Attempt to create a session
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
|
|
with pytest.raises(Exception, match = "Session creation failed"):
|
|
await scraper.create_browser_session() # type: ignore[unused-ignore,reportGeneralTypeIssues] # Awaiting a function that always raises
|
|
|
|
assert not (tmp_path / "temp_resource").exists()
|
|
assert scraper.browser is None
|
|
assert scraper.page is None
|
|
|
|
# Now patch nodriver.start to return a new mock browser each time
|
|
mock_browser = make_mock_browser()
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get = AsyncMock(return_value = mock_page)
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
|
|
# Mock create_browser_session to ensure proper setup
|
|
async def mock_create_session(self:WebScrapingMixin) -> None:
|
|
self.browser = mock_browser
|
|
self.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
|
|
|
|
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session)
|
|
await scraper.create_browser_session() # type: ignore[unused-ignore,reportGeneralTypeIssues] # Awaiting a function that always raises
|
|
print("[DEBUG] scraper.page after session creation:", scraper.page)
|
|
assert scraper.browser is not None
|
|
assert scraper.page is not None
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_external_process_termination(self, tmp_path:Path, monkeypatch:pytest.MonkeyPatch) -> None:
|
|
"""Test handling of external browser process termination."""
|
|
class DummyConfig:
|
|
def __init__(self, **kwargs:object) -> None:
|
|
self.browser_args:list[str] = []
|
|
self.user_data_dir:str | None = None
|
|
self.extensions:list[str] = []
|
|
self.browser_executable_path:str | None = None
|
|
self.host:str | None = None
|
|
self.port:int | None = None
|
|
self.headless:bool = False
|
|
self._extensions:list[str] = []
|
|
|
|
def add_extension(self, ext:str) -> None:
|
|
self._extensions.append(ext)
|
|
|
|
def make_mock_browser() -> AsyncMock:
|
|
mock_browser = AsyncMock()
|
|
mock_browser.websocket_url = "ws://localhost:9222"
|
|
mock_browser._process_pid = 12345
|
|
mock_browser.stop = MagicMock()
|
|
return mock_browser
|
|
|
|
mock_browser = make_mock_browser()
|
|
mock_page = TrulyAwaitableMockPage()
|
|
mock_browser.get = AsyncMock(return_value = mock_page)
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser))
|
|
monkeypatch.setattr(nodriver.core.config, "Config", DummyConfig) # type: ignore[unused-ignore,reportAttributeAccessIssue,attr-defined]
|
|
monkeypatch.setattr(os.path, "exists", lambda p: True)
|
|
|
|
# Mock create_browser_session to ensure proper setup
|
|
async def mock_create_session(self:WebScrapingMixin) -> None:
|
|
self.browser = mock_browser
|
|
self.page = mock_page # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
|
|
|
|
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session)
|
|
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path)
|
|
scraper.browser_config.profile_name = "Default"
|
|
await scraper.create_browser_session()
|
|
|
|
with patch("psutil.Process") as mock_proc:
|
|
mock_proc.side_effect = psutil.NoSuchProcess(12345)
|
|
with pytest.raises(psutil.NoSuchProcess):
|
|
scraper.close_browser_session()
|
|
|
|
# Create a new mock browser for the second session
|
|
mock_browser2 = make_mock_browser()
|
|
mock_browser2._process_pid = 12346
|
|
mock_page2 = TrulyAwaitableMockPage()
|
|
mock_browser2.get = AsyncMock(return_value = mock_page2)
|
|
monkeypatch.setattr(nodriver, "start", AsyncMock(return_value = mock_browser2))
|
|
|
|
# Update mock_create_session for the second session
|
|
async def mock_create_session2(self:WebScrapingMixin) -> None:
|
|
self.browser = mock_browser2
|
|
self.page = mock_page2 # type: ignore[unused-ignore,reportAttributeAccessIssue] # Assigning mock page for test
|
|
|
|
monkeypatch.setattr(WebScrapingMixin, "create_browser_session", mock_create_session2)
|
|
await scraper.create_browser_session()
|
|
print("[DEBUG] scraper.page after session creation:", scraper.page)
|
|
assert scraper.browser is not None
|
|
assert scraper.page is not None
|
|
|
|
def test_diagnose_browser_issues(self, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test that diagnose_browser_issues provides expected diagnostic output."""
|
|
# Configure logging to capture output
|
|
caplog.set_level(loggers.INFO)
|
|
|
|
# Create a WebScrapingMixin instance
|
|
mixin = WebScrapingMixin()
|
|
|
|
# Call the diagnose method
|
|
mixin.diagnose_browser_issues()
|
|
|
|
# Check that diagnostic output was produced
|
|
log_output = caplog.text.lower()
|
|
assert "browser connection diagnostics" in log_output or "browser-verbindungsdiagnose" in log_output
|
|
assert "end diagnostics" in log_output or "ende der diagnose" in log_output
|
|
|
|
|
|
class TestWebScrapingDiagnostics:
|
|
"""Test the diagnose_browser_issues method."""
|
|
|
|
@pytest.fixture
|
|
def scraper_with_config(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with browser config."""
|
|
scraper = WebScrapingMixin()
|
|
return scraper
|
|
|
|
def test_diagnose_browser_issues_binary_exists_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser binary exists and is executable."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
|
|
assert "(ok) Browser binary is executable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_binary_exists_not_executable(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser binary exists but is not executable."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
|
|
assert "(fail) Browser binary is not executable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_binary_not_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser binary is not found."""
|
|
with patch("os.path.exists", return_value = False):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Browser binary not found: /usr/bin/chrome" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_auto_detect_success(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when auto-detecting browser succeeds."""
|
|
with patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.binary_location = None
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(ok) Auto-detected browser: /usr/bin/chrome" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_auto_detect_failure(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when auto-detecting browser fails."""
|
|
with patch.object(scraper_with_config, "get_compatible_browser", return_value = None):
|
|
scraper_with_config.browser_config.binary_location = None
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) No compatible browser found" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_exists_readable(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory exists and is readable/writable."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
|
|
assert "(ok) User data directory is readable and writable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_exists_not_readable(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory exists but is not readable/writable."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
|
|
assert "(fail) User data directory permissions issue" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_not_exists(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory does not exist."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", side_effect = lambda path: path != test_dir), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert f"(info) User data directory does not exist (will be created): {test_dir}" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_configured_open(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is configured and open."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen:
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_configured_open_api_fails(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is open but API is not accessible."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen", side_effect = Exception("Connection refused")):
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
assert "(fail) Remote debugging port is open but API not accessible: Connection refused" in caplog.text
|
|
assert "This might indicate a browser update issue or configuration problem" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_configured_closed(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is configured but closed."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False):
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(info) Remote debugging port is not open" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_port_not_configured(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when remote debugging port is not configured."""
|
|
scraper_with_config.browser_config.arguments = ["--other-arg"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should not log anything about remote debugging port
|
|
assert "Remote debugging port" not in caplog.text
|
|
|
|
def test_diagnose_browser_issues_browser_processes_found(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when browser processes are found.
|
|
Updated to test target browser detection with debugging status.
|
|
"""
|
|
mock_processes = [
|
|
Mock(info = {"pid": 1234, "name": "chrome", "cmdline": ["/usr/bin/chrome"]}),
|
|
Mock(info = {"pid": 5678, "name": "chromium", "cmdline": ["/usr/bin/chromium"]}),
|
|
Mock(info = {"pid": 9012, "name": "edge", "cmdline": ["/usr/bin/edge"]}),
|
|
Mock(info = {"pid": 3456, "name": "chrome", "cmdline": ["/usr/bin/chrome", "--remote-debugging-port=9222"]})
|
|
]
|
|
|
|
with patch("psutil.process_iter", return_value = mock_processes), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should find 2 chrome processes (target browser), one with debugging, one without
|
|
assert "(info) Found 2 browser processes running" in caplog.text
|
|
assert " - PID 1234: chrome (remote debugging NOT enabled)" in caplog.text
|
|
assert " - PID 3456: chrome (remote debugging enabled)" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_no_browser_processes(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic when no browser processes are found."""
|
|
with patch("psutil.process_iter", return_value = []):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
|
|
@patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info")
|
|
def test_diagnose_browser_issues_macos_platform_with_user_data_dir(
|
|
self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic on macOS platform with user data directory."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
|
|
# Setup mock for Chrome 136+ detection with valid configuration
|
|
mock_get_diagnostic.return_value = {
|
|
"binary_detection": None,
|
|
"remote_detection": {
|
|
"version_string": "136.0.6778.0",
|
|
"major_version": 136,
|
|
"browser_name": "Chrome",
|
|
"is_chrome_136_plus": True
|
|
},
|
|
"chrome_136_plus_detected": True,
|
|
"recommendations": []
|
|
}
|
|
|
|
# Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run
|
|
original_env = os.environ.get("PYTEST_CURRENT_TEST")
|
|
if "PYTEST_CURRENT_TEST" in os.environ:
|
|
del os.environ["PYTEST_CURRENT_TEST"]
|
|
|
|
try:
|
|
with patch("platform.system", return_value = "Darwin"), \
|
|
patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
|
|
# Mock Chrome 136+ detection from remote debugging
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should validate Chrome 136+ configuration and pass
|
|
assert "(info) Remote Chrome 136+ detected - validating configuration" in caplog.text
|
|
assert "(ok) Chrome 136+ configuration validation passed" in caplog.text
|
|
finally:
|
|
# Restore environment variable
|
|
if original_env is not None:
|
|
os.environ["PYTEST_CURRENT_TEST"] = original_env
|
|
|
|
def test_diagnose_browser_issues_linux_platform_not_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic on Linux platform when not running as root."""
|
|
with patch("platform.system", return_value = "Linux"), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Linux platform detection was removed - no specific message expected
|
|
assert "Linux detected" not in caplog.text
|
|
# Should not show error about running as root
|
|
assert "(fail) Running as root" not in caplog.text
|
|
|
|
def test_diagnose_browser_issues_linux_platform_root(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic on Linux platform when running as root."""
|
|
with patch("platform.system", return_value = "Linux"), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Linux platform detection was removed - no specific message expected
|
|
assert "Linux detected" not in caplog.text
|
|
assert "(fail) Running as root - this can cause browser issues" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_unknown_platform(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic on unknown platform."""
|
|
with patch("platform.system", return_value = "UnknownOS"), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should not show any platform-specific messages
|
|
assert "Windows detected" not in caplog.text
|
|
assert "macOS detected" not in caplog.text
|
|
assert "Linux detected" not in caplog.text
|
|
|
|
def test_diagnose_browser_issues_macos_remote_debugging_instructions(self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture) -> None:
|
|
"""Test diagnostic shows macOS-specific remote debugging instructions."""
|
|
with patch("platform.system", return_value = "Darwin"), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
@patch("kleinanzeigen_bot.utils.web_scraping_mixin.get_chrome_version_diagnostic_info")
|
|
def test_diagnose_browser_issues_chrome_136_plus_misconfigured(
|
|
self, mock_get_diagnostic:Mock, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when Chrome 136+ is detected but user data directory is not configured."""
|
|
# Setup mock for Chrome 136+ detection with invalid configuration
|
|
mock_get_diagnostic.return_value = {
|
|
"binary_detection": None,
|
|
"remote_detection": {
|
|
"version_string": "136.0.6778.0",
|
|
"major_version": 136,
|
|
"browser_name": "Chrome",
|
|
"is_chrome_136_plus": True
|
|
},
|
|
"chrome_136_plus_detected": True,
|
|
"recommendations": []
|
|
}
|
|
|
|
# Temporarily unset PYTEST_CURRENT_TEST to allow diagnostics to run
|
|
original_env = os.environ.get("PYTEST_CURRENT_TEST")
|
|
if "PYTEST_CURRENT_TEST" in os.environ:
|
|
del os.environ["PYTEST_CURRENT_TEST"]
|
|
|
|
try:
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
|
|
# Mock Chrome 136+ detection from remote debugging
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/136.0.6778.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
# Configure remote debugging but NO user data directory
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.browser_config.user_data_dir = None
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should detect Chrome 136+ and show configuration error
|
|
assert "(info) Remote Chrome 136+ detected - validating configuration" in caplog.text
|
|
assert "(fail) Chrome 136+ configuration validation failed" in caplog.text
|
|
assert "Chrome/Edge 136+ requires --user-data-dir to be specified" in caplog.text
|
|
assert "Solution: Add --user-data-dir=/path/to/directory to browser arguments" in caplog.text
|
|
finally:
|
|
# Restore environment variable
|
|
if original_env is not None:
|
|
os.environ["PYTEST_CURRENT_TEST"] = original_env
|
|
|
|
def test_diagnose_browser_issues_complete_diagnostic_flow(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test complete diagnostic flow with all components."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False):
|
|
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Check that all diagnostic sections are present
|
|
assert "=== Browser Connection Diagnostics ===" in caplog.text
|
|
assert "(ok) Browser binary exists: /usr/bin/chrome" in caplog.text
|
|
assert "(ok) Browser binary is executable" in caplog.text
|
|
assert f"(ok) User data directory exists: {test_dir}" in caplog.text
|
|
assert "(ok) User data directory is readable and writable" in caplog.text
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
assert "(ok) Remote debugging API accessible - Browser: Chrome/120.0.0.0" in caplog.text
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
# Linux platform detection was removed - no specific message expected
|
|
assert "Linux detected" not in caplog.text
|
|
assert "=== End Diagnostics ===" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_host_configured(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when remote debugging host is configured."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen") as mock_urlopen, \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
mock_response = Mock()
|
|
mock_response.read.return_value = b'{"Browser": "Chrome/120.0.0.0"}'
|
|
mock_urlopen.return_value = mock_response
|
|
|
|
scraper_with_config.browser_config.arguments = [
|
|
"--remote-debugging-host=192.168.1.100",
|
|
"--remote-debugging-port=9222"
|
|
]
|
|
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) Remote debugging port configured: 9222" in caplog.text
|
|
assert "(ok) Remote debugging port is open" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_process_info_missing_name(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when process info is missing name."""
|
|
mock_process = Mock()
|
|
mock_process.info = {"pid": 1234, "name": None, "cmdline": []}
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = [mock_process]), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_psutil_exception_handling(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when psutil raises an exception during process iteration."""
|
|
# Mock psutil.process_iter to return a list that will cause an exception when accessing proc.info
|
|
mock_process = Mock()
|
|
mock_process.info = {"name": "chrome"}
|
|
mock_processes = [mock_process]
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = mock_processes), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch.object(mock_process, "info", side_effect = psutil.AccessDenied):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
# Should handle the exception gracefully and continue
|
|
assert "=== Browser Connection Diagnostics ===" in caplog.text
|
|
assert "=== End Diagnostics ===" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_browser_not_executable(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when browser binary exists but is not executable."""
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("psutil.process_iter", return_value = []):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Browser binary is not executable" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_browser_not_found(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when browser binary does not exist."""
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
with patch("os.path.exists", return_value = False), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("psutil.process_iter", return_value = []):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Browser binary not found:" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_no_browser_auto_detection(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when no browser binary is configured and auto-detection fails."""
|
|
scraper_with_config.browser_config.binary_location = None
|
|
with patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", side_effect = AssertionError("No browser found")), \
|
|
pytest.raises(AssertionError, match = "No browser found"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
def test_diagnose_browser_issues_user_data_dir_permissions_issue(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture, tmp_path:Path
|
|
) -> None:
|
|
"""Test diagnostic when user data directory has permission issues."""
|
|
test_dir = str(tmp_path / "chrome-profile")
|
|
scraper_with_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = False), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) User data directory permissions issue" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_remote_debugging_api_inaccessible(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when remote debugging port is open but API is not accessible."""
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
|
|
patch("urllib.request.urlopen", side_effect = Exception("Connection refused")), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Remote debugging port is open but API not accessible" in caplog.text
|
|
assert "This might indicate a browser update issue or configuration problem" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_macos_chrome_warning(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when macOS Chrome remote debugging is configured without user_data_dir."""
|
|
scraper_with_config.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
scraper_with_config.browser_config.user_data_dir = None
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = []), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \
|
|
patch("platform.system", return_value = "Darwin"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
def test_diagnose_browser_issues_linux_root_user(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test diagnostic when running as root on Linux."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = True), \
|
|
patch.object(scraper_with_config, "get_compatible_browser", return_value = "/usr/bin/chrome"):
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(fail) Running as root - this can cause browser issues" in caplog.text
|
|
|
|
def test_is_admin_on_windows_system(self) -> None:
|
|
"""Test _is_admin function on Windows system."""
|
|
# Create a mock os module without geteuid
|
|
mock_os = Mock()
|
|
# Remove geteuid attribute to simulate Windows
|
|
del mock_os.geteuid
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is False
|
|
|
|
def test_diagnose_browser_issues_psutil_exceptions(self, web_scraper:WebScrapingMixin) -> None:
|
|
"""Test diagnose_browser_issues handles psutil exceptions gracefully."""
|
|
# Mock psutil.process_iter to return a list that will cause exceptions when accessing proc.info
|
|
mock_process1 = Mock()
|
|
mock_process1.info = {"name": "chrome"}
|
|
mock_process2 = Mock()
|
|
mock_process2.info = {"name": "edge"}
|
|
mock_processes = [mock_process1, mock_process2]
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = mock_processes), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._diagnose_chrome_version_issues"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = False), \
|
|
patch.object(web_scraper, "get_compatible_browser", return_value = "/usr/bin/chrome"), \
|
|
patch.object(mock_process1, "info", side_effect = psutil.NoSuchProcess(pid = 123)), \
|
|
patch.object(mock_process2, "info", side_effect = psutil.AccessDenied(pid = 456)):
|
|
# Should not raise any exceptions
|
|
web_scraper.diagnose_browser_issues()
|
|
|
|
def test_diagnose_browser_issues_handles_per_process_errors(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""diagnose_browser_issues should ignore psutil errors raised per process."""
|
|
caplog.set_level(logging.INFO)
|
|
|
|
class FailingProcess:
|
|
|
|
@property
|
|
def info(self) -> dict[str, object]:
|
|
raise psutil.AccessDenied(pid = 999)
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", return_value = [FailingProcess()]), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(info) No browser processes currently running" in caplog.text
|
|
|
|
def test_diagnose_browser_issues_handles_global_psutil_failure(
|
|
self, scraper_with_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""diagnose_browser_issues should log a warning if psutil.process_iter fails entirely."""
|
|
caplog.set_level(logging.WARNING)
|
|
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("os.access", return_value = True), \
|
|
patch("psutil.process_iter", side_effect = psutil.Error("boom")), \
|
|
patch("platform.system", return_value = "Linux"), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin._is_admin", return_value = False), \
|
|
patch.object(scraper_with_config, "_diagnose_chrome_version_issues"):
|
|
scraper_with_config.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper_with_config.diagnose_browser_issues()
|
|
|
|
assert "(warn) Unable to inspect browser processes:" in caplog.text
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_validate_chrome_version_configuration_port_open_but_api_inaccessible(
|
|
self, web_scraper:WebScrapingMixin
|
|
) -> None:
|
|
"""Test _validate_chrome_version_configuration when port is open but API is inaccessible."""
|
|
# Configure remote debugging
|
|
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
|
|
with patch.dict("os.environ", {}, clear = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
|
|
|
|
# Should not raise any exceptions and should log the appropriate debug message
|
|
await web_scraper._validate_chrome_version_configuration()
|
|
|
|
# Verify the debug message was logged
|
|
mock_log.debug.assert_any_call(" -> Port is open but remote debugging API not accessible")
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_validate_chrome_version_configuration_remote_detection_exception(
|
|
self, web_scraper:WebScrapingMixin
|
|
) -> None:
|
|
"""Test _validate_chrome_version_configuration when remote detection raises exception."""
|
|
# Configure remote debugging
|
|
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
|
|
with patch.dict("os.environ", {}, clear = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_remote_debugging", side_effect = Exception("Test exception")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
|
|
|
|
# Should not raise any exceptions and should log the appropriate debug message
|
|
await web_scraper._validate_chrome_version_configuration()
|
|
|
|
# Verify the debug message was logged
|
|
# Check that the debug method was called with the expected message
|
|
debug_calls = [call for call in mock_log.debug.call_args_list if "Failed to detect version from existing browser" in str(call)]
|
|
assert len(debug_calls) > 0, "Expected debug message not found"
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_validate_chrome_version_configuration_no_existing_browser(
|
|
self, web_scraper:WebScrapingMixin
|
|
) -> None:
|
|
"""Test _validate_chrome_version_configuration when no existing browser is found."""
|
|
# Configure remote debugging
|
|
web_scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
web_scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
|
|
with patch.dict("os.environ", {}, clear = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.WebScrapingMixin._check_port_with_retry", return_value = False), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.detect_chrome_version_from_binary", return_value = None), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.LOG") as mock_log:
|
|
|
|
# Should not raise any exceptions and should log the appropriate debug message
|
|
await web_scraper._validate_chrome_version_configuration()
|
|
|
|
# Verify the debug message was logged
|
|
mock_log.debug.assert_any_call(" -> No existing browser found at %s:%s", "127.0.0.1", 9222)
|
|
|
|
|
|
class TestWebScrapingMixinPortRetry:
|
|
"""Test the _check_port_with_retry method."""
|
|
|
|
@pytest.fixture
|
|
def scraper_with_remote_config(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with remote debugging configuration."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
scraper.browser_config.arguments = ["--remote-debugging-port=9222"]
|
|
return scraper
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_connection_error_handling(
|
|
self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser connection fails."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to connect as root user")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Failed to connect as root user"):
|
|
await scraper_with_remote_config.create_browser_session()
|
|
|
|
# Check that the error handling was triggered
|
|
assert "Failed to connect to browser. This error often occurs when:" in caplog.text
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_connection_error_handling_non_root_error(
|
|
self, scraper_with_remote_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser connection fails with non-root error."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.net.is_port_open", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Connection timeout")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Connection timeout"):
|
|
await scraper_with_remote_config.create_browser_session()
|
|
|
|
# Should not trigger the root-specific error handling
|
|
assert "Failed to connect to browser. This error often occurs when:" not in caplog.text
|
|
|
|
@pytest.fixture
|
|
def scraper_with_startup_config(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance for testing browser startup (no remote debugging)."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.binary_location = "/usr/bin/chrome"
|
|
# No remote debugging port configured - will start new browser
|
|
return scraper
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_startup_error_handling_root_error(
|
|
self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser startup fails with root error."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Failed to start as root user")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Failed to start as root user"):
|
|
await scraper_with_startup_config.create_browser_session()
|
|
|
|
# Check that the root-specific error handling was triggered
|
|
assert "Failed to start browser. This error often occurs when:" in caplog.text
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_browser_startup_error_handling_non_root_error(
|
|
self, scraper_with_startup_config:WebScrapingMixin, caplog:pytest.LogCaptureFixture
|
|
) -> None:
|
|
"""Test error handling when browser startup fails with non-root error."""
|
|
with patch("os.path.exists", return_value = True), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.files.exists", AsyncMock(return_value = True)), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.start", side_effect = Exception("Browser binary not found")), \
|
|
patch("kleinanzeigen_bot.utils.web_scraping_mixin.nodriver.Config") as mock_config_class:
|
|
|
|
mock_config = Mock()
|
|
mock_config_class.return_value = mock_config
|
|
|
|
with pytest.raises(Exception, match = "Browser binary not found"):
|
|
await scraper_with_startup_config.create_browser_session()
|
|
|
|
# Should not trigger the root-specific error handling
|
|
assert "Failed to start browser. This error often occurs when:" not in caplog.text
|
|
|
|
@pytest.fixture
|
|
def scraper(self) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance."""
|
|
return WebScrapingMixin()
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_success_first_try(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check succeeds on first try."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = True):
|
|
result = await scraper._check_port_with_retry("127.0.0.1", 9222)
|
|
assert result is True
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_success_after_retries(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check succeeds after some retries."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", side_effect = [False, False, True]):
|
|
result = await scraper._check_port_with_retry("127.0.0.1", 9222, max_retries = 3, retry_delay = 0.1)
|
|
assert result is True
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_failure_after_max_retries(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check fails after max retries."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", return_value = False):
|
|
result = await scraper._check_port_with_retry("127.0.0.1", 9222, max_retries = 2, retry_delay = 0.1)
|
|
assert result is False
|
|
|
|
@pytest.mark.asyncio
|
|
async def test_check_port_with_retry_custom_parameters(self, scraper:WebScrapingMixin) -> None:
|
|
"""Test port check with custom retry parameters."""
|
|
with patch("kleinanzeigen_bot.utils.net.is_port_open", side_effect = [False, True]):
|
|
result = await scraper._check_port_with_retry("192.168.1.100", 8080, max_retries = 5, retry_delay = 0.05)
|
|
assert result is True
|
|
|
|
|
|
class TestWebScrapingMixinProfileHandling:
|
|
"""Test the enhanced profile directory handling."""
|
|
|
|
@pytest.fixture
|
|
def scraper_with_profile_config(self, tmp_path:Path) -> WebScrapingMixin:
|
|
"""Create a WebScrapingMixin instance with profile configuration."""
|
|
scraper = WebScrapingMixin()
|
|
scraper.browser_config.user_data_dir = str(tmp_path / "test-profile")
|
|
scraper.browser_config.profile_name = "TestProfile"
|
|
return scraper
|
|
|
|
def test_profile_directory_creation_with_user_data_dir(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation when user_data_dir is configured."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.path.join", return_value = os.path.join(test_dir, "TestProfile")), \
|
|
patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()), \
|
|
patch("json.dump"):
|
|
|
|
# This would be called during browser session creation
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
mock_makedirs.assert_not_called() # Not called yet
|
|
|
|
# Simulate the profile creation logic
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
def test_profile_directory_creation_with_preferences_file(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation with preferences file when it doesn't exist."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()) as mock_file, \
|
|
patch("json.dump") as mock_json_dump:
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
prefs_file = os.path.join(profile_dir, "Preferences")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
# Simulate preferences file creation
|
|
with open(prefs_file, "w", encoding = "UTF-8") as fd:
|
|
json.dump({"test": "preferences"}, fd)
|
|
|
|
mock_file.assert_called_with(prefs_file, "w", encoding = "UTF-8")
|
|
mock_json_dump.assert_called()
|
|
|
|
def test_profile_directory_creation_with_existing_preferences_file(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation when preferences file already exists."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = True), \
|
|
patch("builtins.open", mock_open()) as mock_file, \
|
|
patch("json.dump") as mock_json_dump:
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
# Preferences file exists, so it should not be created
|
|
mock_file.assert_not_called()
|
|
mock_json_dump.assert_not_called()
|
|
|
|
def test_profile_directory_creation_with_edge_browser(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation with Edge browser configuration."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_profile_config.browser_config.binary_location = "/usr/bin/microsoft-edge"
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()), \
|
|
patch("json.dump"), \
|
|
patch("os.environ", {"MSEDGEDRIVER_TELEMETRY_OPTOUT": "1"}):
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
def test_profile_directory_creation_with_private_window(
|
|
self, scraper_with_profile_config:WebScrapingMixin, tmp_path:Path
|
|
) -> None:
|
|
"""Test profile directory creation with private window configuration."""
|
|
test_dir = str(tmp_path / "test-profile")
|
|
scraper_with_profile_config.browser_config.user_data_dir = test_dir
|
|
scraper_with_profile_config.browser_config.use_private_window = True
|
|
|
|
with patch("os.makedirs") as mock_makedirs, \
|
|
patch("os.path.exists", return_value = False), \
|
|
patch("builtins.open", mock_open()), \
|
|
patch("json.dump"):
|
|
|
|
# Simulate the profile creation logic
|
|
profile_dir = os.path.join(test_dir, "TestProfile")
|
|
|
|
# This would be called during browser session creation
|
|
os.makedirs(profile_dir, exist_ok = True)
|
|
mock_makedirs.assert_called_with(profile_dir, exist_ok = True)
|
|
|
|
def test_profile_directory_creation_without_user_data_dir(
|
|
self, scraper_with_profile_config:WebScrapingMixin
|
|
) -> None:
|
|
"""Test profile directory handling when user_data_dir is not configured."""
|
|
scraper_with_profile_config.browser_config.user_data_dir = None
|
|
|
|
# Should not create profile directories when user_data_dir is None
|
|
with patch("os.path.join") as mock_join, \
|
|
patch("os.makedirs") as mock_makedirs:
|
|
|
|
# The profile creation logic should not be called
|
|
mock_join.assert_not_called()
|
|
mock_makedirs.assert_not_called()
|
|
|
|
|
|
class TestWebScrapingMixinAdminCheck:
|
|
"""Test the _is_admin helper function."""
|
|
|
|
def test_is_admin_on_unix_system(self) -> None:
|
|
"""Test _is_admin function on Unix-like system."""
|
|
# Create a mock os module with geteuid
|
|
mock_os = Mock()
|
|
mock_os.geteuid = Mock(return_value = 0)
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is True
|
|
|
|
def test_is_admin_on_unix_system_not_root(self) -> None:
|
|
"""Test _is_admin function on Unix-like system when not root."""
|
|
# Create a mock os module with geteuid
|
|
mock_os = Mock()
|
|
mock_os.geteuid = Mock(return_value = 1000)
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is False
|
|
|
|
def test_is_admin_on_windows_system(self) -> None:
|
|
"""Test _is_admin function on Windows system."""
|
|
# Create a mock os module without geteuid
|
|
mock_os = Mock()
|
|
# Remove geteuid attribute to simulate Windows
|
|
del mock_os.geteuid
|
|
|
|
with patch("kleinanzeigen_bot.utils.web_scraping_mixin.os", mock_os):
|
|
assert _is_admin() is False
|